Sfoglia il codice sorgente

mobile android/ios fixes and other important fixes

- typos on touchaction for IE10+ #658
- MS Edge (14+) detection fixed
#655
- webkitCancelRequestAnimationFrame deprecated #650
-
enableobserver option added #643
- Bug in bower.json #617
- Versions
from "3.6.7" to "latest" brokes scroll on touch devices #634
-
Horizontal scroll doesn't work on mobile devices tested with chrome &
firefox on Android #646
- How to Scroll in Mobile Device #626
- 3.6.7
not working on ios or android #574
- On iPhone safari does not work
#649
- Touch scrolling leads to a click event on Windows touch (Edge and
Firefox browser) #614
- Nicescroll not working in IOS 9+ #611
- fixed
ghost horizontal scrollbar
- enableobserver (default:true), attach Mutation Observers (or
alternative observers) to monitoring any attribute change at nicescroll
DOM, on performance issue you can disable
- deprecated touchbehavior, new touchemulate option, name changing I
hope solve many misunderstanding about this option meaning
- a little
more saving on zoomico.png (from 393b to 254b)
InuYaksa 8 anni fa
parent
commit
d4bb7f786a

+ 1 - 1
MIT.LICENSE

@@ -2,7 +2,7 @@ Open Source Initiative OSI - The MIT License (MIT):Licensing
 [OSI Approved License]
 [OSI Approved License]
 The MIT License (MIT)
 The MIT License (MIT)
 
 
-Copyright (c) 2011-14 InuYaksa
+Copyright (c) 2011-17 InuYaksa
 
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated
 documentation files (the "Software"), to deal in the Software without restriction, including without limitation
 documentation files (the "Software"), to deal in the Software without restriction, including without limitation

+ 7 - 6
README.md

@@ -1,5 +1,5 @@
 #jQuery.NiceScroll
 #jQuery.NiceScroll
-v. 3.6.8 02-29-2016
+v. 3.7.0 2017-05-21
 
 
  - [Web Site: nicescroll.areaaperta.com](http://nicescroll.areaaperta.com)
  - [Web Site: nicescroll.areaaperta.com](http://nicescroll.areaaperta.com)
  - [Repo: github.com/inuyaksa/jquery.nicescroll](https://github.com/inuyaksa/jquery.nicescroll)
  - [Repo: github.com/inuyaksa/jquery.nicescroll](https://github.com/inuyaksa/jquery.nicescroll)
@@ -14,13 +14,13 @@ v. 3.6.8 02-29-2016
 
 
   - HORIZONAL scrollbar support!
   - HORIZONAL scrollbar support!
   - It supports DIVs, IFrames, textarea, and document page (body) scrollbars.
   - It supports DIVs, IFrames, textarea, and document page (body) scrollbars.
-  - Compatible with all desktop browser: Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+. (all A-grade browsers)
-  - Compatible with mobile device: iPad/iPhone/iPod, Android 2.2+, Blackberry phones and Playbook (WebWorks/Table OS), Windows Phone 7.5 Mango.
+  - Compatible with all recent desktop browser and older: Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+. (all A-grade browsers)
+  - Compatible with mobile device: iPad/iPhone/iPod, Android 2.2+, Blackberry phones and Playbook (WebWorks/Table OS), Windows Phone 10 and older.
   - Compatible with all touch devices: iPad, Android tablets, Window Surface.
   - Compatible with all touch devices: iPad, Android tablets, Window Surface.
   - Compabible with multi-input device (mouse with touch or pen): Window Surface, Chrome Desktop on touch notebook.
   - Compabible with multi-input device (mouse with touch or pen): Window Surface, Chrome Desktop on touch notebook.
   - Compatible with 2 directions mice: Apple Magic Mouse, Apple Mouser with 2-dir wheel, PC mouse with 2-dir wheel (if browser support it).
   - Compatible with 2 directions mice: Apple Magic Mouse, Apple Mouser with 2-dir wheel, PC mouse with 2-dir wheel (if browser support it).
 
 
-So you have scrollable divs with momentum for iPad 4+ and you have consistent scrollable areas for all desktop and mobile platforms.
+So you have customizable and scrollable divs with momentum for iPad and you have consistent scrollable areas for all desktop and mobile platforms.
 
 
 Sexy zoom feature, you can "zoom-in" the content of any nicescroll'ed div.
 Sexy zoom feature, you can "zoom-in" the content of any nicescroll'ed div.
 Nice to use and nice to see, all the content of the div in fullscreen mode.
 Nice to use and nice to see, all the content of the div in fullscreen mode.
@@ -123,7 +123,8 @@ $("#thisdiv").niceScroll({
     zindex: "auto" | <number>, // change z-index for scrollbar div
     zindex: "auto" | <number>, // change z-index for scrollbar div
     scrollspeed: 60, // scrolling speed
     scrollspeed: 60, // scrolling speed
     mousescrollstep: 40, // scrolling speed with mouse wheel (pixel)
     mousescrollstep: 40, // scrolling speed with mouse wheel (pixel)
-    touchbehavior: false, // enable cursor-drag scrolling like touch devices in desktop computer
+    touchbehavior: false, // DEPRECATED!! use "touchemulate"
+    touchemulate: false, // enable cursor-drag scrolling like touch devices in desktop computer
     hwacceleration: true, // use hardware accelerated scroll when supported
     hwacceleration: true, // use hardware accelerated scroll when supported
     boxzoom: false, // enable zoom for box content
     boxzoom: false, // enable zoom for box content
     dblclickzoom: true, // (only when boxzoom=true) zoom activated when double click on box
     dblclickzoom: true, // (only when boxzoom=true) zoom activated when double click on box
@@ -176,7 +177,7 @@ Related projects
 
 
 * LICENSE
 * LICENSE
 
 
-## Copyright 2011-16 InuYaksa
+## Copyright 2011-17 InuYaksa
 
 
 ######Licensed under the MIT License, http://www.opensource.org/licenses/mit-license.php
 ######Licensed under the MIT License, http://www.opensource.org/licenses/mit-license.php
 ######Images used for zoom icons have derived from OLPC interface, http://laptop.org/8.2.0/manual/Browse_ChangingView.html
 ######Images used for zoom icons have derived from OLPC interface, http://laptop.org/8.2.0/manual/Browse_ChangingView.html

+ 1 - 1
bower.json

@@ -1,7 +1,7 @@
 {
 {
     "name": "jquery.nicescroll",
     "name": "jquery.nicescroll",
     "main": [
     "main": [
-        "./jquery.nicescroll.js"
+        "./jquery.nicescroll.min.js"
     ],
     ],
     "ignore": [
     "ignore": [
         "**/.*",
         "**/.*",

+ 0 - 31
changelog_3.6.8.txt

@@ -1,31 +0,0 @@
-Changelog nicescroll release 3.6.8
-http://nicescroll.areaaperta.com/
-https://github.com/inuyaksa/jquery.nicescroll
-
-
-Changed features
-
-New options
-- disablemutationobserver, = TRUE when you want that MutationObserver disabled #580
-
-Fixes
-- Fix show of null #583
-- Refactoring js #582
-- Removed comments #577
-- Timeouts & using on dynamic DOM Elements: "Uncaught TypeError" #579
-- version 3.6.6 stack overflow #578 
-- MutationObserver. IE11 crashes #568 
-- Xbox One IE Edge browser can't scroll anywhere #581 (to test on real hw!)
-- NIce Scroll doesnt work on Window Surface IE Edge #555
-
-
-Thanks to great contributors!!
-@silversonicaxel
-@vsn4ik
-@ronar
-@StephanBijzitter
- 
-
-
-TODO
-- deprecate legacy browsers

+ 40 - 0
changelog_3.7.0.txt

@@ -0,0 +1,40 @@
+Changelog nicescroll release 3.7.0
+http://nicescroll.areaaperta.com/
+https://github.com/inuyaksa/jquery.nicescroll
+
+
+Fixes
+- typos on touchaction for IE10+ #658
+- MS Edge (14+) detection fixed #655
+- webkitCancelRequestAnimationFrame deprecated #650
+- enableobserver option added #643
+- Bug in bower.json #617
+- Versions from "3.6.7" to "latest" brokes scroll on touch devices #634
+- Horizontal scroll doesn't work on mobile devices tested with chrome & firefox on Android #646
+- How to Scroll in Mobile Device #626
+- 3.6.7 not working on ios or android #574
+- On iPhone safari does not work #649
+- Touch scrolling leads to a click event on Windows touch (Edge and Firefox browser) #614
+- Nicescroll not working in IOS 9+ #611
+- fixed ghost horizontal scrollbar
+
+
+New options
+- enableobserver (default:true), attach Mutation Observers (or alternative observers) to monitoring any attribute change at nicescroll DOM, on performance issue you can disable
+
+
+Changes 
+- deprecated touchbehavior, new touchemulate option, name changing I hope solve many misunderstanding about this option meaning
+
+
+TODO
+- railpadding
+- railpadding top & bottom settings ignored - thanks to simovinci.bellissimo
+- honorcssoverflow
+- autohidemode:hover
+- check 2D scrolling
+- check text selection on cursor drag (testing)
+- recursive position:fixed check
+- check horiz mouse wheel scrolling speed on chrome
+- mouse pan scroll
+

+ 9 - 6
demo/browser.html

@@ -1,4 +1,4 @@
-<!DOCTYPE html>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
 <html xmlns="http://www.w3.org/1999/xhtml">
 <html xmlns="http://www.w3.org/1999/xhtml">
 <head>
 <head>
 <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
 <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
@@ -24,7 +24,7 @@ body {
 }
 }
 </style>
 </style>
 
 
-<script src="//code.jquery.com/jquery-1.11.3.min.js"></script>
+<script src="//code.jquery.com/jquery-1.11.1.min.js"></script>
 <script src="js/jquery.nicescroll.min.js"></script>
 <script src="js/jquery.nicescroll.min.js"></script>
 
 
 <script>
 <script>
@@ -34,7 +34,7 @@ body {
     nice = $("html").niceScroll();
     nice = $("html").niceScroll();
   });
   });
   
   
-  var obj = window;
+  var obj = window;//$(window);
   
   
   console.log(obj.length);
   console.log(obj.length);
   console.log("selector" in obj);
   console.log("selector" in obj);
@@ -63,6 +63,7 @@ body {
 	toCell(3,6,nice.detected.isieold);
 	toCell(3,6,nice.detected.isieold);
 
 
   toCell(7,1,nice.detected.isie11);
   toCell(7,1,nice.detected.isie11);
+  toCell(7,2,nice.detected.ismsedge);
   
   
 	toCell(4,1,nice.detected.isopera);
 	toCell(4,1,nice.detected.isopera);
   toCell(4,2,nice.detected.isopera12);
   toCell(4,2,nice.detected.isopera12);
@@ -70,6 +71,8 @@ body {
 	
 	
 	toCell(5,1,nice.detected.isios);
 	toCell(5,1,nice.detected.isios);
 	toCell(5,2,nice.detected.isios4);
 	toCell(5,2,nice.detected.isios4);
+  toCell(5,3,nice.detected.isios8);
+  toCell(5,4,nice.detected.isios10);
 
 
   toCell(6,1,nice.detected.ischrome);
   toCell(6,1,nice.detected.ischrome);
 	toCell(6,2,nice.detected.ischrome22);
 	toCell(6,2,nice.detected.ischrome22);
@@ -135,7 +138,7 @@ body {
     <td bgcolor="#E0E0E9">Opera&nbsp;12</td>
     <td bgcolor="#E0E0E9">Opera&nbsp;12</td>
     <td bgcolor="#E0E0E9">iOS4- <span class="num">(6)</span></td>
     <td bgcolor="#E0E0E9">iOS4- <span class="num">(6)</span></td>
 		<td bgcolor="#E0E0E9">Chrome 22+</td>
 		<td bgcolor="#E0E0E9">Chrome 22+</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">MSEdge</td>
   </tr>
   </tr>
   <tr>
   <tr>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
@@ -143,7 +146,7 @@ body {
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">IE9+</td>
     <td bgcolor="#E0E0E9">IE9+</td>
     <td bgcolor="#E0E0E9">Opera&nbsp;Mini</td>
     <td bgcolor="#E0E0E9">Opera&nbsp;Mini</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">iOS8</td>
 		<td bgcolor="#E0E0E9">Chrome 26+</td>
 		<td bgcolor="#E0E0E9">Chrome 26+</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
   </tr>
   </tr>
@@ -153,7 +156,7 @@ body {
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">IE8</td>
     <td bgcolor="#E0E0E9">IE8</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">iOS10</td>
 		<td bgcolor="#E0E0E9">&nbsp;</td>
 		<td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
   </tr>
   </tr>

File diff suppressed because it is too large
+ 1 - 120
demo/js/jquery.nicescroll.min.js


+ 3847 - 0
dist/jquery.nicescroll.js

@@ -0,0 +1,3847 @@
+/* jquery.nicescroll
+-- version 3.7.0 [maintenance edition]
+-- copyright 2017-05-21 InuYaksa*2017
+-- licensed under the MIT
+--
+-- http://nicescroll.areaaperta.com/
+-- https://github.com/inuyaksa/jquery.nicescroll
+--
+*/
+
+(function(factory) {
+  if (typeof define === 'function' && define.amd) {
+    // AMD. Register as anonymous module.
+    define(['jquery'], factory);
+  } else if (typeof exports === 'object') {
+    // Node/CommonJS.
+    module.exports = factory(require('jquery'));
+  } else {
+    // Browser globals.
+    factory(jQuery);
+  }
+}(function(jQuery) {
+  "use strict";
+
+  // globals
+  var domfocus = false;
+  var mousefocus = false;
+  var tabindexcounter = 0;
+  var ascrailcounter = 2000;
+  var globalmaxzindex = 0;
+
+  var $ = jQuery; // sandbox
+
+  // http://stackoverflow.com/questions/2161159/get-script-path
+  function getScriptPath() {
+    var scripts = document.getElementsByTagName('script');
+    var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
+    return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
+  }
+
+  // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/  
+  var setAnimationFrame = (function(){ return window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || false; })();
+  var clearAnimationFrame = (function(){ return window.cancelAnimationFrame || window.webkitCancelAnimationFrame || window.mozCancelAnimationFrame || false; })();  
+  if (!setAnimationFrame) {
+    setAnimationFrame = function(callback, element) {
+      var currTime = new Date().getTime();
+      var timeToCall = Math.max(0, 16 - (currTime - lastTime));
+      var id = window.setTimeout(function() { callback(currTime + timeToCall); },
+        timeToCall);
+      lastTime = currTime + timeToCall;
+      return id;
+    };
+    clearAnimationFrame = function(id) {
+      window.clearTimeout(id);
+    };
+  } else {
+    if (!window.cancelAnimationFrame) clearAnimationFrame = function(id) {};
+  }
+
+  var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
+
+  var _globaloptions = {
+    zindex: "auto",
+    cursoropacitymin: 0,
+    cursoropacitymax: 1,
+    cursorcolor: "#424242",
+    cursorwidth: "6px",
+    cursorborder: "1px solid #fff",
+    cursorborderradius: "5px",
+    scrollspeed: 60,
+    mousescrollstep: 8 * 3,
+    touchbehavior: false,   // deprecated
+    emulatetouch: false,    // replacing touchbehavior
+    hwacceleration: true,
+    usetransition: true,
+    boxzoom: false,
+    dblclickzoom: true,
+    gesturezoom: true,
+    grabcursorenabled: true,
+    autohidemode: true,
+    background: "",
+    iframeautoresize: true,
+    cursorminheight: 32,
+    preservenativescrolling: true,
+    railoffset: false,
+    railhoffset: false,
+    bouncescroll: true,
+    spacebarenabled: true,
+    railpadding: {
+      top: 0,
+      right: 0,
+      left: 0,
+      bottom: 0
+    },
+    disableoutline: true,
+    horizrailenabled: true,
+    railalign: "right",
+    railvalign: "bottom",
+    enabletranslate3d: true,
+    enablemousewheel: true,
+    enablekeyboard: true,
+    smoothscroll: true,
+    sensitiverail: true,
+    enablemouselockapi: true,
+    //      cursormaxheight:false,
+    cursorfixedheight: false,
+    directionlockdeadzone: 6,
+    hidecursordelay: 400,
+    nativeparentscrolling: true,
+    enablescrollonselection: true,
+    overflowx: true,
+    overflowy: true,
+    cursordragspeed: 0.3,
+    rtlmode: "auto",
+    cursordragontouch: false,
+    oneaxismousemode: "auto",
+    scriptpath: getScriptPath(),
+    preventmultitouchscrolling: true,
+    disablemutationobserver:false,
+    enableobserver:true
+  };
+
+  var browserdetected = false;
+
+  var getBrowserDetection = function() {
+
+    if (browserdetected) return browserdetected;
+
+    var _el = document.createElement('DIV'),
+        _style = _el.style,
+        _agent = navigator.userAgent,
+        _platform = navigator.platform,
+        d = {};
+
+    d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
+
+    d.isopera = ("opera" in window); // 12-
+    d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
+    d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
+
+    d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
+    d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
+    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode === 7));
+    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode === 8);
+    d.isie9 = d.isie && ("performance" in window) && (document.documentMode === 9);
+    d.isie10 = d.isie && ("performance" in window) && (document.documentMode === 10);
+    d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
+
+    d.ismsedge = ("msCredentials" in window);  // MS Edge 14+
+
+    d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
+    if (d.isie9mobile) d.isie9 = false;
+    d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
+
+    d.ismozilla = ("MozAppearance" in _style);
+
+    d.iswebkit = !d.ismsedge&&("WebkitAppearance" in _style);
+
+    d.ischrome = !d.ismsedge&&("chrome" in window);
+    d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
+    d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
+    d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
+    
+    d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation    
+    d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
+    d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events
+
+    d.ismac = /^mac$/i.test(_platform);
+    
+    d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
+    d.isios4 = ((d.isios) && !("seal" in Object));
+    d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
+    d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
+    d.isios10 = (d.isios&&window.Proxy);  //iOS 10+
+
+    d.isandroid = (/android/i.test(_agent));
+
+    d.haseventlistener = ("addEventListener" in _el);
+    
+    d.trstyle = false;
+    d.hastransform = false;
+    d.hastranslate3d = false;
+    d.transitionstyle = false;
+    d.hastransition = false;
+    d.transitionend = false;
+
+    d.trstyle = "transform";
+    d.hastransform = ("transform" in _style)||(function(){
+      var a;
+      var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
+      for (a = 0; a < check.length; a++) {
+        if (_style[check[a]] !== undefined) {
+          d.trstyle = check[a];
+          break;
+        }
+      }
+      d.hastransform = (!!d.trstyle);
+    })(); 
+
+    if (d.hastransform) {
+      _style[d.trstyle] = "translate3d(1px,2px,3px)";
+      d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
+    }
+
+    d.transitionstyle = "transition";
+    d.prefixstyle = '';
+    d.transitionend = "transitionend";
+
+    d.hastransition = ("transition" in _style)||(function(){
+
+      d.transitionend = false;
+      var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+      var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+      var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+      for (var a = 0; a < check.length; a++) {
+        if (check[a] in _style) {
+          d.transitionstyle = check[a];
+          d.prefixstyle = prefix[a];
+          d.transitionend = evs[a];
+          break;
+        }
+      }    
+      if (d.ischrome26) {  // always use prefix
+        d.prefixstyle = prefix[1];
+      }
+      d.hastransition = (d.transitionstyle);
+
+    })();
+
+
+
+    function detectCursorGrab() {
+      var lst = ['grab','-webkit-grab', '-moz-grab'];
+      if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
+      for (var a = 0; a < lst.length; a++) {
+        var p = lst[a];
+        _style.cursor = p;
+        if (_style.cursor == p) return p;
+      }
+      return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thank to https://cdnjs.com/ for the openhand cursor!
+    }
+    d.cursorgrabvalue = detectCursorGrab();
+
+    d.hasmousecapture = ("setCapture" in _el);
+
+    d.hasMutationObserver = (ClsMutationObserver !== false);
+
+    _el = null; //memory released
+
+    browserdetected = d;
+
+    return d;
+  };
+
+  var NiceScrollClass = function(myopt, me) {
+
+    var self = this;
+
+    this.version = '3.7.0';
+    this.name = 'nicescroll';
+
+    this.me = me;
+
+    this.opt = {
+      doc: $("body"),
+      win: false
+    };
+
+    $.extend(this.opt, _globaloptions);  // clone opts
+
+    // Options for internal use
+    this.opt.snapbackspeed = 80;
+
+    if (myopt || false) {
+      for (var a in self.opt) {
+        if (myopt[a] !== undefined) self.opt[a] = myopt[a];
+      }
+    }
+
+    if (self.opt.disablemutationobserver) ClsMutationObserver = false;
+    
+    this.doc = self.opt.doc;
+    this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
+    this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
+    this.haswrapper = (self.opt.win !== false);
+    this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
+    this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
+    this.body = $("body");
+    this.viewport = false;
+
+    this.isfixed = false;
+
+    this.iframe = false;
+    this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
+
+    this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
+
+    this.forcescreen = false; //force to use screen position on events
+
+    this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
+
+    // Events jump table    
+    this.onmousedown = false;
+    this.onmouseup = false;
+    this.onmousemove = false;
+    this.onmousewheel = false;
+    this.onkeypress = false;
+    this.ongesturezoom = false;
+    this.onclick = false;
+
+    // Nicescroll custom events
+    this.onscrollstart = false;
+    this.onscrollend = false;
+    this.onscrollcancel = false;
+
+    this.onzoomin = false;
+    this.onzoomout = false;
+
+    // Let's start!  
+    this.view = false;
+    this.page = false;
+
+    this.scroll = {
+      x: 0,
+      y: 0
+    };
+    this.scrollratio = {
+      x: 0,
+      y: 0
+    };
+    this.cursorheight = 20;
+    this.scrollvaluemax = 0;
+
+    // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
+    // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
+    if (this.opt.rtlmode == "auto") {
+      var target = this.win[0] == window ? this.body : this.win;
+      var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
+
+      if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") {
+        this.isrtlmode = (target.css("direction") == "rtl");
+        this.isvertical = false;
+      } else {
+        this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
+        this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
+      }
+    } else {
+      this.isrtlmode = (this.opt.rtlmode === true);
+      this.isvertical = false;
+    }
+    //    this.checkrtlmode = false;
+    
+    this.scrollrunning = false;
+
+    this.scrollmom = false;
+
+    this.observer        = false;  // observer div changes
+    this.observerremover = false;  // observer on parent for remove detection
+    this.observerbody    = false;  // observer on body for position change
+
+    do {
+      this.id = "ascrail" + (ascrailcounter++);
+    } while (document.getElementById(this.id));
+
+    this.rail = false;
+    this.cursor = false;
+    this.cursorfreezed = false;
+    this.selectiondrag = false;
+
+    this.zoom = false;
+    this.zoomactive = false;
+
+    this.hasfocus = false;
+    this.hasmousefocus = false;
+
+    this.visibility = true;
+    this.railslocked = false;  // locked by resize
+    this.locked = false;  // prevent lost of locked status sets by user
+    this.hidden = false; // rails always hidden
+    this.cursoractive = true; // user can interact with cursors
+
+    this.wheelprevented = false; //prevent mousewheel event
+
+    this.overflowx = self.opt.overflowx;
+    this.overflowy = self.opt.overflowy;
+
+    this.nativescrollingarea = false;
+    this.checkarea = 0;
+
+    this.events = []; // event list for unbind
+
+    this.saved = {};  // style saved
+
+    this.delaylist = {};
+    this.synclist = {};
+
+    this.lastdeltax = 0;
+    this.lastdeltay = 0;
+
+    this.detected = getBrowserDetection();
+
+    var cap = $.extend({}, this.detected);
+
+    this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
+    this.ishwscroll = (this.canhwscroll && self.haswrapper);
+
+    if (!this.isrtlmode) {
+      this.hasreversehr = false;
+    } else if (this.isvertical) { // RTL mode with reverse horizontal axis
+      this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
+    } else {
+      this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
+    }
+
+    this.istouchcapable = false; // desktop devices with touch screen support
+
+    //## Check WebKit-based desktop with touch support
+    //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
+    
+    if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) {  // desktop device with multiple input
+      this.istouchcapable = true;
+    } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
+      this.istouchcapable = true;
+//      cap.cantouch = false; // parse normal desktop events
+    }
+
+    //## disable MouseLock API on user request
+    if (!self.opt.enablemouselockapi) {
+      cap.hasmousecapture = false;
+      cap.haspointerlock = false;
+    }
+
+/* deprecated
+    this.delayed = function(name, fn, tm, lazy) {
+    };
+*/    
+
+/*
+    this.debounced = function(name, fn, tm) {
+		if (!self) return;
+      var dd = self.delaylist[name];
+      self.delaylist[name] = fn;
+      if (!dd) {
+        self.debouncedelayed =  setTimeout(function() {
+					if (!self) return;
+          var fn = self.delaylist[name];
+          self.delaylist[name] = false;
+          fn.call(self);
+        }, tm);
+      }
+    };
+*/
+
+		this.debounced = function(name, fn, tm) {
+      if (!self) return;
+			var dd = self.delaylist[name]||false;
+			if (!dd) {
+        //fixed loop call fn:checkSelectionScroll
+				//fn.call(self);				
+				self.delaylist[name] = {
+					h: setAnimationFrame(function(){
+						self.delaylist[name].fn.call(self);
+					  self.delaylist[name] = false;	
+					}, tm)
+				};
+        fn.call(self);
+			}			
+			self.delaylist[name].fn = fn;				
+		};
+
+    var _onsync = false;
+
+    this.synched = function(name, fn) {
+
+      function requestSync() {
+        if (_onsync) return;
+        setAnimationFrame(function() {
+          if (!self) return;
+          _onsync = false;
+          for (var nn in self.synclist) {
+            var fn = self.synclist[nn];
+            if (fn) fn.call(self);
+            self.synclist[nn] = false;
+          }
+        });
+        _onsync = true;
+      }
+
+      self.synclist[name] = fn;
+      requestSync();
+      return name;
+    };
+
+    this.unsynched = function(name) {
+      if (self.synclist[name]) self.synclist[name] = false;
+    };
+
+    this.css = function(el, pars) { // save & set
+      for (var n in pars) {
+        self.saved.css.push([el, n, el.css(n)]);
+        el.css(n, pars[n]);
+      }
+    };
+
+    this.scrollTop = function(val) {
+      return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
+    };
+
+    this.scrollLeft = function(val) {
+      return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
+    };
+
+    // derived by by Dan Pupius www.pupius.net
+    var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
+    
+      this.st = st;
+      this.ed = ed;
+      this.spd = spd;
+
+      this.p1 = p1 || 0;
+      this.p2 = p2 || 1;
+      this.p3 = p3 || 0;
+      this.p4 = p4 || 1;
+
+      this.ts = (new Date()).getTime();
+      this.df = this.ed - this.st;
+    };
+    BezierClass.prototype = {
+      B2: function(t) {
+        return 3 * t * t * (1 - t);
+      },
+      B3: function(t) {
+        return 3 * t * (1 - t) * (1 - t);
+      },
+      B4: function(t) {
+        return (1 - t) * (1 - t) * (1 - t);
+      },
+      getNow: function() {
+        var nw = (new Date()).getTime();
+        var pc = 1 - ((nw - this.ts) / this.spd);
+        var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
+        return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
+      },
+      update: function(ed, spd) {
+        this.st = this.getNow();
+        this.ed = ed;
+        this.spd = spd;
+        this.ts = (new Date()).getTime();
+        this.df = this.ed - this.st;
+        return this;
+      }
+    };
+
+    //derived from http://stackoverflow.com/questions/11236090/
+    function getMatrixValues() {
+      var tr = self.doc.css(cap.trstyle);
+      if (tr && (tr.substr(0, 6) == "matrix")) {
+        return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
+      }
+      return false;
+    }
+
+    if (this.ishwscroll) {
+      // hw accelerated scroll
+      this.doc.translate = {
+        x: 0,
+        y: 0,
+        tx: "0px",
+        ty: "0px"
+      };
+
+      //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
+      if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/      
+
+      this.getScrollTop = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
+        }
+        return self.doc.translate.y;
+      };
+
+      this.getScrollLeft = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
+        }
+        return self.doc.translate.x;
+      };
+
+      this.notifyScrollEvent = function(el) {
+        var e = document.createEvent("UIEvents");
+        e.initUIEvent("scroll", false, true, window, 1);
+        e.niceevent = true;
+        el.dispatchEvent(e);
+      };
+
+      var cxscrollleft = (this.isrtlmode) ? 1 : -1;
+
+      if (cap.hastranslate3d && self.opt.enabletranslate3d) {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      } else {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      }
+    } else {
+      // native scroll
+      this.getScrollTop = function() {
+        return self.docscroll.scrollTop();
+      };
+      this.setScrollTop = function(val) {
+        return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1);
+      };
+      this.getScrollLeft = function() {
+        var val;
+        if (!self.hasreversehr) {
+          val = self.docscroll.scrollLeft();
+        } else if (self.detected.ismozilla) {
+          val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
+        } else {
+          val = self.page.maxw - self.docscroll.scrollLeft();
+        }
+        return val;
+      };
+      this.setScrollLeft = function(val) {
+        return setTimeout(function() {
+          if (!self) return;
+					if (self.hasreversehr) {
+						if (self.detected.ismozilla) {
+							val = -(self.page.maxw - val);
+						} else {
+							val = self.page.maxw - val;
+						}
+					}
+					return self.docscroll.scrollLeft(val);
+				}, 1);					
+      };
+    }
+
+    this.getTarget = function(e) {
+      if (!e) return false;
+      if (e.target) return e.target;
+      if (e.srcElement) return e.srcElement;
+      return false;
+    };
+
+    this.hasParent = function(e, id) {
+      if (!e) return false;
+      var el = e.target || e.srcElement || e || false;
+      while (el && el.id != id) {
+        el = el.parentNode || false;
+      }
+      return (el !== false);
+    };
+
+    function getZIndex() {
+      var dom = self.win;
+      if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
+      while (dom.length > 0) {
+        if (dom[0].nodeType == 9) return false;
+        var zi = dom.css('zIndex');
+        if (!isNaN(zi) && zi != 0) return parseInt(zi);
+        dom = dom.parent();
+      }
+      return false;
+    }
+
+    //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
+    var _convertBorderWidth = {
+      "thin": 1,
+      "medium": 3,
+      "thick": 5
+    };
+
+    function getWidthToPixel(dom, prop, chkheight) {
+      var wd = dom.css(prop);
+      var px = parseFloat(wd);
+      if (isNaN(px)) {
+        px = _convertBorderWidth[wd] || 0;
+        var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
+        if (self.isie8 && px) px += 1;
+        return (brd) ? px : 0;
+      }
+      return px;
+    }
+
+    this.getDocumentScrollOffset = function() {
+      return {
+        top: window.pageYOffset || document.documentElement.scrollTop,
+        left: window.pageXOffset || document.documentElement.scrollLeft
+      };
+    };
+    
+    this.getOffset = function() {
+      if (self.isfixed) {
+        var ofs = self.win.offset();  // fix Chrome auto issue (when right/bottom props only)
+        var scrl = self.getDocumentScrollOffset();
+        ofs.top-=scrl.top;
+        ofs.left-=scrl.left;
+        return ofs;  
+      }
+      var ww = self.win.offset();
+      if (!self.viewport) return ww;      
+      var vp = self.viewport.offset();
+      return {
+        top: ww.top - vp.top,// + self.viewport.scrollTop(),
+        left: ww.left - vp.left // + self.viewport.scrollLeft()
+      };
+    };
+
+    this.updateScrollBar = function(len) {
+      var pos, off;
+      if (self.ishwscroll) {
+        self.rail.css({  //**
+          height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+        if (self.railh) self.railh.css({  //**
+          width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
+        });
+        
+      } else {
+        var wpos = self.getOffset();
+        pos = {
+          top: wpos.top,
+          left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
+        };
+        pos.top += getWidthToPixel(self.win, 'border-top-width', true);
+        pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
+
+        off = self.opt.railoffset;
+        if (off) {
+          if (off.top) pos.top += off.top;
+          if (off.left) pos.left += off.left;
+        }
+        
+        if (!self.railslocked) self.rail.css({
+          top: pos.top,
+          left: pos.left,
+          height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+
+        if (self.zoom) {
+          self.zoom.css({
+            top: pos.top + 1,
+            left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
+          });
+        }
+
+        if (self.railh && !self.railslocked) {
+          pos = {
+            top: wpos.top,
+            left: wpos.left
+          };
+          off = self.opt.railhoffset;
+          if (off) {
+            if (off.top) pos.top += off.top;
+            if (off.left) pos.left += off.left;
+          }
+          var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
+          var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
+          self.railh.css({
+            top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
+            left: x,
+            width: self.railh.width
+          });
+        }
+
+      }
+    };
+
+    this.doRailClick = function(e, dbl, hr) {
+      var fn, pg, cur, pos;
+
+      if (self.railslocked) return;
+      self.cancelEvent(e);
+
+      if (dbl) {
+        fn = (hr) ? self.doScrollLeft : self.doScrollTop;
+        cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
+        fn(cur);
+      } else {
+        fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
+        cur = (hr) ? self.scroll.x : self.scroll.y;
+        pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
+        pg = (hr) ? self.view.w : self.view.h;
+        fn((cur >= pos) ? pg: -pg);//   (cur >= pos) ? fn(pg): fn(-pg);
+      }
+
+    };
+
+    self.hasanimationframe = ("requestAnimationFrame" in window);
+    self.hascancelanimationframe = ("cancelAnimationFrame" in window);
+/*
+    if (!self.hasanimationframe) {
+      setAnimationFrame = function(fn) {
+        return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
+      }; // 1000/60)};
+      clearAnimationFrame = clearTimeout;
+    } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
+      self.cancelAnimationFrame = true;
+    };
+*/    
+
+    this.init = function() {
+    
+      self.saved.css = [];
+      
+      if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
+      if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
+      if (cap.isandroid && !("hidden" in document)) return true; // Android 3- SORRY, DO NOT WORK!
+
+      var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
+      
+      self.opt.emulatetouch = self.opt.emulatetouch||self.opt.touchbehavior;  // mantain compatibility with "touchbehavior"      
+
+      self.zindex = "auto";
+      if (!self.ispage && self.opt.zindex == "auto") {
+        self.zindex = getZIndex() || "auto";
+      } else {
+        self.zindex = self.opt.zindex;
+      }
+
+      if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
+        globalmaxzindex = self.zindex;
+      }
+
+      if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
+        self.zindex = "auto";
+      }
+
+      if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
+
+        var cont = self.docscroll;
+        if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
+
+        if (!cap.isie9mobile) self.css(cont, _scrollyhidden);
+
+        if (self.ispage && cap.isie7) {
+          if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
+            'overflow-y': 'hidden'
+          }); //IE7 double scrollbar issue
+          else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue
+        }
+
+        if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
+          "-webkit-overflow-scrolling": "touch"
+        }); //force hw acceleration
+
+        var cursor = $(document.createElement('div'));
+        cursor.css({
+          position: "relative",
+          top: 0,
+          "float": "right",
+          width: self.opt.cursorwidth,
+          height: 0,
+          'background-color': self.opt.cursorcolor,
+          border: self.opt.cursorborder,
+          'background-clip': 'padding-box',
+          '-webkit-border-radius': self.opt.cursorborderradius,
+          '-moz-border-radius': self.opt.cursorborderradius,
+          'border-radius': self.opt.cursorborderradius
+        });
+
+        cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
+        
+        cursor.addClass('nicescroll-cursors');
+        
+        self.cursor = cursor;
+
+        var rail = $(document.createElement('div'));
+        rail.attr('id', self.id);
+        rail.addClass('nicescroll-rails nicescroll-rails-vr');
+
+        var v, a, kp = ["left","right","top","bottom"];  //**
+        for (var n in kp) {
+          a = kp[n];
+          v = self.opt.railpadding[a];
+          (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
+        }
+
+        rail.append(cursor);
+
+        rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
+        rail.css({
+          width: rail.width + "px",
+          zIndex: self.zindex,
+          background: self.opt.background,
+          cursor: "default"
+        });
+
+        rail.visibility = true;
+        rail.scrollable = true;
+
+        rail.align = (self.opt.railalign == "left") ? 0 : 1;
+
+        self.rail = rail;
+
+        self.rail.drag = false;
+
+        var zoom = false;
+        if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
+          zoom = document.createElement('div');
+
+          self.bind(zoom, "click", self.doZoom);
+          self.bind(zoom, "mouseenter", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymax);
+          });
+          self.bind(zoom, "mouseleave", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymin);
+          });
+
+          self.zoom = $(zoom);
+          self.zoom.css({
+            cursor: "pointer",
+            zIndex: self.zindex,
+            backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)',
+            height: 18,
+            width: 18,
+            backgroundPosition: '0px 0px'
+          });
+          if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
+          if (cap.cantouch && self.opt.gesturezoom) {
+            self.ongesturezoom = function(e) {
+              if (e.scale > 1.5) self.doZoomIn(e);
+              if (e.scale < 0.8) self.doZoomOut(e);
+              return self.cancelEvent(e);
+            };
+            self.bind(self.win, "gestureend", self.ongesturezoom);
+          }
+        }
+
+        // init HORIZ
+
+        self.railh = false;
+        var railh;
+
+        if (self.opt.horizrailenabled) {
+
+          self.css(cont, {
+            overflowX: 'hidden'
+          });
+
+          var cursor = $(document.createElement('div'));
+          cursor.css({
+            position: "absolute",
+            top: 0,
+            height: self.opt.cursorwidth,
+            width: 0,
+            backgroundColor: self.opt.cursorcolor,
+            border: self.opt.cursorborder,
+            backgroundClip: 'padding-box',
+            '-webkit-border-radius': self.opt.cursorborderradius,
+            '-moz-border-radius': self.opt.cursorborderradius,
+            'border-radius': self.opt.cursorborderradius
+          });
+
+          if (cap.isieold) cursor.css('overflow', 'hidden');  //IE6 horiz scrollbar issue
+          
+          cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
+          
+          cursor.addClass('nicescroll-cursors');
+          
+          self.cursorh = cursor;
+
+          railh = $(document.createElement('div'));
+          railh.attr('id', self.id + '-hr');
+          railh.addClass('nicescroll-rails nicescroll-rails-hr');
+          railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
+          railh.css({
+            height: railh.height + "px",
+            'zIndex': self.zindex,
+            "background": self.opt.background
+          });
+
+          railh.append(cursor);
+
+          railh.visibility = true;
+          railh.scrollable = true;
+
+          railh.align = (self.opt.railvalign == "top") ? 0 : 1;
+
+          self.railh = railh;
+
+          self.railh.drag = false;
+
+        }
+
+        //        
+
+        if (self.ispage) {
+          rail.css({
+            position: "fixed",
+            top: 0,
+            height: "100%"
+          });
+          (rail.align) ? rail.css({
+            right: 0
+          }): rail.css({
+            left: 0
+          });
+          self.body.append(rail);
+          if (self.railh) {
+            railh.css({
+              position: "fixed",
+              left: 0,
+              width: "100%"
+            });
+            (railh.align) ? railh.css({
+              bottom: 0
+            }): railh.css({
+              top: 0
+            });
+            self.body.append(railh);
+          }
+        } else {
+          if (self.ishwscroll) {
+            if (self.win.css('position') == 'static') self.css(self.win, {
+              'position': 'relative'
+            });
+            var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
+            $(bd).scrollTop(0).scrollLeft(0);  // fix rail position if content already scrolled
+            if (self.zoom) {
+              self.zoom.css({
+                position: "absolute",
+                top: 1,
+                right: 0,
+                "margin-right": rail.width + 4
+              });
+              bd.append(self.zoom);
+            }
+            rail.css({
+              position: "absolute",
+              top: 0
+            });
+            (rail.align) ? rail.css({
+              right: 0
+            }): rail.css({
+              left: 0
+            });
+            bd.append(rail);
+            if (railh) {
+              railh.css({
+                position: "absolute",
+                left: 0,
+                bottom: 0
+              });
+              (railh.align) ? railh.css({
+                bottom: 0
+              }): railh.css({
+                top: 0
+              });
+              bd.append(railh);
+            }
+          } else {
+            self.isfixed = (self.win.css("position") == "fixed");
+            var rlpos = (self.isfixed) ? "fixed" : "absolute";
+
+            if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
+            if (self.viewport) {
+              self.body = self.viewport;
+              if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
+                "position": "relative"
+              });
+            }
+
+            rail.css({
+              position: rlpos
+            });
+            if (self.zoom) self.zoom.css({
+              position: rlpos
+            });
+            self.updateScrollBar();
+            self.body.append(rail);
+            if (self.zoom) self.body.append(self.zoom);
+            if (self.railh) {
+              railh.css({
+                position: rlpos
+              });
+              self.body.append(railh);
+            }
+          }
+
+          if (cap.isios) self.css(self.win, {
+            '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
+            '-webkit-touch-callout': 'none'
+          }); // prevent grey layer on click
+
+          if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
+          if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none');  // Webkit outline
+          //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"});  // Opera 12- to test [TODO]
+
+        }
+
+        if (self.opt.autohidemode === false) {
+          self.autohidedom = false;
+          self.rail.css({
+            opacity: self.opt.cursoropacitymax
+          });
+          if (self.railh) self.railh.css({
+            opacity: self.opt.cursoropacitymax
+          });
+        } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
+          self.autohidedom = $().add(self.rail);
+          if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+          if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "scroll") {
+          self.autohidedom = $().add(self.rail);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+        } else if (self.opt.autohidemode == "cursor") {
+          self.autohidedom = $().add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "hidden") {
+          self.autohidedom = false;
+          self.hide();
+          self.railslocked = false;
+        }
+
+        if (cap.isie9mobile) {
+
+          self.scrollmom = new ScrollMomentumClass2D(self);
+
+          self.onmangotouch = function() {
+            var py = self.getScrollTop();
+            var px = self.getScrollLeft();
+
+            if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
+
+            var dfy = py - self.mangotouch.sy;
+            var dfx = px - self.mangotouch.sx;
+            var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
+            if (df == 0) return;
+
+            var dry = (dfy < 0) ? -1 : 1;
+            var drx = (dfx < 0) ? -1 : 1;
+
+            var tm = +new Date();
+            if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
+
+            if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
+              self.scrollmom.stop();
+              self.scrollmom.reset(px, py);
+              self.mangotouch.sy = py;
+              self.mangotouch.ly = py;
+              self.mangotouch.sx = px;
+              self.mangotouch.lx = px;
+              self.mangotouch.dry = dry;
+              self.mangotouch.drx = drx;
+              self.mangotouch.tm = tm;
+            } else {
+
+              self.scrollmom.stop();
+              self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
+              self.mangotouch.tm = tm;
+
+              var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
+              self.mangotouch.ly = py;
+              self.mangotouch.lx = px;
+
+              if (ds > 2) {
+                self.mangotouch.lazy = setTimeout(function() {
+                  self.mangotouch.lazy = false;
+                  self.mangotouch.dry = 0;
+                  self.mangotouch.drx = 0;
+                  self.mangotouch.tm = 0;
+                  self.scrollmom.doMomentum(30);
+                }, 100);
+              }
+            }
+          };
+
+          var top = self.getScrollTop();
+          var lef = self.getScrollLeft();
+          self.mangotouch = {
+            sy: top,
+            ly: top,
+            dry: 0,
+            sx: lef,
+            lx: lef,
+            drx: 0,
+            lazy: false,
+            tm: 0
+          };
+
+          self.bind(self.docscroll, "scroll", self.onmangotouch);
+
+        } else {
+
+          if (cap.cantouch || self.istouchcapable || self.opt.emulatetouch || cap.hasmstouch) {
+
+            self.scrollmom = new ScrollMomentumClass2D(self);
+
+            self.ontouchstart = function(e) {
+
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+              
+              self.hasmoving = false;
+
+              if (!self.railslocked) {
+                var tg;
+                if (cap.hasmstouch) {
+                  tg = (e.target) ? e.target : false;
+                  while (tg) {
+                    var nc = $(tg).getNiceScroll();
+                    if ((nc.length > 0) && (nc[0].me == self.me)) break;
+                    if (nc.length > 0) return false;
+                    if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
+                    tg = (tg.parentNode) ? tg.parentNode : false;
+                  }
+                }
+
+                self.cancelScroll();
+
+                tg = self.getTarget(e);
+
+                if (tg) {
+                  var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
+                  if (skp) return self.stopPropagation(e);
+                }
+
+                if (!("clientX" in e) && ("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                self.rail.drag = {
+                  x: e.clientX,
+                  y: e.clientY,
+                  sx: self.scroll.x,
+                  sy: self.scroll.y,
+                  st: self.getScrollTop(),
+                  sl: self.getScrollLeft(),
+                  pt: 2,
+                  dl: false,
+                  tg: tg
+                };
+
+                if (self.ispage || !self.opt.directionlockdeadzone) {
+                  self.rail.drag.dl = "f";
+                } else {
+
+                  var view = {
+                    w: $(window).width(),
+                    h: $(window).height()
+                  };
+
+                  var page = {
+                    w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+                    h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+                  };
+
+                  var maxh = Math.max(0, page.h - view.h);
+                  var maxw = Math.max(0, page.w - view.w);
+
+                  if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
+                  else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
+                  else self.rail.drag.ck = false;
+                  if (!self.rail.drag.ck) self.rail.drag.dl = "f";
+                }
+
+                if (self.opt.emulatetouch && self.isiframe && cap.isie) {
+                  var wp = self.win.position();
+                  self.rail.drag.x += wp.left;
+                  self.rail.drag.y += wp.top;
+                }
+
+                self.hasmoving = false;
+                self.lastmouseup = false;
+                self.scrollmom.reset(e.clientX, e.clientY);
+                
+                if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
+                
+                  var ip = (tg) ? /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName) : false;
+                  if (!ip) {
+                    if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+                    if (self.opt.emulatetouch) {
+                      if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
+                        tg._onclick = tg.onclick;
+                        tg.onclick = function(e) {
+                          if (self.hasmoving) return false;
+                          tg._onclick.call(this, e);
+                        };
+                      }
+                      return self.cancelEvent(e);
+                    }
+                    return self.stopPropagation(e);
+                  }
+
+                  if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
+                    self.preventclick = {
+                      "tg": tg,
+                      "click": false
+                    };
+                  }
+
+                }
+              }
+
+            };
+
+            self.ontouchend = function(e) {              
+
+              if (!self.rail.drag) return true;              
+              if (self.rail.drag.pt == 2) {
+                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;                
+
+                if (!self.hasmoving) {
+                  var tg = self.rail.drag.tg;
+                  setTimeout(function(){
+                    tg&&$(tg).trigger("click");
+                  },20);
+                }
+                self.rail.drag = false;
+
+                if (self.hasmoving) {                  
+                  self.scrollmom.doMomentum();
+                  self.lastmouseup = true;
+                  self.hideCursor();
+                  if (cap.hasmousecapture) document.releaseCapture();
+                  if (!cap.cantouch) return self.cancelEvent(e);
+                }
+
+              }
+              else if (self.rail.drag.pt == 1) {
+                return self.onmouseup(e);
+              }
+
+            };
+
+            var moveneedoffset = (self.opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
+
+            self.ontouchmove = function(e, byiframe) {
+
+              if (!self.rail.drag) return false;
+
+              if (e.targetTouches && self.opt.preventmultitouchscrolling) {
+                if (e.targetTouches.length > 1) return false; // multitouch
+              }
+            
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+              
+              cap.isandroid && self.cancelEvent(e);
+
+              if (self.rail.drag.pt == 2) {
+                //if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements  <--- not works on modern devices
+
+                var ev = $.extend({
+                  "original": e
+                }, e);
+                e = ev;
+
+                if (("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                if (self.rail.drag.y===e.clientY&&self.rail.drag.x===e.clientX) return false;  // prevent first useless move event 
+
+                self.hasmoving = true;
+
+                if (self.preventclick && !self.preventclick.click) {
+                  self.preventclick.click = self.preventclick.tg.onclick || false;
+                  self.preventclick.tg.onclick = self.onpreventclick;
+                }
+
+                var ofy,ofx;
+                ofx = ofy = 0;
+
+                if (moveneedoffset && !byiframe) {
+                  var wp = self.win.position();
+                  ofx = -wp.left;
+                  ofy = -wp.top;
+                }
+
+                var fy = e.clientY + ofy;
+                var my = (fy - self.rail.drag.y);
+                var fx = e.clientX + ofx;
+                var mx = (fx - self.rail.drag.x);
+
+                var ny = self.rail.drag.st - my;
+
+                if (self.ishwscroll && self.opt.bouncescroll) {
+                  if (ny < 0) {
+                    ny = Math.round(ny / 2);
+                    //                    fy = 0;
+                  } else if (ny > self.page.maxh) {
+                    ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
+                    //                    fy = 0;
+                  }
+                } else {
+                  if (ny < 0) {
+                    ny = 0;
+                    fy = 0;
+                  }
+                  if (ny > self.page.maxh) {
+                    ny = self.page.maxh;
+                    fy = 0;
+                  }
+                }
+
+                var nx;
+                if (self.railh && self.railh.scrollable) {
+                  nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
+
+                  if (self.ishwscroll && self.opt.bouncescroll) {
+                    if (nx < 0) {
+                      nx = Math.round(nx / 2);
+                      //                      fx = 0;
+                    } else if (nx > self.page.maxw) {
+                      nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
+                      //                      fx = 0;
+                    }
+                  } else {
+                    if (nx < 0) {
+                      nx = 0;
+                      fx = 0;
+                    }
+                    if (nx > self.page.maxw) {
+                      nx = self.page.maxw;
+                      fx = 0;
+                    }
+                  }
+
+                }
+
+                var grabbed = false;
+                if (self.rail.drag.dl) {
+                  grabbed = true;
+                  if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
+                  else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
+                } else {
+                  var ay = Math.abs(my);
+                  var ax = Math.abs(mx);
+                  var dz = self.opt.directionlockdeadzone;
+                  if (self.rail.drag.ck == "v") {
+                    if (ay > dz && (ax <= (ay * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ax > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  } else if (self.rail.drag.ck == "h") {
+                    if (ax > dz && (ay <= (ax * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ay > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  }
+                }
+
+                self.synched("touchmove", function() {
+                  if (self.rail.drag && (self.rail.drag.pt == 2)) {
+                    if (self.prepareTransition) self.prepareTransition(0);
+                    if (self.rail.scrollable) self.setScrollTop(ny);
+                    self.scrollmom.update(fx, fy);
+                    if (self.railh && self.railh.scrollable) {
+                      self.setScrollLeft(nx);
+                      self.showCursor(ny, nx);
+                    } else {
+                      self.showCursor(ny);
+                    }
+                    if (cap.isie10) document.selection.clear();
+                  }
+                });
+
+                if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
+                if (grabbed) return self.cancelEvent(e);
+              }
+              else if (self.rail.drag.pt == 1) { // drag on cursor
+                return self.onmousemove(e);
+              }
+
+            };
+
+            self.ontouchstartCursor = function (e, hronly) {
+              if (self.rail.drag && self.rail.drag.pt != 3) return;
+              if (self.locked) return self.cancelEvent(e);
+              self.cancelScroll();
+              self.rail.drag = {
+                x: e.touches[0].clientX,
+                y: e.touches[0].clientY,
+                sx: self.scroll.x,
+                sy: self.scroll.y,
+                pt: 3,
+                hr: (!!hronly)
+              };
+              var tg = self.getTarget(e);
+              if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+              if (self.isiframe && !cap.hasmousecapture) {
+                self.saved["csspointerevents"] = self.doc.css("pointer-events");
+                self.css(self.doc, {"pointer-events": "none"});
+              }
+              return self.cancelEvent(e);
+            };
+
+            self.ontouchendCursor = function (e) {
+              if (self.rail.drag) {
+                if (cap.hasmousecapture) document.releaseCapture();
+                if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved["csspointerevents"]);
+                if (self.rail.drag.pt != 3)return;
+                self.rail.drag = false;
+                //if (!self.rail.active) self.hideCursor();
+                return self.cancelEvent(e);
+              }
+            };
+
+            self.ontouchmoveCursor = function (e) {
+              if (self.rail.drag) {
+                if (self.rail.drag.pt != 3)return;
+
+                self.cursorfreezed = true;
+
+                if (self.rail.drag.hr) {
+                  self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
+                  if (self.scroll.x < 0) self.scroll.x = 0;
+                  var mw = self.scrollvaluemaxw;
+                  if (self.scroll.x > mw) self.scroll.x = mw;
+                } else {
+                  self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
+                  if (self.scroll.y < 0) self.scroll.y = 0;
+                  var my = self.scrollvaluemax;
+                  if (self.scroll.y > my) self.scroll.y = my;
+                }
+
+                self.synched('touchmove', function () {
+                  if (self.rail.drag && (self.rail.drag.pt == 3)) {
+                    self.showCursor();
+                    if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+                  }
+                });
+
+                return self.cancelEvent(e);
+              }
+              /*
+               else {
+               self.checkarea = true;
+               }
+               */
+            };
+
+          }
+
+          self.onmousedown = function(e, hronly) {
+            if (self.rail.drag && self.rail.drag.pt != 1) return;
+            if (self.railslocked) return self.cancelEvent(e);
+            self.cancelScroll();
+            self.rail.drag = {
+              x: e.clientX,
+              y: e.clientY,
+              sx: self.scroll.x,
+              sy: self.scroll.y,
+              pt: 1,
+              hr: hronly||false
+            };
+            var tg = self.getTarget(e);
+            if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+            if (self.isiframe && !cap.hasmousecapture) {
+              self.saved.csspointerevents = self.doc.css("pointer-events");
+              self.css(self.doc, {
+                "pointer-events": "none"
+              });
+            }
+            self.hasmoving = false;
+            return self.cancelEvent(e);
+          };
+
+          self.onmouseup = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt != 1) return true;
+							
+              if (cap.hasmousecapture) document.releaseCapture();
+              if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);              
+              self.rail.drag = false;
+              //if (!self.rail.active) self.hideCursor();
+              if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
+              return self.cancelEvent(e);
+            }
+          };
+
+          self.onmousemove = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt !== 1) return;
+
+              if (cap.ischrome && e.which === 0) return self.onmouseup(e);
+
+              self.cursorfreezed = true;
+              self.hasmoving = true;
+
+              if (self.rail.drag.hr) {
+                self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
+                if (self.scroll.x < 0) self.scroll.x = 0;
+                var mw = self.scrollvaluemaxw;
+                if (self.scroll.x > mw) self.scroll.x = mw;
+              } else {
+                self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
+                if (self.scroll.y < 0) self.scroll.y = 0;
+                var my = self.scrollvaluemax;
+                if (self.scroll.y > my) self.scroll.y = my;
+              }
+
+              self.synched('mousemove', function() {
+                if (self.rail.drag && (self.rail.drag.pt == 1)) {
+                  self.showCursor();
+                  if (self.rail.drag.hr) {
+                    if (self.hasreversehr) {
+                      self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    } else {
+                      self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    }
+                  }
+                  else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+                }
+              });
+
+              return self.cancelEvent(e);
+            }
+            else {
+              self.checkarea = 0;
+            }
+          };
+
+          if (cap.cantouch || self.opt.emulatetouch) {
+
+            self.onpreventclick = function(e) {
+              if (self.preventclick) {
+                self.preventclick.tg.onclick = self.preventclick.click;
+                self.preventclick = false;
+                return self.cancelEvent(e);
+              }
+            };
+
+            //self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging  <-- REENABLE!!
+
+            self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
+              if (self.lastmouseup) {
+                self.lastmouseup = false;
+                return self.cancelEvent(e);
+              } else {
+                return true;
+              }
+            };
+
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
+              self.css((self.ispage) ? self.doc : self.win, {
+                'cursor': cap.cursorgrabvalue
+              });
+              self.css(self.rail, {
+                'cursor': cap.cursorgrabvalue
+              });
+            }
+
+          } else {
+
+            var checkSelectionScroll = function(e) {
+              if (!self.selectiondrag) return;
+
+              if (e) {
+                var ww = self.win.outerHeight();
+                var df = (e.pageY - self.selectiondrag.top);
+                if (df > 0 && df < ww) df = 0;
+                if (df >= ww) df -= ww;
+                self.selectiondrag.df = df;
+              }
+              if (self.selectiondrag.df == 0) return;
+
+              var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
+              self.doScrollBy(rt);
+
+              self.debounced("doselectionscroll", function() {
+                checkSelectionScroll();
+              }, 50);
+            };
+
+            if ("getSelection" in document) { // A grade - Major browsers
+              self.hasTextSelected = function() {
+                return (document.getSelection().rangeCount > 0);
+              };
+            } else if ("selection" in document) { //IE9-
+              self.hasTextSelected = function() {
+                return (document.selection.type != "None");
+              };
+            } else {
+              self.hasTextSelected = function() { // no support
+                return false;
+              };
+            }
+
+            self.onselectionstart = function(e) {
+/*  More testing - severe chrome issues            
+              if (!self.haswrapper&&(e.which&&e.which==2)) {  // fool browser to manage middle button scrolling
+                self.win.css({'overflow':'auto'});
+                setTimeout(function(){
+                  self.win.css({'overflow':''});
+                },10);                
+                return true;
+              }            
+*/              
+              if (self.ispage) return;
+              self.selectiondrag = self.win.offset();
+            };
+            
+            self.onselectionend = function(e) {
+              self.selectiondrag = false;
+            };
+            self.onselectiondrag = function(e) {
+              if (!self.selectiondrag) return;
+              if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
+                checkSelectionScroll(e);
+              }, 250);
+            };
+          }
+
+          if (cap.hasw3ctouch) { //IE11+
+            self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
+            self.css(self.rail, {
+              'touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              'touch-action': 'none'
+            });
+            self.bind(self.win, "pointerdown", self.ontouchstart);
+            self.bind(document, "pointerup", self.ontouchend);
+            self.bind(document, "pointermove", self.ontouchmove);
+          } else if (cap.hasmstouch) { //IE10
+            self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
+            self.css(self.rail, {
+              '-ms-touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              '-ms-touch-action': 'none'
+            });
+            self.bind(self.win, "MSPointerDown", self.ontouchstart);
+            self.bind(document, "MSPointerUp", self.ontouchend);
+            self.bind(document, "MSPointerMove", self.ontouchmove);
+            self.bind(self.cursor, "MSGestureHold", function(e) {
+              e.preventDefault();
+            });
+            self.bind(self.cursor, "contextmenu", function(e) {
+              e.preventDefault();
+            });
+          } else if (cap.cantouch) { // smartphones/touch devices
+            self.bind(self.win, "touchstart", self.ontouchstart,false,true);
+            self.bind(document, "touchend", self.ontouchend,false,true);
+            self.bind(document, "touchcancel", self.ontouchend,false,true);
+            self.bind(document, "touchmove", self.ontouchmove,false,true);
+          }
+
+          if (self.opt.emulatetouch) {
+            self.bind(self.win, "mousedown", self.ontouchstart,false,true);
+            self.bind(document, "mouseup", self.ontouchend,false,true);
+            self.bind(document, "mousemove", self.ontouchmove,false,true);
+          }
+          
+          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.emulatetouch)) {
+
+            self.rail.css({
+              cursor: "default"
+            });
+            self.railh && self.railh.css({
+              cursor: "default"
+            });
+
+            self.jqbind(self.rail, "mouseenter", function() {
+              if (!self.ispage && !self.win.is(":visible")) return false;
+              if (self.canshowonmouseevent) self.showCursor();
+              self.rail.active = true;
+            });
+            self.jqbind(self.rail, "mouseleave", function() {
+              self.rail.active = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+            if (self.opt.sensitiverail) {
+              self.bind(self.rail, "click", function(e) {
+                self.doRailClick(e, false, false);
+              });
+              self.bind(self.rail, "dblclick", function(e) {
+                self.doRailClick(e, true, false);
+              });
+              self.bind(self.cursor, "click", function(e) {
+                self.cancelEvent(e);
+              });
+              self.bind(self.cursor, "dblclick", function(e) {
+                self.cancelEvent(e);
+              });
+            }
+
+            if (self.railh) {
+              self.jqbind(self.railh, "mouseenter", function() {
+                if (!self.ispage && !self.win.is(":visible")) return false;
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.railh, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+
+              if (self.opt.sensitiverail) {
+                self.bind(self.railh, "click", function(e) {
+                  self.doRailClick(e, false, true);
+                });
+                self.bind(self.railh, "dblclick", function(e) {
+                  self.doRailClick(e, true, true);
+                });
+                self.bind(self.cursorh, "click", function(e) {
+                  self.cancelEvent(e);
+                });
+                self.bind(self.cursorh, "dblclick", function(e) {
+                  self.cancelEvent(e);
+                });
+              }
+
+            }
+
+          }
+
+          if(self.opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
+            self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
+            self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
+            self.bind(self.cursor, "touchend", self.ontouchendCursor);
+            self.cursorh && self.bind(self.cursorh, "touchstart", function(e) {
+                self.ontouchstartCursor(e, true);
+            });
+            self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
+            self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
+          }
+
+          if (!cap.cantouch && !self.opt.emulatetouch) {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
+            self.bind(document, "mousemove", self.onmousemove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            self.bind(self.cursor, "mousedown", self.onmousedown);
+            self.bind(self.cursor, "mouseup", self.onmouseup);
+
+            if (self.railh) {
+              self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              self.bind(self.cursorh, "mouseup", self.onmouseup);
+            }
+            
+            if (!self.ispage && self.opt.enablescrollonselection) {
+              self.bind(self.win[0], "mousedown", self.onselectionstart);
+              self.bind(document, "mouseup", self.onselectionend);
+              self.bind(self.cursor, "mouseup", self.onselectionend);
+              if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
+              self.bind(document, "mousemove", self.onselectiondrag);
+            }
+
+            if (self.zoom) {
+              self.jqbind(self.zoom, "mouseenter", function() {
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.zoom, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+            }
+
+          } else {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
+            //self.bind(document, "mousemove", self.ontouchmove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            if (self.opt.cursordragontouch) {
+              self.bind(self.cursor, "mousedown", self.onmousedown);
+              self.bind(self.cursor, "mouseup", self.onmouseup);
+              //self.bind(self.cursor, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
+            } else {
+              self.bind(self.rail, "mousedown", function(e){e.preventDefault();});  // prevent text selection             
+							self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();});
+            }
+
+          }
+            
+
+          if (self.opt.enablemousewheel) {
+            if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel);
+            self.mousewheel(self.rail, self.onmousewheel);
+            if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
+          }
+
+          if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
+            if (!self.win.attr("tabindex")) self.win.attr({
+              "tabindex": tabindexcounter++
+            });
+
+            self.jqbind(self.win, "focus", function(e) {
+              domfocus = (self.getTarget(e)).id || true;
+              self.hasfocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "blur", function(e) {
+              domfocus = false;
+              self.hasfocus = false;
+            });
+
+            self.jqbind(self.win, "mouseenter", function(e) {
+              mousefocus = (self.getTarget(e)).id || true;
+              self.hasmousefocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "mouseleave", function() {
+              mousefocus = false;
+              self.hasmousefocus = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+          }
+
+        } // !ie9mobile
+
+        //Thanks to http://www.quirksmode.org !!
+        self.onkeypress = function(e) {
+          if (self.railslocked && self.page.maxh == 0) return true;
+
+          e = (e) ? e : window.e;
+          var tg = self.getTarget(e);
+          if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
+            var tp = tg.getAttribute('type') || tg.type || false;
+            if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
+          }
+
+          if ($(tg).attr('contenteditable')) return true;
+
+          if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
+            var key = e.keyCode;
+
+            if (self.railslocked && key != 27) return self.cancelEvent(e);
+
+            var ctrl = e.ctrlKey || false;
+            var shift = e.shiftKey || false;
+
+            var ret = false;
+            switch (key) {
+              case 38:
+              case 63233: //safari
+                self.doScrollBy(24 * 3);
+                ret = true;
+                break;
+              case 40:
+              case 63235: //safari
+                self.doScrollBy(-24 * 3);
+                ret = true;
+                break;
+              case 37:
+              case 63232: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
+                  ret = true;
+                }
+                break;
+              case 39:
+              case 63234: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
+                  ret = true;
+                }
+                break;
+              case 33:
+              case 63276: // safari
+                self.doScrollBy(self.view.h);
+                ret = true;
+                break;
+              case 34:
+              case 63277: // safari
+                self.doScrollBy(-self.view.h);
+                ret = true;
+                break;
+              case 36:
+              case 63273: // safari                
+                (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
+                ret = true;
+                break;
+              case 35:
+              case 63275: // safari
+                (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
+                ret = true;
+                break;
+              case 32:
+                if (self.opt.spacebarenabled) {
+                  (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
+                  ret = true;
+                }
+                break;
+              case 27: // ESC
+                if (self.zoomactive) {
+                  self.doZoom();
+                  ret = true;
+                }
+                break;
+            }
+            if (ret) return self.cancelEvent(e);
+          }
+        };
+
+        if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
+
+        self.bind(document, "keydown", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (ctrl) self.wheelprevented = true;
+        });
+        self.bind(document, "keyup", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (!ctrl) self.wheelprevented = false;
+        });
+        self.bind(window,"blur",function(e){
+          self.wheelprevented = false;
+        });        
+
+        self.bind(window, 'resize', self.lazyResize);
+        self.bind(window, 'orientationchange', self.lazyResize);
+
+        self.bind(window, "load", self.lazyResize);
+
+        if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
+          var tmp = self.win.attr("style");
+          var ww = parseFloat(self.win.css("width")) + 1;
+          self.win.css('width', ww);
+          self.synched("chromefix", function() {
+            self.win.attr("style", tmp);
+          });
+        }
+
+
+        // Trying a cross-browser implementation - good luck!
+
+        self.onAttributeChange = function(e) {
+          self.lazyResize(self.isieold ? 250 : 30);
+        };
+
+        if (self.opt.enableobserver) {
+
+          if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
+            self.observerbody = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(function(mut){
+                if (mut.type=="attributes") {
+                  return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+                }
+              });
+              // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
+              if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
+            });
+            self.observerbody.observe(document.body, {
+              childList: true,
+              subtree: true,
+              characterData: false,
+              attributes: true,
+              attributeFilter: ['class']
+            });
+          }
+          
+          if (!self.ispage && !self.haswrapper) {
+            // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+            if (ClsMutationObserver !== false) {
+              self.observer = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(self.onAttributeChange);
+              });
+              self.observer.observe(self.win[0], {
+                childList: true,
+                characterData: false,
+                attributes: true,
+                subtree: false
+              });
+              self.observerremover = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(function(mo) {
+                  if (mo.removedNodes.length > 0) {
+                    for (var dd in mo.removedNodes) {
+                      if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+                    }
+                  }
+                });
+              });
+              self.observerremover.observe(self.win[0].parentNode, {
+                childList: true,
+                characterData: false,
+                attributes: false,
+                subtree: false
+              });
+            } else {
+              self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+              if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+              self.bind(self.win, "DOMNodeRemoved", function(e) {
+                if (e.target == self.win[0]) self.remove();
+              });
+            }
+          }
+
+        }
+
+        //
+
+        if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
+				if (self.istextarea) {
+					self.bind(self.win, "keydown", self.lazyResize);
+					self.bind(self.win, "mouseup", self.lazyResize);
+				}
+
+        //        self.checkrtlmode = true;
+        self.lazyResize(30);
+
+      }
+      
+      if (this.doc[0].nodeName == 'IFRAME') {
+        var oniframeload = function() {
+          self.iframexd = false;
+          var doc;
+          try {
+            doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
+            var a = doc.domain;
+          } catch (e) {
+            self.iframexd = true;
+            doc = false;
+          }
+          
+          if (self.iframexd) {
+            if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
+            return true; //cross-domain - I can't manage this        
+          }
+
+          self.forcescreen = true;
+
+          if (self.isiframe) {
+            self.iframe = {
+              "doc": $(doc),
+              "html": self.doc.contents().find('html')[0],
+              "body": self.doc.contents().find('body')[0]
+            };
+            self.getContentSize = function() {
+              return {
+                w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
+                h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
+              };
+            };
+            self.docscroll = $(self.iframe.body); //$(this.contentWindow);
+          }
+
+          if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
+            self.win.scrollTop(0); // reset position
+            self.doc.height(""); //reset height to fix browser bug
+            var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
+            self.doc.height(hh);
+          }
+          self.lazyResize(30);
+
+          if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden);
+          self.css($(self.iframe.body), _scrollyhidden);
+
+          if (cap.isios && self.haswrapper) {
+            self.css($(doc.body), {
+              '-webkit-transform': 'translate3d(0,0,0)'
+            }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
+          }
+
+          if ('contentWindow' in this) {
+            self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
+          } else {
+            self.bind(doc, "scroll", self.onscroll);
+          }
+
+          if (self.opt.enablemousewheel) {
+            self.mousewheel(doc, self.onmousewheel);
+          }
+
+          if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
+
+          if (cap.cantouch) {
+            self.bind(doc, "touchstart", self.ontouchstart);
+            self.bind(doc, "touchmove", self.ontouchmove);          
+          } 
+          else if (self.opt.emulatetouch) {
+            self.bind(doc, "mousedown", self.ontouchstart);
+            self.bind(doc, "mousemove", function(e) {
+              return self.ontouchmove(e, true);
+            });
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
+              'cursor': cap.cursorgrabvalue
+            });
+          }
+
+          self.bind(doc, "mouseup", self.ontouchend);
+
+          if (self.zoom) {
+            if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
+            if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
+          }
+        };
+
+        if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
+          setTimeout(function() {
+            oniframeload.call(self.doc[0], false);
+          }, 500);
+        }
+        self.bind(this.doc, "load", oniframeload);
+
+      }
+
+    };
+
+    this.showCursor = function(py, px) {
+      if (self.cursortimeout) {
+        clearTimeout(self.cursortimeout);
+        self.cursortimeout = 0;
+      }
+      if (!self.rail) return;
+      if (self.autohidedom) {
+        self.autohidedom.stop().css({
+          opacity: self.opt.cursoropacitymax
+        });
+        self.cursoractive = true;
+      }
+
+      if (!self.rail.drag || self.rail.drag.pt != 1) {
+        if (py !== undefined && py !== false) {
+          self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
+        }
+        if (px !== undefined) {
+          self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
+        }
+      }
+
+      self.cursor.css({
+        height: self.cursorheight,
+        top: self.scroll.y
+      });
+      if (self.cursorh) {        
+        var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
+        (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx + self.rail.width
+        }): self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx
+        });
+        self.cursoractive = true;
+      }
+
+      if (self.zoom) self.zoom.stop().css({
+        opacity: self.opt.cursoropacitymax
+      });
+    };
+
+    this.hideCursor = function(tm) {
+      if (self.cursortimeout) return;
+      if (!self.rail) return;
+      if (!self.autohidedom) return;
+      if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
+      self.cursortimeout = setTimeout(function() {
+        if (!self.rail.active || !self.showonmouseevent) {
+          self.autohidedom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          if (self.zoom) self.zoom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          self.cursoractive = false;
+        }
+        self.cursortimeout = 0;
+      }, tm || self.opt.hidecursordelay);
+    };
+
+    this.noticeCursor = function(tm, py, px) {
+      self.showCursor(py, px);
+      if (!self.rail.active) self.hideCursor(tm);
+    };
+
+    this.getContentSize =
+      (self.ispage) ?
+      function() {
+        return {
+          w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+          h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+        };
+      } : (self.haswrapper) ?
+      function() {
+        return {
+          w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
+          h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
+        };
+      } : function() {
+        return {
+          w: self.docscroll[0].scrollWidth,
+          h: self.docscroll[0].scrollHeight
+        };
+      };
+
+    this.onResize = function(e, page) {
+    
+      if (!self || !self.win) return false;
+
+      if (!self.haswrapper && !self.ispage) {
+        if (self.win.css('display') == 'none') {
+          if (self.visibility) self.hideRail().hideRailHr();
+          return false;
+        } else {
+          if (!self.hidden && !self.visibility) self.showRail().showRailHr();
+        }
+      }
+
+      var premaxh = self.page.maxh;
+      var premaxw = self.page.maxw;
+
+      var preview = {
+        h: self.view.h,
+        w: self.view.w
+      };
+
+      self.view = {
+        w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
+        h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
+      };
+
+      self.page = (page) ? page : self.getContentSize();
+
+      self.page.maxh = Math.max(0, self.page.h - self.view.h);
+      self.page.maxw = Math.max(0, self.page.w - self.view.w);
+      
+      if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
+        // test position        
+        if (!self.ispage) {
+          var pos = self.win.offset();
+          if (self.lastposition) {
+            var lst = self.lastposition;
+            if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do            
+          }
+          self.lastposition = pos;
+        } else {
+          return self; //nothing to do
+        }
+      }
+
+      if (self.page.maxh == 0) {
+        self.hideRail();
+        self.scrollvaluemax = 0;
+        self.scroll.y = 0;
+        self.scrollratio.y = 0;
+        self.cursorheight = 0;
+        self.setScrollTop(0);
+        if (self.rail) self.rail.scrollable = false;
+      } else {
+        self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+        self.rail.scrollable = true;
+      }
+
+      if (self.page.maxw == 0) {
+        self.hideRailHr();
+        self.scrollvaluemaxw = 0;
+        self.scroll.x = 0;
+        self.scrollratio.x = 0;
+        self.cursorwidth = 0;
+        self.setScrollLeft(0);
+        if (self.railh) {
+          self.railh.scrollable = false;
+        }
+      } else {
+          self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+          if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
+      }
+
+      self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
+      if (self.railslocked) {
+        if (!self.ispage) self.updateScrollBar(self.view);
+        return false;
+      }
+
+      if (!self.hidden && !self.visibility) {
+        self.showRail().showRailHr();
+      }
+      else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();
+
+      if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
+
+      self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
+      self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
+
+      self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
+      self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
+
+      self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+
+      if (self.railh) {
+        self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
+        self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+      }
+
+      /*
+      if (self.checkrtlmode&&self.railh) {
+        self.checkrtlmode = false;
+        if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
+      }
+*/
+
+      if (!self.ispage) self.updateScrollBar(self.view);
+
+      self.scrollratio = {
+        x: (self.page.maxw / self.scrollvaluemaxw),
+        y: (self.page.maxh / self.scrollvaluemax)
+      };
+
+      var sy = self.getScrollTop();
+      if (sy > self.page.maxh) {
+        self.doScrollTop(self.page.maxh);
+      } else {
+        self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+        self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+        if (self.cursoractive) self.noticeCursor();
+      }
+
+      if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
+
+      return self;
+    };
+
+    this.resize = self.onResize;
+
+		this.hlazyresize = 0;
+		
+    this.lazyResize = function(tm) { // event debounce
+/*		
+      tm = (isNaN(tm)) ? 30 : tm;
+      self.debounced('resize', self.resize, tm);
+*/
+
+//			if (!self.haswrapper&&self.opt.autohidemode!==false) self.hide();	
+			if (!self.haswrapper) self.hide();	
+			if (self.hlazyresize) clearTimeout(self.hlazyresize);
+			self.hlazyresize = setTimeout(function(){
+				if (self) { self.resize(); self.show(); }  // this form mandatory for uglify
+			},240);
+			
+      return self;
+    };
+
+    // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
+    function _modernWheelEvent(dom, name, fn, bubble) {
+      self._bind(dom, name, function(e) {
+        var e = (e) ? e : window.event;
+        var event = {
+          original: e,
+          target: e.target || e.srcElement,
+          type: "wheel",
+          deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
+          deltaX: 0,
+          deltaZ: 0,
+          preventDefault: function() {
+            e.preventDefault ? e.preventDefault() : e.returnValue = false;
+            return false;
+          },
+          stopImmediatePropagation: function() {
+            (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
+          }
+        };
+
+        if (name == "mousewheel") {
+          e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
+					e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
+					!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
+        } else {
+          event.deltaY = e.detail;
+        }
+
+        return fn.call(dom, event);
+      }, bubble);
+    }
+
+
+
+    this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
+      self.events.push({
+        e: dom,
+        n: name,
+        f: fn,
+        q: true
+      });
+      $(dom).bind(name, fn);
+    };
+    
+    this.mousewheel = function(dom, fn, bubble) { // bind mousewheel
+      var el = ("jquery" in dom) ? dom[0] : dom;
+      if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel"
+        self._bind(el, "wheel", fn, bubble || false);
+      } else {
+        var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox          
+        _modernWheelEvent(el, wname, fn, bubble || false);
+        if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
+      }
+    };
+    
+    if (cap.haseventlistener) {  // W3C standard event model
+    
+      this.bind = function(dom, name, fn, bubble, active) {  // W3C
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, fn, bubble || false, active || false);
+      };
+
+      // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
+      var passiveSupported = false;
+      try{var options=Object.defineProperty({},"passive",{get:function(){passiveSupported=!0}});window.addEventListener("test",null,options)}catch(err){}
+      this._bind = function(el, name, fn, bubble, active) { // primitive bind
+      
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+
+        (passiveSupported&&active) ? el.addEventListener(name, fn, {passive:false,capture:bubble}) : el.addEventListener(name, fn, bubble || false);
+      };    
+      this.cancelEvent = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        if (e.cancelable) e.preventDefault();
+        e.stopPropagation();
+        if (e.preventManipulation) e.preventManipulation(); //IE10
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        e.stopPropagation();
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind
+        el.removeEventListener(name, fn, bub);
+      };
+    } else {  // old IE model
+
+      this.bind = function(dom, name, fn, bubble) {  // legacy IE
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, function(e) {
+          e = e || window.event || false;
+          if (e && e.srcElement) {
+            e.target = e.srcElement;
+          }
+          if (!("pageY" in e)) {
+            e.pageX = e.clientX + document.documentElement.scrollLeft;
+            e.pageY = e.clientY + document.documentElement.scrollTop;
+          }
+          return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
+        });
+      };
+    
+      this._bind = function(el, name, fn, bubble) { // primitive bind
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+        if (el.attachEvent) {
+          el.attachEvent("on" + name, fn);
+        } else {
+          el["on" + name] = fn;
+        }
+      };    
+      // Thanks to http://www.switchonthecode.com !!
+      this.cancelEvent = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        e.cancel = true;
+        e.returnValue = false;
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
+        if (el.detachEvent) {
+          el.detachEvent('on' + name, fn);
+        } else {
+          el['on' + name] = false;
+        }
+      };
+    }
+    
+    this.unbindAll = function() {
+      for (var a = 0; a < self.events.length; a++) {
+        var r = self.events[a];
+        (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
+      }
+    };
+
+    this.showRail = function() {
+      if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.visibility = true;
+        self.rail.visibility = true;
+        self.rail.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.showRailHr = function() {
+      if (!self.railh) return self;
+      if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.railh.visibility = true;
+        self.railh.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.hideRail = function() {
+      self.visibility = false;
+      self.rail.visibility = false;
+      self.rail.css('display', 'none');
+      return self;
+    };
+
+    this.hideRailHr = function() {
+      if (!self.railh) return self;
+      self.railh.visibility = false;
+      self.railh.css('display', 'none');
+      return self;
+    };
+
+    this.show = function() {
+      self.hidden = false;
+      self.railslocked = false;
+      return self.showRail().showRailHr();
+    };
+
+    this.hide = function() {
+      self.hidden = true;
+      self.railslocked = true;
+      return self.hideRail().hideRailHr();
+    };
+
+    this.toggle = function() {
+      return (self.hidden) ? self.show() : self.hide();
+    };
+
+    this.remove = function() {
+      self.stop();
+      if (self.cursortimeout) clearTimeout(self.cursortimeout);
+//      if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
+			for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
+      self.doZoomOut();
+      self.unbindAll();
+
+      if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+
+      if (self.observer !== false) self.observer.disconnect();
+      if (self.observerremover !== false) self.observerremover.disconnect();
+      if (self.observerbody !== false) self.observerbody.disconnect();
+
+      self.events = null;
+
+      if (self.cursor) {
+        self.cursor.remove();
+      }
+      if (self.cursorh) {
+        self.cursorh.remove();
+      }
+      if (self.rail) {
+        self.rail.remove();
+      }
+      if (self.railh) {
+        self.railh.remove();
+      }
+      if (self.zoom) {
+        self.zoom.remove();
+      }
+      for (var a = 0; a < self.saved.css.length; a++) {
+        var d = self.saved.css[a];
+        d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
+      }
+      self.saved = false;
+      self.me.data('__nicescroll', ''); //erase all traces
+
+      // memory leak fixed by GianlucaGuarini - thanks a lot!
+      // remove the current nicescroll from the $.nicescroll array & normalize array
+      var lst = $.nicescroll;
+      lst.each(function(i) {
+        if (!this) return;
+        if (this.id === self.id) {
+          delete lst[i];
+          for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
+          lst.length--;
+          if (lst.length) delete lst[lst.length];
+        }
+      });
+
+      for (var i in self) {
+        self[i] = null;
+        delete self[i];
+      }
+
+      self = null;
+
+    };
+
+    this.scrollstart = function(fn) {
+      this.onscrollstart = fn;
+      return self;
+    };
+    this.scrollend = function(fn) {
+      this.onscrollend = fn;
+      return self;
+    };
+    this.scrollcancel = function(fn) {
+      this.onscrollcancel = fn;
+      return self;
+    };
+
+    this.zoomin = function(fn) {
+      this.onzoomin = fn;
+      return self;
+    };
+    this.zoomout = function(fn) {
+      this.onzoomout = fn;
+      return self;
+    };
+
+    this.isScrollable = function(e) {
+      var dom = (e.target) ? e.target : e;
+      if (dom.nodeName == 'OPTION') return true;
+      while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false;
+    };
+
+    this.getViewport = function(me) {
+      var dom = (me && me.parentNode) ? me.parentNode : false;
+      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        if (/fixed|absolute/.test(dd.css("position"))) return dd;
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
+        if (dd.getNiceScroll().length > 0) return dd;
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false; //(dom) ? $(dom) : false;
+    };
+
+    this.triggerScrollEnd = function() {
+      if (!self.onscrollend) return;
+
+      var px = self.getScrollLeft();
+      var py = self.getScrollTop();
+
+      var info = {
+        type: "scrollend",
+        current: {
+          x: px,
+          y: py
+        },
+        end: {
+          x: px,
+          y: py
+        }
+      };
+      self.onscrollend.call(self, info);
+    };
+
+    function execScrollWheel(e, hr, chkscroll) {
+      var px, py;
+      
+      if (e.deltaMode == 0) { // PIXEL
+        px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
+        py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
+      } else if (e.deltaMode == 1) { // LINE
+        px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
+        py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
+      }
+
+      if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support 
+        px = py;
+        py = 0;
+      
+        if (chkscroll) {
+          var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
+          if (hrend) {  // preserve vertical scrolling
+            py = px;
+            px = 0;            
+          }
+        }
+        
+      }
+
+      // invert horizontal direction for rtl mode
+      if (self.isrtlmode) px = -px;
+
+      if (px) {
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltax += px;
+        self.debounced("mousewheelx", function() {
+          var dt = self.lastdeltax;
+          self.lastdeltax = 0;
+          if (!self.rail.drag) {
+            self.doScrollLeftBy(dt);
+          }
+        }, 15);
+      }
+      if (py) {
+        if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
+          if (py < 0) {
+            if (self.getScrollTop() >= self.page.maxh) return true;
+          } else {
+            if (self.getScrollTop() <= 0) return true;
+          }
+        }
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltay += py;
+//        self.debounced("mousewheely", function() {
+	      self.synched("mousewheely", function() {
+          var dt = self.lastdeltay;
+          self.lastdeltay = 0;
+          if (!self.rail.drag) {
+            self.doScrollBy(dt);
+          }
+        }, 15);
+      }
+
+      e.stopImmediatePropagation();
+      return e.preventDefault();
+    }
+
+    this.onmousewheel = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked) {
+        self.debounced("checkunlock", self.resize, 250);
+        return true;
+      }
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
+
+      if (self.opt.oneaxismousemode && e.deltaX == 0) {
+        if (!self.rail.scrollable) {
+          if (self.railh && self.railh.scrollable) {
+            return self.onmousewheelhr(e);
+          } else {
+            return true;
+          }
+        }
+      }
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      var ret = execScrollWheel(e, false, chk);
+      if (ret) self.checkarea = 0;
+      return ret;
+    };
+
+    this.onmousewheelhr = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked || !self.railh.scrollable) return true;
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      if (self.railslocked) return self.cancelEvent(e);
+
+      return execScrollWheel(e, true, chk);
+    };
+
+    this.stop = function() {
+      self.cancelScroll();
+      if (self.scrollmon) self.scrollmon.stop();
+      self.cursorfreezed = false;
+      self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+      self.noticeCursor();
+      return self;
+    };
+
+    this.getTransitionSpeed = function(dif) {
+      var sp = Math.round(self.opt.scrollspeed * 10);
+      var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
+      return (ex > 20) ? ex : 0;
+    };
+
+    if (!self.opt.smoothscroll) {
+      this.doScrollLeft = function(x, spd) { //direct
+        var y = self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollTop = function(y, spd) { //direct
+        var x = self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollPos = function(x, y, spd) { //direct
+        var nx = (x > self.page.maxw) ? self.page.maxw : x;
+        if (nx < 0) nx = 0;
+        var ny = (y > self.page.maxh) ? self.page.maxh : y;
+        if (ny < 0) ny = 0;
+        self.synched('scroll', function() {
+          self.setScrollTop(ny);
+          self.setScrollLeft(nx);
+        });
+      };
+      this.cancelScroll = function() {}; // direct
+    } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
+      this.prepareTransition = function(dif, istime) {
+        var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
+        var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
+        if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
+          self.lasttransitionstyle = trans;
+          self.doc.css(cap.transitionstyle, trans);
+        }
+        return ex;
+      };
+
+      this.doScrollLeft = function(x, spd) { //trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //trans
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection      
+
+        if (self.opt.bouncescroll == false) {
+          if (y < 0) y = 0;
+          else if (y > self.page.maxh) y = self.page.maxh;
+          if (x < 0) x = 0;
+          else if (x > self.page.maxw) x = self.page.maxw;
+        }
+
+        if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        self.newscrollspeed = spd || false;
+
+        if (self.timer) return false;
+
+        self.timer = setTimeout(function() {
+
+          var top = self.getScrollTop();
+          var lft = self.getScrollLeft();
+
+          var dst = {};
+          dst.x = x - lft;
+          dst.y = y - top;
+          dst.px = lft;
+          dst.py = top;
+
+          var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
+          var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
+          if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
+
+          self.prepareTransition(ms, true);
+
+          if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+
+          if (ms > 0) {
+
+            if (!self.scrollrunning && self.onscrollstart) {
+              var info = {
+                "type": "scrollstart",
+                "current": {
+                  "x": lft,
+                  "y": top
+                },
+                "request": {
+                  "x": x,
+                  "y": y
+                },
+                "end": {
+                  "x": self.newscrollx,
+                  "y": self.newscrolly
+                },
+                "speed": ms
+              };
+              self.onscrollstart.call(self, info);
+            }
+
+            if (cap.transitionend) {
+              if (!self.scrollendtrapped) {
+                self.scrollendtrapped = true;
+                self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
+              }
+            } else {
+              if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
+              self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
+            }
+
+            var py = top;
+            var px = lft;
+            self.timerscroll = {
+              bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
+              bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
+            };
+            if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
+              self.showCursor(self.getScrollTop(), self.getScrollLeft());
+            }, 60);
+
+          }
+
+          self.synched("doScroll-set", function() {
+            self.timer = 0;
+            if (self.scrollendtrapped) self.scrollrunning = true;
+            self.setScrollTop(self.newscrolly);
+            self.setScrollLeft(self.newscrollx);
+            if (!self.scrollendtrapped) self.onScrollTransitionEnd();
+          });
+
+
+        }, 50);
+
+      };
+
+      this.cancelScroll = function() {
+        if (!self.scrollendtrapped) return true;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.scrollrunning = false;
+        if (!cap.transitionend) clearTimeout(cap.transitionend);
+        self.scrollendtrapped = false;
+        self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.prepareTransition(0);
+        self.setScrollTop(py); // fire event onscroll
+        if (self.railh) self.setScrollLeft(px);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+
+        self.cursorfreezed = false;
+
+        self.showCursor(py, px);
+        return self;
+      };
+      this.onScrollTransitionEnd = function() {
+        if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.scrollendtrapped = false;
+        self.prepareTransition(0);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.setScrollTop(py); // fire event onscroll        
+        if (self.railh) self.setScrollLeft(px); // fire event onscroll left
+
+        self.noticeCursor(false, py, px);
+
+        self.cursorfreezed = false;
+
+        if (py < 0) py = 0;
+        else if (py > self.page.maxh) py = self.page.maxh;
+        if (px < 0) px = 0;
+        else if (px > self.page.maxw) px = self.page.maxw;
+        if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
+
+        if (self.onscrollend && self.scrollrunning) {
+          self.triggerScrollEnd();
+        }
+        self.scrollrunning = false;
+
+      };
+
+    } else {
+
+      this.doScrollLeft = function(x, spd) { //no-trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //no-trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //no-trans
+        var y = (y === undefined || y === false) ? self.getScrollTop(true) : y;
+
+        if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
+
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        if (!self.bouncescroll || !self.rail.visibility) {
+          if (self.newscrolly < 0) {
+            self.newscrolly = 0;
+          } else if (self.newscrolly > self.page.maxh) {
+            self.newscrolly = self.page.maxh;
+          }
+        }
+        if (!self.bouncescroll || !self.railh.visibility) {
+          if (self.newscrollx < 0) {
+            self.newscrollx = 0;
+          } else if (self.newscrollx > self.page.maxw) {
+            self.newscrollx = self.page.maxw;
+          }
+        }
+
+        self.dst = {};
+        self.dst.x = x - px;
+        self.dst.y = y - py;
+        self.dst.px = px;
+        self.dst.py = py;
+
+        var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
+
+        self.dst.ax = self.dst.x / dst;
+        self.dst.ay = self.dst.y / dst;
+
+        var pa = 0;
+        var pe = dst;
+
+        if (self.dst.x == 0) {
+          pa = py;
+          pe = y;
+          self.dst.ay = 1;
+          self.dst.py = 0;
+        } else if (self.dst.y == 0) {
+          pa = px;
+          pe = x;
+          self.dst.ax = 1;
+          self.dst.px = 0;
+        }
+
+        var ms = self.getTransitionSpeed(dst);
+        if (spd && spd <= 1) ms *= spd;
+        if (ms > 0) {
+          self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
+        } else {
+          self.bzscroll = false;
+        }
+
+        if (self.timer) return;
+
+        if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
+
+        var sync = 1;
+
+        function scrolling() {
+          if (self.cancelAnimationFrame) return true;
+
+          self.scrollrunning = true;
+
+          sync = 1 - sync;
+          if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
+
+          var done = 0;
+          var sx, sy;
+
+          var sc = sy = self.getScrollTop();
+          if (self.dst.ay) {
+            sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
+            var dr = sc - sy;
+            if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
+            self.setScrollTop(sc);
+            if (sc == self.newscrolly) done = 1;
+          } else {
+            done = 1;
+          }
+
+          var scx = sx = self.getScrollLeft();
+          if (self.dst.ax) {
+            scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
+            var dr = scx - sx;
+            if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
+            self.setScrollLeft(scx);
+            if (scx == self.newscrollx) done += 1;
+          } else {
+            done += 1;
+          }
+
+          if (done == 2) {
+            self.timer = 0;
+            self.cursorfreezed = false;
+            self.bzscroll = false;
+            self.scrollrunning = false;
+            if (sc < 0) sc = 0;
+            else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh);
+            if (scx < 0) scx = 0;
+            else if (scx > self.page.maxw) scx = self.page.maxw;
+            if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
+            else {
+              if (self.onscrollend) {
+                self.triggerScrollEnd();
+              }
+            }
+          } else {
+            self.timer = setAnimationFrame(scrolling) || 1;
+          }
+        }
+        self.cancelAnimationFrame = false;
+        self.timer = 1;
+
+        if (self.onscrollstart && !self.scrollrunning) {
+          var info = {
+            "type": "scrollstart",
+            "current": {
+              "x": px,
+              "y": py
+            },
+            "request": {
+              "x": x,
+              "y": y
+            },
+            "end": {
+              "x": self.newscrollx,
+              "y": self.newscrolly
+            },
+            "speed": ms
+          };
+          self.onscrollstart.call(self, info);
+        }
+
+        scrolling();
+
+        if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
+
+        self.noticeCursor();
+      };
+
+      this.cancelScroll = function() {
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+        self.bzscroll = false;
+        self.scrollrunning = false;
+        return self;
+      };
+
+    }
+
+    this.doScrollBy = function(stp, relative) {
+      var ny = 0;
+
+      if (relative) {
+        ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
+      } else {
+        var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
+        ny = sy - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.h / 2);
+        if (ny < -haf) ny = -haf;
+        else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
+      }
+      self.cursorfreezed = false;
+
+      var py = self.getScrollTop(true);
+      if (ny < 0 && py <= 0) return self.noticeCursor();
+      else if (ny > self.page.maxh && py >= self.page.maxh) {
+        self.checkContentSize();
+        return self.noticeCursor();
+      }
+
+      self.doScrollTop(ny);
+    };
+
+    this.doScrollLeftBy = function(stp, relative) {
+      var nx = 0;
+      if (relative) {
+        nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x);
+      } else {
+        var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
+        nx = sx - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.w / 2);
+        if (nx < -haf) nx = -haf;
+        else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
+      }
+      self.cursorfreezed = false;
+
+      var px = self.getScrollLeft(true);
+      if (nx < 0 && px <= 0) return self.noticeCursor();
+      else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
+
+      self.doScrollLeft(nx);
+    };
+
+    this.doScrollTo = function(pos, relative) {
+      var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
+      if (ny < 0) ny = 0;
+      else if (ny > self.page.maxh) ny = self.page.maxh;
+      self.cursorfreezed = false;
+      self.doScrollTop(pos);
+    };
+
+    this.checkContentSize = function() {
+      var pg = self.getContentSize();
+      if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
+    };
+
+    self.onscroll = function(e) {
+      if (self.rail.drag) return;
+      if (!self.cursorfreezed) {
+        self.synched('scroll', function() {
+          self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+          if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+          self.noticeCursor();
+        });
+      }
+      self.triggerScrollEnd();
+    };
+    self.bind(self.docscroll, "scroll", self.onscroll);
+
+    this.doZoomIn = function(e) {
+      if (self.zoomactive) return;
+      self.zoomactive = true;
+
+      self.zoomrestore = {
+        style: {}
+      };
+      var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
+      var win = self.win[0].style;
+      for (var a in lst) {
+        var pp = lst[a];
+        self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
+      }
+
+      self.zoomrestore.style.width = self.win.css('width');
+      self.zoomrestore.style.height = self.win.css('height');
+
+      self.zoomrestore.padding = {
+        w: self.win.outerWidth() - self.win.width(),
+        h: self.win.outerHeight() - self.win.height()
+      };
+
+      if (cap.isios4) {
+        self.zoomrestore.scrollTop = $(window).scrollTop();
+        $(window).scrollTop(0);
+      }
+
+      self.win.css({
+        position: (cap.isios4) ? "absolute" : "fixed",
+        top: 0,
+        left: 0,
+        zIndex: globalmaxzindex + 100,
+        margin: 0
+      });
+      var bkg = self.win.css("backgroundColor");
+      if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
+      self.rail.css({
+        zIndex: globalmaxzindex + 101
+      });
+      self.zoom.css({
+        zIndex: globalmaxzindex + 102
+      });
+      self.zoom.css('backgroundPosition', '0px -18px');
+      self.resizeZoom();
+
+      if (self.onzoomin) self.onzoomin.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoomOut = function(e) {
+      if (!self.zoomactive) return;
+      self.zoomactive = false;
+
+      self.win.css("margin", "");
+      self.win.css(self.zoomrestore.style);
+
+      if (cap.isios4) {
+        $(window).scrollTop(self.zoomrestore.scrollTop);
+      }
+
+      self.rail.css({
+        "z-index": self.zindex
+      });
+      self.zoom.css({
+        "z-index": self.zindex
+      });
+      self.zoomrestore = false;
+      self.zoom.css('backgroundPosition', '0px 0px');
+      self.onResize();
+
+      if (self.onzoomout) self.onzoomout.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoom = function(e) {
+      return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
+    };
+
+    this.resizeZoom = function() {
+      if (!self.zoomactive) return;
+
+      var py = self.getScrollTop(); //preserve scrolling position
+      self.win.css({
+        width: $(window).width() - self.zoomrestore.padding.w + "px",
+        height: $(window).height() - self.zoomrestore.padding.h + "px"
+      });
+      self.onResize();
+
+      self.setScrollTop(Math.min(self.page.maxh, py));
+    };
+
+    this.init();
+
+    $.nicescroll.push(this);
+
+  };
+
+  // Inspired by the work of Kin Blas
+  // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js  
+
+
+  var ScrollMomentumClass2D = function(nc) {
+    var self = this;
+    this.nc = nc;
+
+    this.lastx = 0;
+    this.lasty = 0;
+    this.speedx = 0;
+    this.speedy = 0;
+    this.lasttime = 0;
+    this.steptime = 0;
+    this.snapx = false;
+    this.snapy = false;
+    this.demulx = 0;
+    this.demuly = 0;
+
+    this.lastscrollx = -1;
+    this.lastscrolly = -1;
+
+    this.chkx = 0;
+    this.chky = 0;
+
+    this.timer = 0;
+
+    this.time = function() {
+      return +new Date(); //beautifull hack
+    };
+
+    this.reset = function(px, py) {
+      self.stop();
+      var now = self.time();
+      self.steptime = 0;
+      self.lasttime = now;
+      self.speedx = 0;
+      self.speedy = 0;
+      self.lastx = px;
+      self.lasty = py;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.update = function(px, py) {
+      var now = self.time();
+      self.steptime = now - self.lasttime;
+      self.lasttime = now;
+      var dy = py - self.lasty;
+      var dx = px - self.lastx;
+      var sy = self.nc.getScrollTop();
+      var sx = self.nc.getScrollLeft();
+      var newy = sy + dy;
+      var newx = sx + dx;
+      self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
+      self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
+      self.speedx = dx;
+      self.speedy = dy;
+      self.lastx = px;
+      self.lasty = py;
+    };
+
+    this.stop = function() {
+      self.nc.unsynched("domomentum2d");
+      if (self.timer) clearTimeout(self.timer);
+      self.timer = 0;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.doSnapy = function(nx, ny) {
+      var snap = false;
+
+      if (ny < 0) {
+        ny = 0;
+        snap = true;
+      } else if (ny > self.nc.page.maxh) {
+        ny = self.nc.page.maxh;
+        snap = true;
+      }
+
+      if (nx < 0) {
+        nx = 0;
+        snap = true;
+      } else if (nx > self.nc.page.maxw) {
+        nx = self.nc.page.maxw;
+        snap = true;
+      }
+
+      (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
+    };
+
+    this.doMomentum = function(gp) {
+      var t = self.time();
+      var l = (gp) ? t + gp : self.lasttime;
+
+      var sl = self.nc.getScrollLeft();
+      var st = self.nc.getScrollTop();
+
+      var pageh = self.nc.page.maxh;
+      var pagew = self.nc.page.maxw;
+
+      self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
+      self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
+
+      var chk = l && (t - l) <= 60;
+
+      if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
+
+      var sy = (self.speedy && chk) ? self.speedy : false;
+      var sx = (self.speedx && chk) ? self.speedx : false;
+
+      if (sy || sx) {
+        var tm = Math.max(16, self.steptime); //timeout granularity
+
+        if (tm > 50) { // do smooth
+          var xm = tm / 50;
+          self.speedx *= xm;
+          self.speedy *= xm;
+          tm = 50;
+        }
+
+        self.demulxy = 0;
+
+        self.lastscrollx = self.nc.getScrollLeft();
+        self.chkx = self.lastscrollx;
+        self.lastscrolly = self.nc.getScrollTop();
+        self.chky = self.lastscrolly;
+
+        var nx = self.lastscrollx;
+        var ny = self.lastscrolly;
+
+        var onscroll = function() {
+          var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
+
+          if (self.speedx) {
+            nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
+            self.lastscrollx = nx;
+            if ((nx < 0) || (nx > pagew)) df = 0.10;
+          }
+
+          if (self.speedy) {
+            ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
+            self.lastscrolly = ny;
+            if ((ny < 0) || (ny > pageh)) df = 0.10;
+          }
+
+          self.demulxy = Math.min(1, self.demulxy + df);
+
+          self.nc.synched("domomentum2d", function() {
+
+            if (self.speedx) {
+              var scx = self.nc.getScrollLeft();
+//              if (scx != self.chkx) self.stop();
+              self.chkx = nx;
+              self.nc.setScrollLeft(nx);
+            }
+
+            if (self.speedy) {
+              var scy = self.nc.getScrollTop();
+//              if (scy != self.chky) self.stop();
+              self.chky = ny;
+              self.nc.setScrollTop(ny);
+            }
+
+            if (!self.timer) {
+              self.nc.hideCursor();
+              self.doSnapy(nx, ny);
+            }
+
+          });
+
+          if (self.demulxy < 1) {
+            self.timer = setTimeout(onscroll, tm);
+          } else {
+            self.stop();
+            self.nc.hideCursor();
+            self.doSnapy(nx, ny);
+          }
+        };
+
+        onscroll();
+
+      } else {
+        self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
+      }
+
+    };
+
+  };
+
+
+  // override jQuery scrollTop
+
+  var _scrollTop = jQuery.fn.scrollTop; // preserve original function
+
+  jQuery.cssHooks.pageYOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
+      return this;
+    }
+  };
+
+  /*  
+  $.fx.step["scrollTop"] = function(fx){    
+    $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
+  };
+*/
+
+  jQuery.fn.scrollTop = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
+      });
+    }
+  };
+
+  // override jQuery scrollLeft
+
+  var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
+
+  $.cssHooks.pageXOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
+      return this;
+    }
+  };
+
+  /*  
+  $.fx.step["scrollLeft"] = function(fx){
+    $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
+  };  
+*/
+
+  jQuery.fn.scrollLeft = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
+      });
+    }
+  };
+
+  var NiceScrollArray = function(doms) {
+    var self = this;
+    this.length = 0;
+    this.name = "nicescrollarray";
+
+    this.each = function(fn) {
+      $.each(self, fn);
+      return self;
+    };
+
+    this.push = function(nice) {
+      self[self.length] = nice;
+      self.length++;
+    };
+
+    this.eq = function(idx) {
+      return self[idx];
+    };
+
+    if (doms) {
+      for (var a = 0; a < doms.length; a++) {
+        var nice = $.data(doms[a], '__nicescroll') || false;
+        if (nice) {
+          this[this.length] = nice;
+          this.length++;
+        }
+      }
+    }
+
+    return this;
+  };
+
+  function mplex(el, lst, fn) {
+    for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
+  }
+  mplex(
+    NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
+    function(e, n) {
+      e[n] = function() {
+        var args = arguments;
+        return this.each(function() {
+          this[n].apply(this, args);
+        });
+      };
+    }
+  );
+
+  jQuery.fn.getNiceScroll = function(index) {
+    if (index === undefined) {
+      return new NiceScrollArray(this);
+    } else {
+      return this[index] && $.data(this[index], '__nicescroll') || false;
+    }
+  };
+
+  jQuery.expr[':'].nicescroll = function(a) {
+    return $.data(a, '__nicescroll') !== undefined;
+  };
+
+  $.fn.niceScroll = function(wrapper, opt) {
+    if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
+      opt = wrapper;
+      wrapper = false;
+    }
+    opt = $.extend({},opt); // cloning
+    var ret = new NiceScrollArray();
+    if (opt === undefined) opt = {};
+
+    if (wrapper || false) {
+      opt.doc = $(wrapper);
+      opt.win = $(this);
+    }
+    var docundef = !("doc" in opt);
+    if (!docundef && !("win" in opt)) opt.win = $(this);
+
+    this.each(function() {
+      var nice = $(this).data('__nicescroll') || false;
+      if (!nice) {
+        opt.doc = (docundef) ? $(this) : opt.doc;
+        nice = new NiceScrollClass(opt, $(this));
+        $(this).data('__nicescroll', nice);
+      }
+      ret.push(nice);
+    });
+    return (ret.length == 1) ? ret[0] : ret;
+  };
+
+  window.NiceScroll = {
+    getjQuery: function() {
+      return jQuery;
+    }
+  };
+
+  if (!$.nicescroll) {
+    $.nicescroll = new NiceScrollArray();
+    $.nicescroll.options = _globaloptions;
+  }
+
+}));
+

File diff suppressed because it is too large
+ 1 - 120
dist/jquery.nicescroll.min.js


BIN
dist/zoomico.png


+ 198 - 149
jquery.nicescroll.js

@@ -1,6 +1,6 @@
 /* jquery.nicescroll
 /* jquery.nicescroll
--- version 3.6.8
--- copyright 2016-02-29 InuYaksa*2016
+-- version 3.7.0 [maintenance edition]
+-- copyright 2017-05-21 InuYaksa*2017
 -- licensed under the MIT
 -- licensed under the MIT
 --
 --
 -- http://nicescroll.areaaperta.com/
 -- http://nicescroll.areaaperta.com/
@@ -38,20 +38,23 @@
     return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
     return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
   }
   }
 
 
-  var vendors = ['webkit','ms','moz','o'];
-
-  var setAnimationFrame = window.requestAnimationFrame || false;
-  var clearAnimationFrame = window.cancelAnimationFrame || false;
-
-  if (!setAnimationFrame) {  // legacy detection
-    for (var vx in vendors) {
-      var v = vendors[vx];
-      setAnimationFrame = window[v + 'RequestAnimationFrame'];
-      if (setAnimationFrame) {
-        clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
-        break;
-      }
-    }
+  // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/  
+  var setAnimationFrame = (function(){ return window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || false; })();
+  var clearAnimationFrame = (function(){ return window.cancelAnimationFrame || window.webkitCancelAnimationFrame || window.mozCancelAnimationFrame || false; })();  
+  if (!setAnimationFrame) {
+    setAnimationFrame = function(callback, element) {
+      var currTime = new Date().getTime();
+      var timeToCall = Math.max(0, 16 - (currTime - lastTime));
+      var id = window.setTimeout(function() { callback(currTime + timeToCall); },
+        timeToCall);
+      lastTime = currTime + timeToCall;
+      return id;
+    };
+    clearAnimationFrame = function(id) {
+      window.clearTimeout(id);
+    };
+  } else {
+    if (!window.cancelAnimationFrame) clearAnimationFrame = function(id) {};
   }
   }
 
 
   var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
   var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
@@ -66,7 +69,8 @@
     cursorborderradius: "5px",
     cursorborderradius: "5px",
     scrollspeed: 60,
     scrollspeed: 60,
     mousescrollstep: 8 * 3,
     mousescrollstep: 8 * 3,
-    touchbehavior: false,
+    touchbehavior: false,   // deprecated
+    emulatetouch: false,    // replacing touchbehavior
     hwacceleration: true,
     hwacceleration: true,
     usetransition: true,
     usetransition: true,
     boxzoom: false,
     boxzoom: false,
@@ -112,7 +116,8 @@
     oneaxismousemode: "auto",
     oneaxismousemode: "auto",
     scriptpath: getScriptPath(),
     scriptpath: getScriptPath(),
     preventmultitouchscrolling: true,
     preventmultitouchscrolling: true,
-    disablemutationobserver:false
+    disablemutationobserver:false,
+    enableobserver:true
   };
   };
 
 
   var browserdetected = false;
   var browserdetected = false;
@@ -135,24 +140,23 @@
 
 
     d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
     d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
     d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
     d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
-    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
-    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
-    d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9);
-    d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
+    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode === 7));
+    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode === 8);
+    d.isie9 = d.isie && ("performance" in window) && (document.documentMode === 9);
+    d.isie10 = d.isie && ("performance" in window) && (document.documentMode === 10);
     d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
     d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
-    d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./));  // IE Edge 12
-    d.isieedge = ("msOverflowStyle" in _el);  // IE Edge
-    d.ismodernie = d.isie11 || d.isieedge;
-    
+
+    d.ismsedge = ("msCredentials" in window);  // MS Edge 14+
+
     d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
     d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
     if (d.isie9mobile) d.isie9 = false;
     if (d.isie9mobile) d.isie9 = false;
     d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
     d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
 
 
     d.ismozilla = ("MozAppearance" in _style);
     d.ismozilla = ("MozAppearance" in _style);
 
 
-    d.iswebkit = ("WebkitAppearance" in _style);
+    d.iswebkit = !d.ismsedge&&("WebkitAppearance" in _style);
 
 
-    d.ischrome = ("chrome" in window);
+    d.ischrome = !d.ismsedge&&("chrome" in window);
     d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
     d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
     d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
     d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
     d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
     d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
@@ -167,6 +171,7 @@
     d.isios4 = ((d.isios) && !("seal" in Object));
     d.isios4 = ((d.isios) && !("seal" in Object));
     d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
     d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
     d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
     d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
+    d.isios10 = (d.isios&&window.Proxy);  //iOS 10+
 
 
     d.isandroid = (/android/i.test(_agent));
     d.isandroid = (/android/i.test(_agent));
 
 
@@ -179,39 +184,50 @@
     d.hastransition = false;
     d.hastransition = false;
     d.transitionend = false;
     d.transitionend = false;
 
 
-    var a;
-    var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
-    for (a = 0; a < check.length; a++) {
-      if (_style[check[a]] !== undefined) {
-        d.trstyle = check[a];
-        break;
+    d.trstyle = "transform";
+    d.hastransform = ("transform" in _style)||(function(){
+      var a;
+      var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
+      for (a = 0; a < check.length; a++) {
+        if (_style[check[a]] !== undefined) {
+          d.trstyle = check[a];
+          break;
+        }
       }
       }
-    }
-    d.hastransform = (!!d.trstyle);
+      d.hastransform = (!!d.trstyle);
+    })(); 
+
     if (d.hastransform) {
     if (d.hastransform) {
       _style[d.trstyle] = "translate3d(1px,2px,3px)";
       _style[d.trstyle] = "translate3d(1px,2px,3px)";
       d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
       d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
     }
     }
 
 
-    d.transitionstyle = false;
+    d.transitionstyle = "transition";
     d.prefixstyle = '';
     d.prefixstyle = '';
-    d.transitionend = false;
-    check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
-    var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
-    var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
-    for (a = 0; a < check.length; a++) {
-      if (check[a] in _style) {
-        d.transitionstyle = check[a];
-        d.prefixstyle = prefix[a];
-        d.transitionend = evs[a];
-        break;
+    d.transitionend = "transitionend";
+
+    d.hastransition = ("transition" in _style)||(function(){
+
+      d.transitionend = false;
+      var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+      var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+      var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+      for (var a = 0; a < check.length; a++) {
+        if (check[a] in _style) {
+          d.transitionstyle = check[a];
+          d.prefixstyle = prefix[a];
+          d.transitionend = evs[a];
+          break;
+        }
+      }    
+      if (d.ischrome26) {  // always use prefix
+        d.prefixstyle = prefix[1];
       }
       }
-    }
-    if (d.ischrome26) {  // always use prefix
-      d.prefixstyle = prefix[1];
-    }
+      d.hastransition = (d.transitionstyle);
+
+    })();
+
 
 
-    d.hastransition = (d.transitionstyle);
 
 
     function detectCursorGrab() {
     function detectCursorGrab() {
       var lst = ['grab','-webkit-grab', '-moz-grab'];
       var lst = ['grab','-webkit-grab', '-moz-grab'];
@@ -221,7 +237,7 @@
         _style.cursor = p;
         _style.cursor = p;
         if (_style.cursor == p) return p;
         if (_style.cursor == p) return p;
       }
       }
-      return 'url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor!
+      return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thank to https://cdnjs.com/ for the openhand cursor!
     }
     }
     d.cursorgrabvalue = detectCursorGrab();
     d.cursorgrabvalue = detectCursorGrab();
 
 
@@ -240,7 +256,7 @@
 
 
     var self = this;
     var self = this;
 
 
-    this.version = '3.6.8';
+    this.version = '3.7.0';
     this.name = 'nicescroll';
     this.name = 'nicescroll';
 
 
     this.me = me;
     this.me = me;
@@ -795,9 +811,9 @@
 
 
     };
     };
 
 
-    self.hasanimationframe = (setAnimationFrame);
-    self.hascancelanimationframe = (clearAnimationFrame);
-
+    self.hasanimationframe = ("requestAnimationFrame" in window);
+    self.hascancelanimationframe = ("cancelAnimationFrame" in window);
+/*
     if (!self.hasanimationframe) {
     if (!self.hasanimationframe) {
       setAnimationFrame = function(fn) {
       setAnimationFrame = function(fn) {
         return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
         return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
@@ -806,6 +822,7 @@
     } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
     } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
       self.cancelAnimationFrame = true;
       self.cancelAnimationFrame = true;
     };
     };
+*/    
 
 
     this.init = function() {
     this.init = function() {
     
     
@@ -813,14 +830,12 @@
       
       
       if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
       if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
       if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
       if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
-
-      var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action';
-      if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
-        _touchaction: 'none'
-      });
+      if (cap.isandroid && !("hidden" in document)) return true; // Android 3- SORRY, DO NOT WORK!
 
 
       var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
       var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
       
       
+      self.opt.emulatetouch = self.opt.emulatetouch||self.opt.touchbehavior;  // mantain compatibility with "touchbehavior"      
+
       self.zindex = "auto";
       self.zindex = "auto";
       if (!self.ispage && self.opt.zindex == "auto") {
       if (!self.ispage && self.opt.zindex == "auto") {
         self.zindex = getZIndex() || "auto";
         self.zindex = getZIndex() || "auto";
@@ -1194,11 +1209,12 @@
 
 
         } else {
         } else {
 
 
-          if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
+          if (cap.cantouch || self.istouchcapable || self.opt.emulatetouch || cap.hasmstouch) {
 
 
             self.scrollmom = new ScrollMomentumClass2D(self);
             self.scrollmom = new ScrollMomentumClass2D(self);
 
 
             self.ontouchstart = function(e) {
             self.ontouchstart = function(e) {
+
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
               
               
               self.hasmoving = false;
               self.hasmoving = false;
@@ -1247,7 +1263,8 @@
                   st: self.getScrollTop(),
                   st: self.getScrollTop(),
                   sl: self.getScrollLeft(),
                   sl: self.getScrollLeft(),
                   pt: 2,
                   pt: 2,
-                  dl: false
+                  dl: false,
+                  tg: tg
                 };
                 };
 
 
                 if (self.ispage || !self.opt.directionlockdeadzone) {
                 if (self.ispage || !self.opt.directionlockdeadzone) {
@@ -1273,7 +1290,7 @@
                   if (!self.rail.drag.ck) self.rail.drag.dl = "f";
                   if (!self.rail.drag.ck) self.rail.drag.dl = "f";
                 }
                 }
 
 
-                if (self.opt.touchbehavior && self.isiframe && cap.isie) {
+                if (self.opt.emulatetouch && self.isiframe && cap.isie) {
                   var wp = self.win.position();
                   var wp = self.win.position();
                   self.rail.drag.x += wp.left;
                   self.rail.drag.x += wp.left;
                   self.rail.drag.y += wp.top;
                   self.rail.drag.y += wp.top;
@@ -1285,10 +1302,10 @@
                 
                 
                 if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
                 if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
                 
                 
-                  var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
+                  var ip = (tg) ? /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName) : false;
                   if (!ip) {
                   if (!ip) {
                     if (!self.ispage && cap.hasmousecapture) tg.setCapture();
                     if (!self.ispage && cap.hasmousecapture) tg.setCapture();
-                    if (self.opt.touchbehavior) {
+                    if (self.opt.emulatetouch) {
                       if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
                       if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
                         tg._onclick = tg.onclick;
                         tg._onclick = tg.onclick;
                         tg.onclick = function(e) {
                         tg.onclick = function(e) {
@@ -1314,18 +1331,27 @@
             };
             };
 
 
             self.ontouchend = function(e) {              
             self.ontouchend = function(e) {              
+
               if (!self.rail.drag) return true;              
               if (!self.rail.drag) return true;              
               if (self.rail.drag.pt == 2) {
               if (self.rail.drag.pt == 2) {
-                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-								
-                self.scrollmom.doMomentum();
+                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;                
+
+                if (!self.hasmoving) {
+                  var tg = self.rail.drag.tg;
+                  setTimeout(function(){
+                    tg&&$(tg).trigger("click");
+                  },20);
+                }
                 self.rail.drag = false;
                 self.rail.drag = false;
-                if (self.hasmoving) {
+
+                if (self.hasmoving) {                  
+                  self.scrollmom.doMomentum();
                   self.lastmouseup = true;
                   self.lastmouseup = true;
                   self.hideCursor();
                   self.hideCursor();
                   if (cap.hasmousecapture) document.releaseCapture();
                   if (cap.hasmousecapture) document.releaseCapture();
                   if (!cap.cantouch) return self.cancelEvent(e);
                   if (!cap.cantouch) return self.cancelEvent(e);
                 }
                 }
+
               }
               }
               else if (self.rail.drag.pt == 1) {
               else if (self.rail.drag.pt == 1) {
                 return self.onmouseup(e);
                 return self.onmouseup(e);
@@ -1333,27 +1359,22 @@
 
 
             };
             };
 
 
-            var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
+            var moveneedoffset = (self.opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
 
 
             self.ontouchmove = function(e, byiframe) {
             self.ontouchmove = function(e, byiframe) {
 
 
               if (!self.rail.drag) return false;
               if (!self.rail.drag) return false;
-            
+
               if (e.targetTouches && self.opt.preventmultitouchscrolling) {
               if (e.targetTouches && self.opt.preventmultitouchscrolling) {
                 if (e.targetTouches.length > 1) return false; // multitouch
                 if (e.targetTouches.length > 1) return false; // multitouch
               }
               }
             
             
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-          
-              if (self.rail.drag.pt == 2) {
-                if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements
-
-                self.hasmoving = true;
+              
+              cap.isandroid && self.cancelEvent(e);
 
 
-                if (self.preventclick && !self.preventclick.click) {
-                  self.preventclick.click = self.preventclick.tg.onclick || false;
-                  self.preventclick.tg.onclick = self.onpreventclick;
-                }
+              if (self.rail.drag.pt == 2) {
+                //if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements  <--- not works on modern devices
 
 
                 var ev = $.extend({
                 var ev = $.extend({
                   "original": e
                   "original": e
@@ -1374,6 +1395,15 @@
                   e.clientY = le.screenY;
                   e.clientY = le.screenY;
                 }
                 }
 
 
+                if (self.rail.drag.y===e.clientY&&self.rail.drag.x===e.clientX) return false;  // prevent first useless move event 
+
+                self.hasmoving = true;
+
+                if (self.preventclick && !self.preventclick.click) {
+                  self.preventclick.click = self.preventclick.tg.onclick || false;
+                  self.preventclick.tg.onclick = self.onpreventclick;
+                }
+
                 var ofy,ofx;
                 var ofy,ofx;
                 ofx = ofy = 0;
                 ofx = ofy = 0;
 
 
@@ -1565,7 +1595,7 @@
               sx: self.scroll.x,
               sx: self.scroll.x,
               sy: self.scroll.y,
               sy: self.scroll.y,
               pt: 1,
               pt: 1,
-              hr: (!!hronly)
+              hr: hronly||false
             };
             };
             var tg = self.getTarget(e);
             var tg = self.getTarget(e);
             if (!self.ispage && cap.hasmousecapture) tg.setCapture();
             if (!self.ispage && cap.hasmousecapture) tg.setCapture();
@@ -1594,9 +1624,9 @@
 
 
           self.onmousemove = function(e) {
           self.onmousemove = function(e) {
             if (self.rail.drag) {
             if (self.rail.drag) {
-              if (self.rail.drag.pt != 1) return;
+              if (self.rail.drag.pt !== 1) return;
 
 
-              if (cap.ischrome && e.which == 0) return self.onmouseup(e);
+              if (cap.ischrome && e.which === 0) return self.onmouseup(e);
 
 
               self.cursorfreezed = true;
               self.cursorfreezed = true;
               self.hasmoving = true;
               self.hasmoving = true;
@@ -1634,7 +1664,7 @@
             }
             }
           };
           };
 
 
-          if (cap.cantouch || self.opt.touchbehavior) {
+          if (cap.cantouch || self.opt.emulatetouch) {
 
 
             self.onpreventclick = function(e) {
             self.onpreventclick = function(e) {
               if (self.preventclick) {
               if (self.preventclick) {
@@ -1644,7 +1674,7 @@
               }
               }
             };
             };
 
 
-            self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
+            //self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging  <-- REENABLE!!
 
 
             self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
             self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
               if (self.lastmouseup) {
               if (self.lastmouseup) {
@@ -1723,11 +1753,10 @@
                 checkSelectionScroll(e);
                 checkSelectionScroll(e);
               }, 250);
               }, 250);
             };
             };
-
-
           }
           }
 
 
           if (cap.hasw3ctouch) { //IE11+
           if (cap.hasw3ctouch) { //IE11+
+            self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
             self.css(self.rail, {
             self.css(self.rail, {
               'touch-action': 'none'
               'touch-action': 'none'
             });
             });
@@ -1738,6 +1767,7 @@
             self.bind(document, "pointerup", self.ontouchend);
             self.bind(document, "pointerup", self.ontouchend);
             self.bind(document, "pointermove", self.ontouchmove);
             self.bind(document, "pointermove", self.ontouchmove);
           } else if (cap.hasmstouch) { //IE10
           } else if (cap.hasmstouch) { //IE10
+            self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
             self.css(self.rail, {
             self.css(self.rail, {
               '-ms-touch-action': 'none'
               '-ms-touch-action': 'none'
             });
             });
@@ -1753,15 +1783,20 @@
             self.bind(self.cursor, "contextmenu", function(e) {
             self.bind(self.cursor, "contextmenu", function(e) {
               e.preventDefault();
               e.preventDefault();
             });
             });
-          } else if (this.istouchcapable) { //desktop with screen touch enabled
-            self.bind(self.win, "touchstart", self.ontouchstart);
-            self.bind(document, "touchend", self.ontouchend);
-            self.bind(document, "touchcancel", self.ontouchend);
-            self.bind(document, "touchmove", self.ontouchmove);
+          } else if (cap.cantouch) { // smartphones/touch devices
+            self.bind(self.win, "touchstart", self.ontouchstart,false,true);
+            self.bind(document, "touchend", self.ontouchend,false,true);
+            self.bind(document, "touchcancel", self.ontouchend,false,true);
+            self.bind(document, "touchmove", self.ontouchmove,false,true);
           }
           }
 
 
+          if (self.opt.emulatetouch) {
+            self.bind(self.win, "mousedown", self.ontouchstart,false,true);
+            self.bind(document, "mouseup", self.ontouchend,false,true);
+            self.bind(document, "mousemove", self.ontouchmove,false,true);
+          }
           
           
-          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
+          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.emulatetouch)) {
 
 
             self.rail.css({
             self.rail.css({
               cursor: "default"
               cursor: "default"
@@ -1836,7 +1871,7 @@
             self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
             self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
           }
           }
 
 
-          if (!cap.cantouch && !self.opt.touchbehavior) {
+          if (!cap.cantouch && !self.opt.emulatetouch) {
 
 
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
             self.bind(document, "mousemove", self.onmousemove);
             self.bind(document, "mousemove", self.onmousemove);
@@ -1874,7 +1909,7 @@
           } else {
           } else {
 
 
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
-            self.bind(document, "mousemove", self.ontouchmove);
+            //self.bind(document, "mousemove", self.ontouchmove);
             if (self.onclick) self.bind(document, "click", self.onclick);
             if (self.onclick) self.bind(document, "click", self.onclick);
 
 
             if (self.opt.cursordragontouch) {
             if (self.opt.cursordragontouch) {
@@ -2049,59 +2084,63 @@
           self.lazyResize(self.isieold ? 250 : 30);
           self.lazyResize(self.isieold ? 250 : 30);
         };
         };
 
 
-        if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
-          self.observerbody = new ClsMutationObserver(function(mutations) {
-            mutations.forEach(function(mut){
-              if (mut.type=="attributes") {
-                return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
-              }
-            });
-            // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
-            if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
-          });
-          self.observerbody.observe(document.body, {
-            childList: true,
-            subtree: true,
-            characterData: false,
-            attributes: true,
-            attributeFilter: ['class']
-          });
-        }
-        
-        if (!self.ispage && !self.haswrapper) {
-          // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
-          if (ClsMutationObserver !== false) {
-            self.observer = new ClsMutationObserver(function(mutations) {
-              mutations.forEach(self.onAttributeChange);
+        if (self.opt.enableobserver) {
+
+          if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
+            self.observerbody = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(function(mut){
+                if (mut.type=="attributes") {
+                  return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+                }
+              });
+              // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
+              if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
             });
             });
-            self.observer.observe(self.win[0], {
+            self.observerbody.observe(document.body, {
               childList: true,
               childList: true,
+              subtree: true,
               characterData: false,
               characterData: false,
               attributes: true,
               attributes: true,
-              subtree: false
+              attributeFilter: ['class']
             });
             });
-            self.observerremover = new ClsMutationObserver(function(mutations) {
-              mutations.forEach(function(mo) {
-                if (mo.removedNodes.length > 0) {
-                  for (var dd in mo.removedNodes) {
-                    if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+          }
+          
+          if (!self.ispage && !self.haswrapper) {
+            // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+            if (ClsMutationObserver !== false) {
+              self.observer = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(self.onAttributeChange);
+              });
+              self.observer.observe(self.win[0], {
+                childList: true,
+                characterData: false,
+                attributes: true,
+                subtree: false
+              });
+              self.observerremover = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(function(mo) {
+                  if (mo.removedNodes.length > 0) {
+                    for (var dd in mo.removedNodes) {
+                      if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+                    }
                   }
                   }
-                }
+                });
               });
               });
-            });
-            self.observerremover.observe(self.win[0].parentNode, {
-              childList: true,
-              characterData: false,
-              attributes: false,
-              subtree: false
-            });
-          } else {
-            self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
-            if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
-            self.bind(self.win, "DOMNodeRemoved", function(e) {
-              if (e.target == self.win[0]) self.remove();
-            });
+              self.observerremover.observe(self.win[0].parentNode, {
+                childList: true,
+                characterData: false,
+                attributes: false,
+                subtree: false
+              });
+            } else {
+              self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+              if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+              self.bind(self.win, "DOMNodeRemoved", function(e) {
+                if (e.target == self.win[0]) self.remove();
+              });
+            }
           }
           }
+
         }
         }
 
 
         //
         //
@@ -2180,7 +2219,11 @@
 
 
           if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
           if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
 
 
-          if (cap.cantouch || self.opt.touchbehavior) {
+          if (cap.cantouch) {
+            self.bind(doc, "touchstart", self.ontouchstart);
+            self.bind(doc, "touchmove", self.ontouchmove);          
+          } 
+          else if (self.opt.emulatetouch) {
             self.bind(doc, "mousedown", self.ontouchstart);
             self.bind(doc, "mousedown", self.ontouchstart);
             self.bind(doc, "mousemove", function(e) {
             self.bind(doc, "mousemove", function(e) {
               return self.ontouchmove(e, true);
               return self.ontouchmove(e, true);
@@ -2437,7 +2480,7 @@
 			if (!self.haswrapper) self.hide();	
 			if (!self.haswrapper) self.hide();	
 			if (self.hlazyresize) clearTimeout(self.hlazyresize);
 			if (self.hlazyresize) clearTimeout(self.hlazyresize);
 			self.hlazyresize = setTimeout(function(){
 			self.hlazyresize = setTimeout(function(){
-				self && self.show().resize();
+				if (self) { self.resize(); self.show(); }  // this form mandatory for uglify
 			},240);
 			},240);
 			
 			
       return self;
       return self;
@@ -2500,12 +2543,16 @@
     
     
     if (cap.haseventlistener) {  // W3C standard event model
     if (cap.haseventlistener) {  // W3C standard event model
     
     
-      this.bind = function(dom, name, fn, bubble) {  // W3C
+      this.bind = function(dom, name, fn, bubble, active) {  // W3C
         var el = ("jquery" in dom) ? dom[0] : dom;
         var el = ("jquery" in dom) ? dom[0] : dom;
-        self._bind(el, name, fn, bubble || false);
+        self._bind(el, name, fn, bubble || false, active || false);
       };
       };
-    
-      this._bind = function(el, name, fn, bubble) { // primitive bind
+
+      // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
+      var passiveSupported = false;
+      try{var options=Object.defineProperty({},"passive",{get:function(){passiveSupported=!0}});window.addEventListener("test",null,options)}catch(err){}
+      this._bind = function(el, name, fn, bubble, active) { // primitive bind
+      
         self.events.push({
         self.events.push({
           e: el,
           e: el,
           n: name,
           n: name,
@@ -2513,7 +2560,8 @@
           b: bubble,
           b: bubble,
           q: false
           q: false
         });
         });
-        el.addEventListener(name, fn, bubble || false);
+
+        (passiveSupported&&active) ? el.addEventListener(name, fn, {passive:false,capture:bubble}) : el.addEventListener(name, fn, bubble || false);
       };    
       };    
       this.cancelEvent = function(e) {
       this.cancelEvent = function(e) {
         if (!e) return false;
         if (!e) return false;
@@ -3266,6 +3314,7 @@
 
 
     this.doScrollBy = function(stp, relative) {
     this.doScrollBy = function(stp, relative) {
       var ny = 0;
       var ny = 0;
+
       if (relative) {
       if (relative) {
         ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
         ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
       } else {
       } else {

File diff suppressed because it is too large
+ 0 - 0
jquery.nicescroll.min.js


+ 26 - 16
package.json

@@ -1,6 +1,6 @@
 {
 {
   "name": "nicescroll",
   "name": "nicescroll",
-  "version": "3.6.8",
+  "version": "3.7.0",
   "bugs": "http://github.com/inuyaksa/jquery.nicescroll/issues",
   "bugs": "http://github.com/inuyaksa/jquery.nicescroll/issues",
   "repository": {
   "repository": {
     "type": "git",
     "type": "git",
@@ -12,15 +12,15 @@
     "url": "https://github.com/inuyaksa"
     "url": "https://github.com/inuyaksa"
   },
   },
   "licenses": "MIT",
   "licenses": "MIT",
-	"autoupdate": {
+  "autoupdate": {
     "source": "git",
     "source": "git",
     "target": "git://github.com/inuyaksa/jquery.nicescroll.git",
     "target": "git://github.com/inuyaksa/jquery.nicescroll.git",
     "basePath": "dist",
     "basePath": "dist",
     "files": [
     "files": [
       "**/*"
       "**/*"
     ]
     ]
-  },	
-  "description": "Nicescroll is a jquery plugin, for nice customizabled scrollbars with a very similar ios/mobile style. It supports DIVs, IFrames and document page (body) scrollbars. Compatible with Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+ (all A-grade browsers). Compatible with iOS devices as iPad, Android, Blackberry, Windows Phone, and many many mobile and touch devices.",
+  },
+  "description": "Nicescroll is a jquery plugin, for nice customizabled scrollbars with a very similar ios/mobile style. It supports DIVs, IFrames and document page (body) scrollbars. Compatible with modern browsers Chrome/Firefox/Edge/Safari/Opera for smartphone ios/android and desktop pc/mac: iphone/ipad/ipod, android, surface, pc (chrome/firefox) mac (safari/chrome). Compatibile with older browers too, such as IE11/10/9, some limitations could exists.",
   "keywords": [
   "keywords": [
     "nicescroll",
     "nicescroll",
     "jquery",
     "jquery",
@@ -36,7 +36,12 @@
     "desktop",
     "desktop",
     "scrollbar",
     "scrollbar",
     "touch",
     "touch",
-    "android"
+    "android",
+    "chrome",
+    "firefox",
+    "safari",
+    "surface",
+    "edge"
   ],
   ],
   "homepage": "https://github.com/inuyaksa/jquery.nicescroll",
   "homepage": "https://github.com/inuyaksa/jquery.nicescroll",
   "contributors": [
   "contributors": [
@@ -56,21 +61,26 @@
     "TNKSoftware"
     "TNKSoftware"
   ],
   ],
   "files": [
   "files": [
-    "jquery.nicescroll.js",
-    "jquery.nicescroll.min.js",
-    "zoomico.png"
+    "dist/jquery.nicescroll.js",
+    "dist/jquery.nicescroll.min.js",
+    "dist/zoomico.png"
   ],
   ],
   "main": "jquery.nicescroll.js",
   "main": "jquery.nicescroll.js",
   "dependencies": {
   "dependencies": {
     "jquery": ">=1.8.3"
     "jquery": ">=1.8.3"
   },
   },
-  "devDependencies": {},
+  "devDependencies": {
+    "grunt-contrib-copy": "^1.0.0",
+    "grunt-contrib-jshint": "^1.1.0"
+  },
   "npmName": "nicescroll",
   "npmName": "nicescroll",
-  "npmFileMap": [{
-    "basePath": "/dist/",
-    "files": [
-      "*.js",
-      "zoomico.png"
-    ]
-  }]
+  "npmFileMap": [
+    {
+      "basePath": "/dist/",
+      "files": [
+        "*.js",
+        "zoomico.png"
+      ]
+    }
+  ]
 }
 }

BIN
zoomico.png


Some files were not shown because too many files changed in this diff