Pārlūkot izejas kodu

mobile android/ios fixes and other important fixes

- typos on touchaction for IE10+ #658
- MS Edge (14+) detection fixed
#655
- webkitCancelRequestAnimationFrame deprecated #650
-
enableobserver option added #643
- Bug in bower.json #617
- Versions
from "3.6.7" to "latest" brokes scroll on touch devices #634
-
Horizontal scroll doesn't work on mobile devices tested with chrome &
firefox on Android #646
- How to Scroll in Mobile Device #626
- 3.6.7
not working on ios or android #574
- On iPhone safari does not work
#649
- Touch scrolling leads to a click event on Windows touch (Edge and
Firefox browser) #614
- Nicescroll not working in IOS 9+ #611
- fixed
ghost horizontal scrollbar
- enableobserver (default:true), attach Mutation Observers (or
alternative observers) to monitoring any attribute change at nicescroll
DOM, on performance issue you can disable
- deprecated touchbehavior, new touchemulate option, name changing I
hope solve many misunderstanding about this option meaning
- a little
more saving on zoomico.png (from 393b to 254b)
InuYaksa 8 gadi atpakaļ
vecāks
revīzija
d4bb7f786a

+ 1 - 1
MIT.LICENSE

@@ -2,7 +2,7 @@ Open Source Initiative OSI - The MIT License (MIT):Licensing
 [OSI Approved License]
 The MIT License (MIT)
 
-Copyright (c) 2011-14 InuYaksa
+Copyright (c) 2011-17 InuYaksa
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated
 documentation files (the "Software"), to deal in the Software without restriction, including without limitation

+ 7 - 6
README.md

@@ -1,5 +1,5 @@
 #jQuery.NiceScroll
-v. 3.6.8 02-29-2016
+v. 3.7.0 2017-05-21
 
  - [Web Site: nicescroll.areaaperta.com](http://nicescroll.areaaperta.com)
  - [Repo: github.com/inuyaksa/jquery.nicescroll](https://github.com/inuyaksa/jquery.nicescroll)
@@ -14,13 +14,13 @@ v. 3.6.8 02-29-2016
 
   - HORIZONAL scrollbar support!
   - It supports DIVs, IFrames, textarea, and document page (body) scrollbars.
-  - Compatible with all desktop browser: Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+. (all A-grade browsers)
-  - Compatible with mobile device: iPad/iPhone/iPod, Android 2.2+, Blackberry phones and Playbook (WebWorks/Table OS), Windows Phone 7.5 Mango.
+  - Compatible with all recent desktop browser and older: Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+. (all A-grade browsers)
+  - Compatible with mobile device: iPad/iPhone/iPod, Android 2.2+, Blackberry phones and Playbook (WebWorks/Table OS), Windows Phone 10 and older.
   - Compatible with all touch devices: iPad, Android tablets, Window Surface.
   - Compabible with multi-input device (mouse with touch or pen): Window Surface, Chrome Desktop on touch notebook.
   - Compatible with 2 directions mice: Apple Magic Mouse, Apple Mouser with 2-dir wheel, PC mouse with 2-dir wheel (if browser support it).
 
-So you have scrollable divs with momentum for iPad 4+ and you have consistent scrollable areas for all desktop and mobile platforms.
+So you have customizable and scrollable divs with momentum for iPad and you have consistent scrollable areas for all desktop and mobile platforms.
 
 Sexy zoom feature, you can "zoom-in" the content of any nicescroll'ed div.
 Nice to use and nice to see, all the content of the div in fullscreen mode.
@@ -123,7 +123,8 @@ $("#thisdiv").niceScroll({
     zindex: "auto" | <number>, // change z-index for scrollbar div
     scrollspeed: 60, // scrolling speed
     mousescrollstep: 40, // scrolling speed with mouse wheel (pixel)
-    touchbehavior: false, // enable cursor-drag scrolling like touch devices in desktop computer
+    touchbehavior: false, // DEPRECATED!! use "touchemulate"
+    touchemulate: false, // enable cursor-drag scrolling like touch devices in desktop computer
     hwacceleration: true, // use hardware accelerated scroll when supported
     boxzoom: false, // enable zoom for box content
     dblclickzoom: true, // (only when boxzoom=true) zoom activated when double click on box
@@ -176,7 +177,7 @@ Related projects
 
 * LICENSE
 
-## Copyright 2011-16 InuYaksa
+## Copyright 2011-17 InuYaksa
 
 ######Licensed under the MIT License, http://www.opensource.org/licenses/mit-license.php
 ######Images used for zoom icons have derived from OLPC interface, http://laptop.org/8.2.0/manual/Browse_ChangingView.html

+ 1 - 1
bower.json

@@ -1,7 +1,7 @@
 {
     "name": "jquery.nicescroll",
     "main": [
-        "./jquery.nicescroll.js"
+        "./jquery.nicescroll.min.js"
     ],
     "ignore": [
         "**/.*",

+ 0 - 31
changelog_3.6.8.txt

@@ -1,31 +0,0 @@
-Changelog nicescroll release 3.6.8
-http://nicescroll.areaaperta.com/
-https://github.com/inuyaksa/jquery.nicescroll
-
-
-Changed features
-
-New options
-- disablemutationobserver, = TRUE when you want that MutationObserver disabled #580
-
-Fixes
-- Fix show of null #583
-- Refactoring js #582
-- Removed comments #577
-- Timeouts & using on dynamic DOM Elements: "Uncaught TypeError" #579
-- version 3.6.6 stack overflow #578 
-- MutationObserver. IE11 crashes #568 
-- Xbox One IE Edge browser can't scroll anywhere #581 (to test on real hw!)
-- NIce Scroll doesnt work on Window Surface IE Edge #555
-
-
-Thanks to great contributors!!
-@silversonicaxel
-@vsn4ik
-@ronar
-@StephanBijzitter
- 
-
-
-TODO
-- deprecate legacy browsers

+ 40 - 0
changelog_3.7.0.txt

@@ -0,0 +1,40 @@
+Changelog nicescroll release 3.7.0
+http://nicescroll.areaaperta.com/
+https://github.com/inuyaksa/jquery.nicescroll
+
+
+Fixes
+- typos on touchaction for IE10+ #658
+- MS Edge (14+) detection fixed #655
+- webkitCancelRequestAnimationFrame deprecated #650
+- enableobserver option added #643
+- Bug in bower.json #617
+- Versions from "3.6.7" to "latest" brokes scroll on touch devices #634
+- Horizontal scroll doesn't work on mobile devices tested with chrome & firefox on Android #646
+- How to Scroll in Mobile Device #626
+- 3.6.7 not working on ios or android #574
+- On iPhone safari does not work #649
+- Touch scrolling leads to a click event on Windows touch (Edge and Firefox browser) #614
+- Nicescroll not working in IOS 9+ #611
+- fixed ghost horizontal scrollbar
+
+
+New options
+- enableobserver (default:true), attach Mutation Observers (or alternative observers) to monitoring any attribute change at nicescroll DOM, on performance issue you can disable
+
+
+Changes 
+- deprecated touchbehavior, new touchemulate option, name changing I hope solve many misunderstanding about this option meaning
+
+
+TODO
+- railpadding
+- railpadding top & bottom settings ignored - thanks to simovinci.bellissimo
+- honorcssoverflow
+- autohidemode:hover
+- check 2D scrolling
+- check text selection on cursor drag (testing)
+- recursive position:fixed check
+- check horiz mouse wheel scrolling speed on chrome
+- mouse pan scroll
+

+ 9 - 6
demo/browser.html

@@ -1,4 +1,4 @@
-<!DOCTYPE html>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
 <html xmlns="http://www.w3.org/1999/xhtml">
 <head>
 <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
@@ -24,7 +24,7 @@ body {
 }
 </style>
 
-<script src="//code.jquery.com/jquery-1.11.3.min.js"></script>
+<script src="//code.jquery.com/jquery-1.11.1.min.js"></script>
 <script src="js/jquery.nicescroll.min.js"></script>
 
 <script>
@@ -34,7 +34,7 @@ body {
     nice = $("html").niceScroll();
   });
   
-  var obj = window;
+  var obj = window;//$(window);
   
   console.log(obj.length);
   console.log("selector" in obj);
@@ -63,6 +63,7 @@ body {
 	toCell(3,6,nice.detected.isieold);
 
   toCell(7,1,nice.detected.isie11);
+  toCell(7,2,nice.detected.ismsedge);
   
 	toCell(4,1,nice.detected.isopera);
   toCell(4,2,nice.detected.isopera12);
@@ -70,6 +71,8 @@ body {
 	
 	toCell(5,1,nice.detected.isios);
 	toCell(5,2,nice.detected.isios4);
+  toCell(5,3,nice.detected.isios8);
+  toCell(5,4,nice.detected.isios10);
 
   toCell(6,1,nice.detected.ischrome);
 	toCell(6,2,nice.detected.ischrome22);
@@ -135,7 +138,7 @@ body {
     <td bgcolor="#E0E0E9">Opera&nbsp;12</td>
     <td bgcolor="#E0E0E9">iOS4- <span class="num">(6)</span></td>
 		<td bgcolor="#E0E0E9">Chrome 22+</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">MSEdge</td>
   </tr>
   <tr>
     <td bgcolor="#E0E0E9">&nbsp;</td>
@@ -143,7 +146,7 @@ body {
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">IE9+</td>
     <td bgcolor="#E0E0E9">Opera&nbsp;Mini</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">iOS8</td>
 		<td bgcolor="#E0E0E9">Chrome 26+</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
   </tr>
@@ -153,7 +156,7 @@ body {
     <td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">IE8</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
-    <td bgcolor="#E0E0E9">&nbsp;</td>
+    <td bgcolor="#E0E0E9">iOS10</td>
 		<td bgcolor="#E0E0E9">&nbsp;</td>
     <td bgcolor="#E0E0E9">&nbsp;</td>
   </tr>

Failā izmaiņas netiks attēlotas, jo tās ir par lielu
+ 1 - 120
demo/js/jquery.nicescroll.min.js


+ 3847 - 0
dist/jquery.nicescroll.js

@@ -0,0 +1,3847 @@
+/* jquery.nicescroll
+-- version 3.7.0 [maintenance edition]
+-- copyright 2017-05-21 InuYaksa*2017
+-- licensed under the MIT
+--
+-- http://nicescroll.areaaperta.com/
+-- https://github.com/inuyaksa/jquery.nicescroll
+--
+*/
+
+(function(factory) {
+  if (typeof define === 'function' && define.amd) {
+    // AMD. Register as anonymous module.
+    define(['jquery'], factory);
+  } else if (typeof exports === 'object') {
+    // Node/CommonJS.
+    module.exports = factory(require('jquery'));
+  } else {
+    // Browser globals.
+    factory(jQuery);
+  }
+}(function(jQuery) {
+  "use strict";
+
+  // globals
+  var domfocus = false;
+  var mousefocus = false;
+  var tabindexcounter = 0;
+  var ascrailcounter = 2000;
+  var globalmaxzindex = 0;
+
+  var $ = jQuery; // sandbox
+
+  // http://stackoverflow.com/questions/2161159/get-script-path
+  function getScriptPath() {
+    var scripts = document.getElementsByTagName('script');
+    var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
+    return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
+  }
+
+  // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/  
+  var setAnimationFrame = (function(){ return window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || false; })();
+  var clearAnimationFrame = (function(){ return window.cancelAnimationFrame || window.webkitCancelAnimationFrame || window.mozCancelAnimationFrame || false; })();  
+  if (!setAnimationFrame) {
+    setAnimationFrame = function(callback, element) {
+      var currTime = new Date().getTime();
+      var timeToCall = Math.max(0, 16 - (currTime - lastTime));
+      var id = window.setTimeout(function() { callback(currTime + timeToCall); },
+        timeToCall);
+      lastTime = currTime + timeToCall;
+      return id;
+    };
+    clearAnimationFrame = function(id) {
+      window.clearTimeout(id);
+    };
+  } else {
+    if (!window.cancelAnimationFrame) clearAnimationFrame = function(id) {};
+  }
+
+  var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
+
+  var _globaloptions = {
+    zindex: "auto",
+    cursoropacitymin: 0,
+    cursoropacitymax: 1,
+    cursorcolor: "#424242",
+    cursorwidth: "6px",
+    cursorborder: "1px solid #fff",
+    cursorborderradius: "5px",
+    scrollspeed: 60,
+    mousescrollstep: 8 * 3,
+    touchbehavior: false,   // deprecated
+    emulatetouch: false,    // replacing touchbehavior
+    hwacceleration: true,
+    usetransition: true,
+    boxzoom: false,
+    dblclickzoom: true,
+    gesturezoom: true,
+    grabcursorenabled: true,
+    autohidemode: true,
+    background: "",
+    iframeautoresize: true,
+    cursorminheight: 32,
+    preservenativescrolling: true,
+    railoffset: false,
+    railhoffset: false,
+    bouncescroll: true,
+    spacebarenabled: true,
+    railpadding: {
+      top: 0,
+      right: 0,
+      left: 0,
+      bottom: 0
+    },
+    disableoutline: true,
+    horizrailenabled: true,
+    railalign: "right",
+    railvalign: "bottom",
+    enabletranslate3d: true,
+    enablemousewheel: true,
+    enablekeyboard: true,
+    smoothscroll: true,
+    sensitiverail: true,
+    enablemouselockapi: true,
+    //      cursormaxheight:false,
+    cursorfixedheight: false,
+    directionlockdeadzone: 6,
+    hidecursordelay: 400,
+    nativeparentscrolling: true,
+    enablescrollonselection: true,
+    overflowx: true,
+    overflowy: true,
+    cursordragspeed: 0.3,
+    rtlmode: "auto",
+    cursordragontouch: false,
+    oneaxismousemode: "auto",
+    scriptpath: getScriptPath(),
+    preventmultitouchscrolling: true,
+    disablemutationobserver:false,
+    enableobserver:true
+  };
+
+  var browserdetected = false;
+
+  var getBrowserDetection = function() {
+
+    if (browserdetected) return browserdetected;
+
+    var _el = document.createElement('DIV'),
+        _style = _el.style,
+        _agent = navigator.userAgent,
+        _platform = navigator.platform,
+        d = {};
+
+    d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
+
+    d.isopera = ("opera" in window); // 12-
+    d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
+    d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
+
+    d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
+    d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
+    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode === 7));
+    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode === 8);
+    d.isie9 = d.isie && ("performance" in window) && (document.documentMode === 9);
+    d.isie10 = d.isie && ("performance" in window) && (document.documentMode === 10);
+    d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
+
+    d.ismsedge = ("msCredentials" in window);  // MS Edge 14+
+
+    d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
+    if (d.isie9mobile) d.isie9 = false;
+    d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
+
+    d.ismozilla = ("MozAppearance" in _style);
+
+    d.iswebkit = !d.ismsedge&&("WebkitAppearance" in _style);
+
+    d.ischrome = !d.ismsedge&&("chrome" in window);
+    d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
+    d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
+    d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
+    
+    d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation    
+    d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
+    d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events
+
+    d.ismac = /^mac$/i.test(_platform);
+    
+    d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
+    d.isios4 = ((d.isios) && !("seal" in Object));
+    d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
+    d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
+    d.isios10 = (d.isios&&window.Proxy);  //iOS 10+
+
+    d.isandroid = (/android/i.test(_agent));
+
+    d.haseventlistener = ("addEventListener" in _el);
+    
+    d.trstyle = false;
+    d.hastransform = false;
+    d.hastranslate3d = false;
+    d.transitionstyle = false;
+    d.hastransition = false;
+    d.transitionend = false;
+
+    d.trstyle = "transform";
+    d.hastransform = ("transform" in _style)||(function(){
+      var a;
+      var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
+      for (a = 0; a < check.length; a++) {
+        if (_style[check[a]] !== undefined) {
+          d.trstyle = check[a];
+          break;
+        }
+      }
+      d.hastransform = (!!d.trstyle);
+    })(); 
+
+    if (d.hastransform) {
+      _style[d.trstyle] = "translate3d(1px,2px,3px)";
+      d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
+    }
+
+    d.transitionstyle = "transition";
+    d.prefixstyle = '';
+    d.transitionend = "transitionend";
+
+    d.hastransition = ("transition" in _style)||(function(){
+
+      d.transitionend = false;
+      var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+      var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+      var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+      for (var a = 0; a < check.length; a++) {
+        if (check[a] in _style) {
+          d.transitionstyle = check[a];
+          d.prefixstyle = prefix[a];
+          d.transitionend = evs[a];
+          break;
+        }
+      }    
+      if (d.ischrome26) {  // always use prefix
+        d.prefixstyle = prefix[1];
+      }
+      d.hastransition = (d.transitionstyle);
+
+    })();
+
+
+
+    function detectCursorGrab() {
+      var lst = ['grab','-webkit-grab', '-moz-grab'];
+      if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
+      for (var a = 0; a < lst.length; a++) {
+        var p = lst[a];
+        _style.cursor = p;
+        if (_style.cursor == p) return p;
+      }
+      return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thank to https://cdnjs.com/ for the openhand cursor!
+    }
+    d.cursorgrabvalue = detectCursorGrab();
+
+    d.hasmousecapture = ("setCapture" in _el);
+
+    d.hasMutationObserver = (ClsMutationObserver !== false);
+
+    _el = null; //memory released
+
+    browserdetected = d;
+
+    return d;
+  };
+
+  var NiceScrollClass = function(myopt, me) {
+
+    var self = this;
+
+    this.version = '3.7.0';
+    this.name = 'nicescroll';
+
+    this.me = me;
+
+    this.opt = {
+      doc: $("body"),
+      win: false
+    };
+
+    $.extend(this.opt, _globaloptions);  // clone opts
+
+    // Options for internal use
+    this.opt.snapbackspeed = 80;
+
+    if (myopt || false) {
+      for (var a in self.opt) {
+        if (myopt[a] !== undefined) self.opt[a] = myopt[a];
+      }
+    }
+
+    if (self.opt.disablemutationobserver) ClsMutationObserver = false;
+    
+    this.doc = self.opt.doc;
+    this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
+    this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
+    this.haswrapper = (self.opt.win !== false);
+    this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
+    this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
+    this.body = $("body");
+    this.viewport = false;
+
+    this.isfixed = false;
+
+    this.iframe = false;
+    this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
+
+    this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
+
+    this.forcescreen = false; //force to use screen position on events
+
+    this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
+
+    // Events jump table    
+    this.onmousedown = false;
+    this.onmouseup = false;
+    this.onmousemove = false;
+    this.onmousewheel = false;
+    this.onkeypress = false;
+    this.ongesturezoom = false;
+    this.onclick = false;
+
+    // Nicescroll custom events
+    this.onscrollstart = false;
+    this.onscrollend = false;
+    this.onscrollcancel = false;
+
+    this.onzoomin = false;
+    this.onzoomout = false;
+
+    // Let's start!  
+    this.view = false;
+    this.page = false;
+
+    this.scroll = {
+      x: 0,
+      y: 0
+    };
+    this.scrollratio = {
+      x: 0,
+      y: 0
+    };
+    this.cursorheight = 20;
+    this.scrollvaluemax = 0;
+
+    // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
+    // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
+    if (this.opt.rtlmode == "auto") {
+      var target = this.win[0] == window ? this.body : this.win;
+      var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
+
+      if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") {
+        this.isrtlmode = (target.css("direction") == "rtl");
+        this.isvertical = false;
+      } else {
+        this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
+        this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
+      }
+    } else {
+      this.isrtlmode = (this.opt.rtlmode === true);
+      this.isvertical = false;
+    }
+    //    this.checkrtlmode = false;
+    
+    this.scrollrunning = false;
+
+    this.scrollmom = false;
+
+    this.observer        = false;  // observer div changes
+    this.observerremover = false;  // observer on parent for remove detection
+    this.observerbody    = false;  // observer on body for position change
+
+    do {
+      this.id = "ascrail" + (ascrailcounter++);
+    } while (document.getElementById(this.id));
+
+    this.rail = false;
+    this.cursor = false;
+    this.cursorfreezed = false;
+    this.selectiondrag = false;
+
+    this.zoom = false;
+    this.zoomactive = false;
+
+    this.hasfocus = false;
+    this.hasmousefocus = false;
+
+    this.visibility = true;
+    this.railslocked = false;  // locked by resize
+    this.locked = false;  // prevent lost of locked status sets by user
+    this.hidden = false; // rails always hidden
+    this.cursoractive = true; // user can interact with cursors
+
+    this.wheelprevented = false; //prevent mousewheel event
+
+    this.overflowx = self.opt.overflowx;
+    this.overflowy = self.opt.overflowy;
+
+    this.nativescrollingarea = false;
+    this.checkarea = 0;
+
+    this.events = []; // event list for unbind
+
+    this.saved = {};  // style saved
+
+    this.delaylist = {};
+    this.synclist = {};
+
+    this.lastdeltax = 0;
+    this.lastdeltay = 0;
+
+    this.detected = getBrowserDetection();
+
+    var cap = $.extend({}, this.detected);
+
+    this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
+    this.ishwscroll = (this.canhwscroll && self.haswrapper);
+
+    if (!this.isrtlmode) {
+      this.hasreversehr = false;
+    } else if (this.isvertical) { // RTL mode with reverse horizontal axis
+      this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
+    } else {
+      this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
+    }
+
+    this.istouchcapable = false; // desktop devices with touch screen support
+
+    //## Check WebKit-based desktop with touch support
+    //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
+    
+    if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) {  // desktop device with multiple input
+      this.istouchcapable = true;
+    } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
+      this.istouchcapable = true;
+//      cap.cantouch = false; // parse normal desktop events
+    }
+
+    //## disable MouseLock API on user request
+    if (!self.opt.enablemouselockapi) {
+      cap.hasmousecapture = false;
+      cap.haspointerlock = false;
+    }
+
+/* deprecated
+    this.delayed = function(name, fn, tm, lazy) {
+    };
+*/    
+
+/*
+    this.debounced = function(name, fn, tm) {
+		if (!self) return;
+      var dd = self.delaylist[name];
+      self.delaylist[name] = fn;
+      if (!dd) {
+        self.debouncedelayed =  setTimeout(function() {
+					if (!self) return;
+          var fn = self.delaylist[name];
+          self.delaylist[name] = false;
+          fn.call(self);
+        }, tm);
+      }
+    };
+*/
+
+		this.debounced = function(name, fn, tm) {
+      if (!self) return;
+			var dd = self.delaylist[name]||false;
+			if (!dd) {
+        //fixed loop call fn:checkSelectionScroll
+				//fn.call(self);				
+				self.delaylist[name] = {
+					h: setAnimationFrame(function(){
+						self.delaylist[name].fn.call(self);
+					  self.delaylist[name] = false;	
+					}, tm)
+				};
+        fn.call(self);
+			}			
+			self.delaylist[name].fn = fn;				
+		};
+
+    var _onsync = false;
+
+    this.synched = function(name, fn) {
+
+      function requestSync() {
+        if (_onsync) return;
+        setAnimationFrame(function() {
+          if (!self) return;
+          _onsync = false;
+          for (var nn in self.synclist) {
+            var fn = self.synclist[nn];
+            if (fn) fn.call(self);
+            self.synclist[nn] = false;
+          }
+        });
+        _onsync = true;
+      }
+
+      self.synclist[name] = fn;
+      requestSync();
+      return name;
+    };
+
+    this.unsynched = function(name) {
+      if (self.synclist[name]) self.synclist[name] = false;
+    };
+
+    this.css = function(el, pars) { // save & set
+      for (var n in pars) {
+        self.saved.css.push([el, n, el.css(n)]);
+        el.css(n, pars[n]);
+      }
+    };
+
+    this.scrollTop = function(val) {
+      return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
+    };
+
+    this.scrollLeft = function(val) {
+      return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
+    };
+
+    // derived by by Dan Pupius www.pupius.net
+    var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
+    
+      this.st = st;
+      this.ed = ed;
+      this.spd = spd;
+
+      this.p1 = p1 || 0;
+      this.p2 = p2 || 1;
+      this.p3 = p3 || 0;
+      this.p4 = p4 || 1;
+
+      this.ts = (new Date()).getTime();
+      this.df = this.ed - this.st;
+    };
+    BezierClass.prototype = {
+      B2: function(t) {
+        return 3 * t * t * (1 - t);
+      },
+      B3: function(t) {
+        return 3 * t * (1 - t) * (1 - t);
+      },
+      B4: function(t) {
+        return (1 - t) * (1 - t) * (1 - t);
+      },
+      getNow: function() {
+        var nw = (new Date()).getTime();
+        var pc = 1 - ((nw - this.ts) / this.spd);
+        var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
+        return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
+      },
+      update: function(ed, spd) {
+        this.st = this.getNow();
+        this.ed = ed;
+        this.spd = spd;
+        this.ts = (new Date()).getTime();
+        this.df = this.ed - this.st;
+        return this;
+      }
+    };
+
+    //derived from http://stackoverflow.com/questions/11236090/
+    function getMatrixValues() {
+      var tr = self.doc.css(cap.trstyle);
+      if (tr && (tr.substr(0, 6) == "matrix")) {
+        return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
+      }
+      return false;
+    }
+
+    if (this.ishwscroll) {
+      // hw accelerated scroll
+      this.doc.translate = {
+        x: 0,
+        y: 0,
+        tx: "0px",
+        ty: "0px"
+      };
+
+      //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
+      if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/      
+
+      this.getScrollTop = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
+        }
+        return self.doc.translate.y;
+      };
+
+      this.getScrollLeft = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
+        }
+        return self.doc.translate.x;
+      };
+
+      this.notifyScrollEvent = function(el) {
+        var e = document.createEvent("UIEvents");
+        e.initUIEvent("scroll", false, true, window, 1);
+        e.niceevent = true;
+        el.dispatchEvent(e);
+      };
+
+      var cxscrollleft = (this.isrtlmode) ? 1 : -1;
+
+      if (cap.hastranslate3d && self.opt.enabletranslate3d) {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      } else {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      }
+    } else {
+      // native scroll
+      this.getScrollTop = function() {
+        return self.docscroll.scrollTop();
+      };
+      this.setScrollTop = function(val) {
+        return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1);
+      };
+      this.getScrollLeft = function() {
+        var val;
+        if (!self.hasreversehr) {
+          val = self.docscroll.scrollLeft();
+        } else if (self.detected.ismozilla) {
+          val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
+        } else {
+          val = self.page.maxw - self.docscroll.scrollLeft();
+        }
+        return val;
+      };
+      this.setScrollLeft = function(val) {
+        return setTimeout(function() {
+          if (!self) return;
+					if (self.hasreversehr) {
+						if (self.detected.ismozilla) {
+							val = -(self.page.maxw - val);
+						} else {
+							val = self.page.maxw - val;
+						}
+					}
+					return self.docscroll.scrollLeft(val);
+				}, 1);					
+      };
+    }
+
+    this.getTarget = function(e) {
+      if (!e) return false;
+      if (e.target) return e.target;
+      if (e.srcElement) return e.srcElement;
+      return false;
+    };
+
+    this.hasParent = function(e, id) {
+      if (!e) return false;
+      var el = e.target || e.srcElement || e || false;
+      while (el && el.id != id) {
+        el = el.parentNode || false;
+      }
+      return (el !== false);
+    };
+
+    function getZIndex() {
+      var dom = self.win;
+      if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
+      while (dom.length > 0) {
+        if (dom[0].nodeType == 9) return false;
+        var zi = dom.css('zIndex');
+        if (!isNaN(zi) && zi != 0) return parseInt(zi);
+        dom = dom.parent();
+      }
+      return false;
+    }
+
+    //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
+    var _convertBorderWidth = {
+      "thin": 1,
+      "medium": 3,
+      "thick": 5
+    };
+
+    function getWidthToPixel(dom, prop, chkheight) {
+      var wd = dom.css(prop);
+      var px = parseFloat(wd);
+      if (isNaN(px)) {
+        px = _convertBorderWidth[wd] || 0;
+        var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
+        if (self.isie8 && px) px += 1;
+        return (brd) ? px : 0;
+      }
+      return px;
+    }
+
+    this.getDocumentScrollOffset = function() {
+      return {
+        top: window.pageYOffset || document.documentElement.scrollTop,
+        left: window.pageXOffset || document.documentElement.scrollLeft
+      };
+    };
+    
+    this.getOffset = function() {
+      if (self.isfixed) {
+        var ofs = self.win.offset();  // fix Chrome auto issue (when right/bottom props only)
+        var scrl = self.getDocumentScrollOffset();
+        ofs.top-=scrl.top;
+        ofs.left-=scrl.left;
+        return ofs;  
+      }
+      var ww = self.win.offset();
+      if (!self.viewport) return ww;      
+      var vp = self.viewport.offset();
+      return {
+        top: ww.top - vp.top,// + self.viewport.scrollTop(),
+        left: ww.left - vp.left // + self.viewport.scrollLeft()
+      };
+    };
+
+    this.updateScrollBar = function(len) {
+      var pos, off;
+      if (self.ishwscroll) {
+        self.rail.css({  //**
+          height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+        if (self.railh) self.railh.css({  //**
+          width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
+        });
+        
+      } else {
+        var wpos = self.getOffset();
+        pos = {
+          top: wpos.top,
+          left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
+        };
+        pos.top += getWidthToPixel(self.win, 'border-top-width', true);
+        pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
+
+        off = self.opt.railoffset;
+        if (off) {
+          if (off.top) pos.top += off.top;
+          if (off.left) pos.left += off.left;
+        }
+        
+        if (!self.railslocked) self.rail.css({
+          top: pos.top,
+          left: pos.left,
+          height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+
+        if (self.zoom) {
+          self.zoom.css({
+            top: pos.top + 1,
+            left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
+          });
+        }
+
+        if (self.railh && !self.railslocked) {
+          pos = {
+            top: wpos.top,
+            left: wpos.left
+          };
+          off = self.opt.railhoffset;
+          if (off) {
+            if (off.top) pos.top += off.top;
+            if (off.left) pos.left += off.left;
+          }
+          var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
+          var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
+          self.railh.css({
+            top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
+            left: x,
+            width: self.railh.width
+          });
+        }
+
+      }
+    };
+
+    this.doRailClick = function(e, dbl, hr) {
+      var fn, pg, cur, pos;
+
+      if (self.railslocked) return;
+      self.cancelEvent(e);
+
+      if (dbl) {
+        fn = (hr) ? self.doScrollLeft : self.doScrollTop;
+        cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
+        fn(cur);
+      } else {
+        fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
+        cur = (hr) ? self.scroll.x : self.scroll.y;
+        pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
+        pg = (hr) ? self.view.w : self.view.h;
+        fn((cur >= pos) ? pg: -pg);//   (cur >= pos) ? fn(pg): fn(-pg);
+      }
+
+    };
+
+    self.hasanimationframe = ("requestAnimationFrame" in window);
+    self.hascancelanimationframe = ("cancelAnimationFrame" in window);
+/*
+    if (!self.hasanimationframe) {
+      setAnimationFrame = function(fn) {
+        return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
+      }; // 1000/60)};
+      clearAnimationFrame = clearTimeout;
+    } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
+      self.cancelAnimationFrame = true;
+    };
+*/    
+
+    this.init = function() {
+    
+      self.saved.css = [];
+      
+      if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
+      if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
+      if (cap.isandroid && !("hidden" in document)) return true; // Android 3- SORRY, DO NOT WORK!
+
+      var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
+      
+      self.opt.emulatetouch = self.opt.emulatetouch||self.opt.touchbehavior;  // mantain compatibility with "touchbehavior"      
+
+      self.zindex = "auto";
+      if (!self.ispage && self.opt.zindex == "auto") {
+        self.zindex = getZIndex() || "auto";
+      } else {
+        self.zindex = self.opt.zindex;
+      }
+
+      if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
+        globalmaxzindex = self.zindex;
+      }
+
+      if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
+        self.zindex = "auto";
+      }
+
+      if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
+
+        var cont = self.docscroll;
+        if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
+
+        if (!cap.isie9mobile) self.css(cont, _scrollyhidden);
+
+        if (self.ispage && cap.isie7) {
+          if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
+            'overflow-y': 'hidden'
+          }); //IE7 double scrollbar issue
+          else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue
+        }
+
+        if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
+          "-webkit-overflow-scrolling": "touch"
+        }); //force hw acceleration
+
+        var cursor = $(document.createElement('div'));
+        cursor.css({
+          position: "relative",
+          top: 0,
+          "float": "right",
+          width: self.opt.cursorwidth,
+          height: 0,
+          'background-color': self.opt.cursorcolor,
+          border: self.opt.cursorborder,
+          'background-clip': 'padding-box',
+          '-webkit-border-radius': self.opt.cursorborderradius,
+          '-moz-border-radius': self.opt.cursorborderradius,
+          'border-radius': self.opt.cursorborderradius
+        });
+
+        cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
+        
+        cursor.addClass('nicescroll-cursors');
+        
+        self.cursor = cursor;
+
+        var rail = $(document.createElement('div'));
+        rail.attr('id', self.id);
+        rail.addClass('nicescroll-rails nicescroll-rails-vr');
+
+        var v, a, kp = ["left","right","top","bottom"];  //**
+        for (var n in kp) {
+          a = kp[n];
+          v = self.opt.railpadding[a];
+          (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
+        }
+
+        rail.append(cursor);
+
+        rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
+        rail.css({
+          width: rail.width + "px",
+          zIndex: self.zindex,
+          background: self.opt.background,
+          cursor: "default"
+        });
+
+        rail.visibility = true;
+        rail.scrollable = true;
+
+        rail.align = (self.opt.railalign == "left") ? 0 : 1;
+
+        self.rail = rail;
+
+        self.rail.drag = false;
+
+        var zoom = false;
+        if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
+          zoom = document.createElement('div');
+
+          self.bind(zoom, "click", self.doZoom);
+          self.bind(zoom, "mouseenter", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymax);
+          });
+          self.bind(zoom, "mouseleave", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymin);
+          });
+
+          self.zoom = $(zoom);
+          self.zoom.css({
+            cursor: "pointer",
+            zIndex: self.zindex,
+            backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)',
+            height: 18,
+            width: 18,
+            backgroundPosition: '0px 0px'
+          });
+          if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
+          if (cap.cantouch && self.opt.gesturezoom) {
+            self.ongesturezoom = function(e) {
+              if (e.scale > 1.5) self.doZoomIn(e);
+              if (e.scale < 0.8) self.doZoomOut(e);
+              return self.cancelEvent(e);
+            };
+            self.bind(self.win, "gestureend", self.ongesturezoom);
+          }
+        }
+
+        // init HORIZ
+
+        self.railh = false;
+        var railh;
+
+        if (self.opt.horizrailenabled) {
+
+          self.css(cont, {
+            overflowX: 'hidden'
+          });
+
+          var cursor = $(document.createElement('div'));
+          cursor.css({
+            position: "absolute",
+            top: 0,
+            height: self.opt.cursorwidth,
+            width: 0,
+            backgroundColor: self.opt.cursorcolor,
+            border: self.opt.cursorborder,
+            backgroundClip: 'padding-box',
+            '-webkit-border-radius': self.opt.cursorborderradius,
+            '-moz-border-radius': self.opt.cursorborderradius,
+            'border-radius': self.opt.cursorborderradius
+          });
+
+          if (cap.isieold) cursor.css('overflow', 'hidden');  //IE6 horiz scrollbar issue
+          
+          cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
+          
+          cursor.addClass('nicescroll-cursors');
+          
+          self.cursorh = cursor;
+
+          railh = $(document.createElement('div'));
+          railh.attr('id', self.id + '-hr');
+          railh.addClass('nicescroll-rails nicescroll-rails-hr');
+          railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
+          railh.css({
+            height: railh.height + "px",
+            'zIndex': self.zindex,
+            "background": self.opt.background
+          });
+
+          railh.append(cursor);
+
+          railh.visibility = true;
+          railh.scrollable = true;
+
+          railh.align = (self.opt.railvalign == "top") ? 0 : 1;
+
+          self.railh = railh;
+
+          self.railh.drag = false;
+
+        }
+
+        //        
+
+        if (self.ispage) {
+          rail.css({
+            position: "fixed",
+            top: 0,
+            height: "100%"
+          });
+          (rail.align) ? rail.css({
+            right: 0
+          }): rail.css({
+            left: 0
+          });
+          self.body.append(rail);
+          if (self.railh) {
+            railh.css({
+              position: "fixed",
+              left: 0,
+              width: "100%"
+            });
+            (railh.align) ? railh.css({
+              bottom: 0
+            }): railh.css({
+              top: 0
+            });
+            self.body.append(railh);
+          }
+        } else {
+          if (self.ishwscroll) {
+            if (self.win.css('position') == 'static') self.css(self.win, {
+              'position': 'relative'
+            });
+            var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
+            $(bd).scrollTop(0).scrollLeft(0);  // fix rail position if content already scrolled
+            if (self.zoom) {
+              self.zoom.css({
+                position: "absolute",
+                top: 1,
+                right: 0,
+                "margin-right": rail.width + 4
+              });
+              bd.append(self.zoom);
+            }
+            rail.css({
+              position: "absolute",
+              top: 0
+            });
+            (rail.align) ? rail.css({
+              right: 0
+            }): rail.css({
+              left: 0
+            });
+            bd.append(rail);
+            if (railh) {
+              railh.css({
+                position: "absolute",
+                left: 0,
+                bottom: 0
+              });
+              (railh.align) ? railh.css({
+                bottom: 0
+              }): railh.css({
+                top: 0
+              });
+              bd.append(railh);
+            }
+          } else {
+            self.isfixed = (self.win.css("position") == "fixed");
+            var rlpos = (self.isfixed) ? "fixed" : "absolute";
+
+            if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
+            if (self.viewport) {
+              self.body = self.viewport;
+              if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
+                "position": "relative"
+              });
+            }
+
+            rail.css({
+              position: rlpos
+            });
+            if (self.zoom) self.zoom.css({
+              position: rlpos
+            });
+            self.updateScrollBar();
+            self.body.append(rail);
+            if (self.zoom) self.body.append(self.zoom);
+            if (self.railh) {
+              railh.css({
+                position: rlpos
+              });
+              self.body.append(railh);
+            }
+          }
+
+          if (cap.isios) self.css(self.win, {
+            '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
+            '-webkit-touch-callout': 'none'
+          }); // prevent grey layer on click
+
+          if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
+          if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none');  // Webkit outline
+          //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"});  // Opera 12- to test [TODO]
+
+        }
+
+        if (self.opt.autohidemode === false) {
+          self.autohidedom = false;
+          self.rail.css({
+            opacity: self.opt.cursoropacitymax
+          });
+          if (self.railh) self.railh.css({
+            opacity: self.opt.cursoropacitymax
+          });
+        } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
+          self.autohidedom = $().add(self.rail);
+          if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+          if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "scroll") {
+          self.autohidedom = $().add(self.rail);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+        } else if (self.opt.autohidemode == "cursor") {
+          self.autohidedom = $().add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "hidden") {
+          self.autohidedom = false;
+          self.hide();
+          self.railslocked = false;
+        }
+
+        if (cap.isie9mobile) {
+
+          self.scrollmom = new ScrollMomentumClass2D(self);
+
+          self.onmangotouch = function() {
+            var py = self.getScrollTop();
+            var px = self.getScrollLeft();
+
+            if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
+
+            var dfy = py - self.mangotouch.sy;
+            var dfx = px - self.mangotouch.sx;
+            var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
+            if (df == 0) return;
+
+            var dry = (dfy < 0) ? -1 : 1;
+            var drx = (dfx < 0) ? -1 : 1;
+
+            var tm = +new Date();
+            if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
+
+            if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
+              self.scrollmom.stop();
+              self.scrollmom.reset(px, py);
+              self.mangotouch.sy = py;
+              self.mangotouch.ly = py;
+              self.mangotouch.sx = px;
+              self.mangotouch.lx = px;
+              self.mangotouch.dry = dry;
+              self.mangotouch.drx = drx;
+              self.mangotouch.tm = tm;
+            } else {
+
+              self.scrollmom.stop();
+              self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
+              self.mangotouch.tm = tm;
+
+              var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
+              self.mangotouch.ly = py;
+              self.mangotouch.lx = px;
+
+              if (ds > 2) {
+                self.mangotouch.lazy = setTimeout(function() {
+                  self.mangotouch.lazy = false;
+                  self.mangotouch.dry = 0;
+                  self.mangotouch.drx = 0;
+                  self.mangotouch.tm = 0;
+                  self.scrollmom.doMomentum(30);
+                }, 100);
+              }
+            }
+          };
+
+          var top = self.getScrollTop();
+          var lef = self.getScrollLeft();
+          self.mangotouch = {
+            sy: top,
+            ly: top,
+            dry: 0,
+            sx: lef,
+            lx: lef,
+            drx: 0,
+            lazy: false,
+            tm: 0
+          };
+
+          self.bind(self.docscroll, "scroll", self.onmangotouch);
+
+        } else {
+
+          if (cap.cantouch || self.istouchcapable || self.opt.emulatetouch || cap.hasmstouch) {
+
+            self.scrollmom = new ScrollMomentumClass2D(self);
+
+            self.ontouchstart = function(e) {
+
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+              
+              self.hasmoving = false;
+
+              if (!self.railslocked) {
+                var tg;
+                if (cap.hasmstouch) {
+                  tg = (e.target) ? e.target : false;
+                  while (tg) {
+                    var nc = $(tg).getNiceScroll();
+                    if ((nc.length > 0) && (nc[0].me == self.me)) break;
+                    if (nc.length > 0) return false;
+                    if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
+                    tg = (tg.parentNode) ? tg.parentNode : false;
+                  }
+                }
+
+                self.cancelScroll();
+
+                tg = self.getTarget(e);
+
+                if (tg) {
+                  var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
+                  if (skp) return self.stopPropagation(e);
+                }
+
+                if (!("clientX" in e) && ("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                self.rail.drag = {
+                  x: e.clientX,
+                  y: e.clientY,
+                  sx: self.scroll.x,
+                  sy: self.scroll.y,
+                  st: self.getScrollTop(),
+                  sl: self.getScrollLeft(),
+                  pt: 2,
+                  dl: false,
+                  tg: tg
+                };
+
+                if (self.ispage || !self.opt.directionlockdeadzone) {
+                  self.rail.drag.dl = "f";
+                } else {
+
+                  var view = {
+                    w: $(window).width(),
+                    h: $(window).height()
+                  };
+
+                  var page = {
+                    w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+                    h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+                  };
+
+                  var maxh = Math.max(0, page.h - view.h);
+                  var maxw = Math.max(0, page.w - view.w);
+
+                  if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
+                  else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
+                  else self.rail.drag.ck = false;
+                  if (!self.rail.drag.ck) self.rail.drag.dl = "f";
+                }
+
+                if (self.opt.emulatetouch && self.isiframe && cap.isie) {
+                  var wp = self.win.position();
+                  self.rail.drag.x += wp.left;
+                  self.rail.drag.y += wp.top;
+                }
+
+                self.hasmoving = false;
+                self.lastmouseup = false;
+                self.scrollmom.reset(e.clientX, e.clientY);
+                
+                if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
+                
+                  var ip = (tg) ? /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName) : false;
+                  if (!ip) {
+                    if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+                    if (self.opt.emulatetouch) {
+                      if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
+                        tg._onclick = tg.onclick;
+                        tg.onclick = function(e) {
+                          if (self.hasmoving) return false;
+                          tg._onclick.call(this, e);
+                        };
+                      }
+                      return self.cancelEvent(e);
+                    }
+                    return self.stopPropagation(e);
+                  }
+
+                  if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
+                    self.preventclick = {
+                      "tg": tg,
+                      "click": false
+                    };
+                  }
+
+                }
+              }
+
+            };
+
+            self.ontouchend = function(e) {              
+
+              if (!self.rail.drag) return true;              
+              if (self.rail.drag.pt == 2) {
+                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;                
+
+                if (!self.hasmoving) {
+                  var tg = self.rail.drag.tg;
+                  setTimeout(function(){
+                    tg&&$(tg).trigger("click");
+                  },20);
+                }
+                self.rail.drag = false;
+
+                if (self.hasmoving) {                  
+                  self.scrollmom.doMomentum();
+                  self.lastmouseup = true;
+                  self.hideCursor();
+                  if (cap.hasmousecapture) document.releaseCapture();
+                  if (!cap.cantouch) return self.cancelEvent(e);
+                }
+
+              }
+              else if (self.rail.drag.pt == 1) {
+                return self.onmouseup(e);
+              }
+
+            };
+
+            var moveneedoffset = (self.opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
+
+            self.ontouchmove = function(e, byiframe) {
+
+              if (!self.rail.drag) return false;
+
+              if (e.targetTouches && self.opt.preventmultitouchscrolling) {
+                if (e.targetTouches.length > 1) return false; // multitouch
+              }
+            
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+              
+              cap.isandroid && self.cancelEvent(e);
+
+              if (self.rail.drag.pt == 2) {
+                //if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements  <--- not works on modern devices
+
+                var ev = $.extend({
+                  "original": e
+                }, e);
+                e = ev;
+
+                if (("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                if (self.rail.drag.y===e.clientY&&self.rail.drag.x===e.clientX) return false;  // prevent first useless move event 
+
+                self.hasmoving = true;
+
+                if (self.preventclick && !self.preventclick.click) {
+                  self.preventclick.click = self.preventclick.tg.onclick || false;
+                  self.preventclick.tg.onclick = self.onpreventclick;
+                }
+
+                var ofy,ofx;
+                ofx = ofy = 0;
+
+                if (moveneedoffset && !byiframe) {
+                  var wp = self.win.position();
+                  ofx = -wp.left;
+                  ofy = -wp.top;
+                }
+
+                var fy = e.clientY + ofy;
+                var my = (fy - self.rail.drag.y);
+                var fx = e.clientX + ofx;
+                var mx = (fx - self.rail.drag.x);
+
+                var ny = self.rail.drag.st - my;
+
+                if (self.ishwscroll && self.opt.bouncescroll) {
+                  if (ny < 0) {
+                    ny = Math.round(ny / 2);
+                    //                    fy = 0;
+                  } else if (ny > self.page.maxh) {
+                    ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
+                    //                    fy = 0;
+                  }
+                } else {
+                  if (ny < 0) {
+                    ny = 0;
+                    fy = 0;
+                  }
+                  if (ny > self.page.maxh) {
+                    ny = self.page.maxh;
+                    fy = 0;
+                  }
+                }
+
+                var nx;
+                if (self.railh && self.railh.scrollable) {
+                  nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
+
+                  if (self.ishwscroll && self.opt.bouncescroll) {
+                    if (nx < 0) {
+                      nx = Math.round(nx / 2);
+                      //                      fx = 0;
+                    } else if (nx > self.page.maxw) {
+                      nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
+                      //                      fx = 0;
+                    }
+                  } else {
+                    if (nx < 0) {
+                      nx = 0;
+                      fx = 0;
+                    }
+                    if (nx > self.page.maxw) {
+                      nx = self.page.maxw;
+                      fx = 0;
+                    }
+                  }
+
+                }
+
+                var grabbed = false;
+                if (self.rail.drag.dl) {
+                  grabbed = true;
+                  if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
+                  else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
+                } else {
+                  var ay = Math.abs(my);
+                  var ax = Math.abs(mx);
+                  var dz = self.opt.directionlockdeadzone;
+                  if (self.rail.drag.ck == "v") {
+                    if (ay > dz && (ax <= (ay * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ax > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  } else if (self.rail.drag.ck == "h") {
+                    if (ax > dz && (ay <= (ax * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ay > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  }
+                }
+
+                self.synched("touchmove", function() {
+                  if (self.rail.drag && (self.rail.drag.pt == 2)) {
+                    if (self.prepareTransition) self.prepareTransition(0);
+                    if (self.rail.scrollable) self.setScrollTop(ny);
+                    self.scrollmom.update(fx, fy);
+                    if (self.railh && self.railh.scrollable) {
+                      self.setScrollLeft(nx);
+                      self.showCursor(ny, nx);
+                    } else {
+                      self.showCursor(ny);
+                    }
+                    if (cap.isie10) document.selection.clear();
+                  }
+                });
+
+                if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
+                if (grabbed) return self.cancelEvent(e);
+              }
+              else if (self.rail.drag.pt == 1) { // drag on cursor
+                return self.onmousemove(e);
+              }
+
+            };
+
+            self.ontouchstartCursor = function (e, hronly) {
+              if (self.rail.drag && self.rail.drag.pt != 3) return;
+              if (self.locked) return self.cancelEvent(e);
+              self.cancelScroll();
+              self.rail.drag = {
+                x: e.touches[0].clientX,
+                y: e.touches[0].clientY,
+                sx: self.scroll.x,
+                sy: self.scroll.y,
+                pt: 3,
+                hr: (!!hronly)
+              };
+              var tg = self.getTarget(e);
+              if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+              if (self.isiframe && !cap.hasmousecapture) {
+                self.saved["csspointerevents"] = self.doc.css("pointer-events");
+                self.css(self.doc, {"pointer-events": "none"});
+              }
+              return self.cancelEvent(e);
+            };
+
+            self.ontouchendCursor = function (e) {
+              if (self.rail.drag) {
+                if (cap.hasmousecapture) document.releaseCapture();
+                if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved["csspointerevents"]);
+                if (self.rail.drag.pt != 3)return;
+                self.rail.drag = false;
+                //if (!self.rail.active) self.hideCursor();
+                return self.cancelEvent(e);
+              }
+            };
+
+            self.ontouchmoveCursor = function (e) {
+              if (self.rail.drag) {
+                if (self.rail.drag.pt != 3)return;
+
+                self.cursorfreezed = true;
+
+                if (self.rail.drag.hr) {
+                  self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
+                  if (self.scroll.x < 0) self.scroll.x = 0;
+                  var mw = self.scrollvaluemaxw;
+                  if (self.scroll.x > mw) self.scroll.x = mw;
+                } else {
+                  self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
+                  if (self.scroll.y < 0) self.scroll.y = 0;
+                  var my = self.scrollvaluemax;
+                  if (self.scroll.y > my) self.scroll.y = my;
+                }
+
+                self.synched('touchmove', function () {
+                  if (self.rail.drag && (self.rail.drag.pt == 3)) {
+                    self.showCursor();
+                    if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+                  }
+                });
+
+                return self.cancelEvent(e);
+              }
+              /*
+               else {
+               self.checkarea = true;
+               }
+               */
+            };
+
+          }
+
+          self.onmousedown = function(e, hronly) {
+            if (self.rail.drag && self.rail.drag.pt != 1) return;
+            if (self.railslocked) return self.cancelEvent(e);
+            self.cancelScroll();
+            self.rail.drag = {
+              x: e.clientX,
+              y: e.clientY,
+              sx: self.scroll.x,
+              sy: self.scroll.y,
+              pt: 1,
+              hr: hronly||false
+            };
+            var tg = self.getTarget(e);
+            if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+            if (self.isiframe && !cap.hasmousecapture) {
+              self.saved.csspointerevents = self.doc.css("pointer-events");
+              self.css(self.doc, {
+                "pointer-events": "none"
+              });
+            }
+            self.hasmoving = false;
+            return self.cancelEvent(e);
+          };
+
+          self.onmouseup = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt != 1) return true;
+							
+              if (cap.hasmousecapture) document.releaseCapture();
+              if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);              
+              self.rail.drag = false;
+              //if (!self.rail.active) self.hideCursor();
+              if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
+              return self.cancelEvent(e);
+            }
+          };
+
+          self.onmousemove = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt !== 1) return;
+
+              if (cap.ischrome && e.which === 0) return self.onmouseup(e);
+
+              self.cursorfreezed = true;
+              self.hasmoving = true;
+
+              if (self.rail.drag.hr) {
+                self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
+                if (self.scroll.x < 0) self.scroll.x = 0;
+                var mw = self.scrollvaluemaxw;
+                if (self.scroll.x > mw) self.scroll.x = mw;
+              } else {
+                self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
+                if (self.scroll.y < 0) self.scroll.y = 0;
+                var my = self.scrollvaluemax;
+                if (self.scroll.y > my) self.scroll.y = my;
+              }
+
+              self.synched('mousemove', function() {
+                if (self.rail.drag && (self.rail.drag.pt == 1)) {
+                  self.showCursor();
+                  if (self.rail.drag.hr) {
+                    if (self.hasreversehr) {
+                      self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    } else {
+                      self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    }
+                  }
+                  else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+                }
+              });
+
+              return self.cancelEvent(e);
+            }
+            else {
+              self.checkarea = 0;
+            }
+          };
+
+          if (cap.cantouch || self.opt.emulatetouch) {
+
+            self.onpreventclick = function(e) {
+              if (self.preventclick) {
+                self.preventclick.tg.onclick = self.preventclick.click;
+                self.preventclick = false;
+                return self.cancelEvent(e);
+              }
+            };
+
+            //self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging  <-- REENABLE!!
+
+            self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
+              if (self.lastmouseup) {
+                self.lastmouseup = false;
+                return self.cancelEvent(e);
+              } else {
+                return true;
+              }
+            };
+
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
+              self.css((self.ispage) ? self.doc : self.win, {
+                'cursor': cap.cursorgrabvalue
+              });
+              self.css(self.rail, {
+                'cursor': cap.cursorgrabvalue
+              });
+            }
+
+          } else {
+
+            var checkSelectionScroll = function(e) {
+              if (!self.selectiondrag) return;
+
+              if (e) {
+                var ww = self.win.outerHeight();
+                var df = (e.pageY - self.selectiondrag.top);
+                if (df > 0 && df < ww) df = 0;
+                if (df >= ww) df -= ww;
+                self.selectiondrag.df = df;
+              }
+              if (self.selectiondrag.df == 0) return;
+
+              var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
+              self.doScrollBy(rt);
+
+              self.debounced("doselectionscroll", function() {
+                checkSelectionScroll();
+              }, 50);
+            };
+
+            if ("getSelection" in document) { // A grade - Major browsers
+              self.hasTextSelected = function() {
+                return (document.getSelection().rangeCount > 0);
+              };
+            } else if ("selection" in document) { //IE9-
+              self.hasTextSelected = function() {
+                return (document.selection.type != "None");
+              };
+            } else {
+              self.hasTextSelected = function() { // no support
+                return false;
+              };
+            }
+
+            self.onselectionstart = function(e) {
+/*  More testing - severe chrome issues            
+              if (!self.haswrapper&&(e.which&&e.which==2)) {  // fool browser to manage middle button scrolling
+                self.win.css({'overflow':'auto'});
+                setTimeout(function(){
+                  self.win.css({'overflow':''});
+                },10);                
+                return true;
+              }            
+*/              
+              if (self.ispage) return;
+              self.selectiondrag = self.win.offset();
+            };
+            
+            self.onselectionend = function(e) {
+              self.selectiondrag = false;
+            };
+            self.onselectiondrag = function(e) {
+              if (!self.selectiondrag) return;
+              if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
+                checkSelectionScroll(e);
+              }, 250);
+            };
+          }
+
+          if (cap.hasw3ctouch) { //IE11+
+            self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
+            self.css(self.rail, {
+              'touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              'touch-action': 'none'
+            });
+            self.bind(self.win, "pointerdown", self.ontouchstart);
+            self.bind(document, "pointerup", self.ontouchend);
+            self.bind(document, "pointermove", self.ontouchmove);
+          } else if (cap.hasmstouch) { //IE10
+            self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
+            self.css(self.rail, {
+              '-ms-touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              '-ms-touch-action': 'none'
+            });
+            self.bind(self.win, "MSPointerDown", self.ontouchstart);
+            self.bind(document, "MSPointerUp", self.ontouchend);
+            self.bind(document, "MSPointerMove", self.ontouchmove);
+            self.bind(self.cursor, "MSGestureHold", function(e) {
+              e.preventDefault();
+            });
+            self.bind(self.cursor, "contextmenu", function(e) {
+              e.preventDefault();
+            });
+          } else if (cap.cantouch) { // smartphones/touch devices
+            self.bind(self.win, "touchstart", self.ontouchstart,false,true);
+            self.bind(document, "touchend", self.ontouchend,false,true);
+            self.bind(document, "touchcancel", self.ontouchend,false,true);
+            self.bind(document, "touchmove", self.ontouchmove,false,true);
+          }
+
+          if (self.opt.emulatetouch) {
+            self.bind(self.win, "mousedown", self.ontouchstart,false,true);
+            self.bind(document, "mouseup", self.ontouchend,false,true);
+            self.bind(document, "mousemove", self.ontouchmove,false,true);
+          }
+          
+          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.emulatetouch)) {
+
+            self.rail.css({
+              cursor: "default"
+            });
+            self.railh && self.railh.css({
+              cursor: "default"
+            });
+
+            self.jqbind(self.rail, "mouseenter", function() {
+              if (!self.ispage && !self.win.is(":visible")) return false;
+              if (self.canshowonmouseevent) self.showCursor();
+              self.rail.active = true;
+            });
+            self.jqbind(self.rail, "mouseleave", function() {
+              self.rail.active = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+            if (self.opt.sensitiverail) {
+              self.bind(self.rail, "click", function(e) {
+                self.doRailClick(e, false, false);
+              });
+              self.bind(self.rail, "dblclick", function(e) {
+                self.doRailClick(e, true, false);
+              });
+              self.bind(self.cursor, "click", function(e) {
+                self.cancelEvent(e);
+              });
+              self.bind(self.cursor, "dblclick", function(e) {
+                self.cancelEvent(e);
+              });
+            }
+
+            if (self.railh) {
+              self.jqbind(self.railh, "mouseenter", function() {
+                if (!self.ispage && !self.win.is(":visible")) return false;
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.railh, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+
+              if (self.opt.sensitiverail) {
+                self.bind(self.railh, "click", function(e) {
+                  self.doRailClick(e, false, true);
+                });
+                self.bind(self.railh, "dblclick", function(e) {
+                  self.doRailClick(e, true, true);
+                });
+                self.bind(self.cursorh, "click", function(e) {
+                  self.cancelEvent(e);
+                });
+                self.bind(self.cursorh, "dblclick", function(e) {
+                  self.cancelEvent(e);
+                });
+              }
+
+            }
+
+          }
+
+          if(self.opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
+            self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
+            self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
+            self.bind(self.cursor, "touchend", self.ontouchendCursor);
+            self.cursorh && self.bind(self.cursorh, "touchstart", function(e) {
+                self.ontouchstartCursor(e, true);
+            });
+            self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
+            self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
+          }
+
+          if (!cap.cantouch && !self.opt.emulatetouch) {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
+            self.bind(document, "mousemove", self.onmousemove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            self.bind(self.cursor, "mousedown", self.onmousedown);
+            self.bind(self.cursor, "mouseup", self.onmouseup);
+
+            if (self.railh) {
+              self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              self.bind(self.cursorh, "mouseup", self.onmouseup);
+            }
+            
+            if (!self.ispage && self.opt.enablescrollonselection) {
+              self.bind(self.win[0], "mousedown", self.onselectionstart);
+              self.bind(document, "mouseup", self.onselectionend);
+              self.bind(self.cursor, "mouseup", self.onselectionend);
+              if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
+              self.bind(document, "mousemove", self.onselectiondrag);
+            }
+
+            if (self.zoom) {
+              self.jqbind(self.zoom, "mouseenter", function() {
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.zoom, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+            }
+
+          } else {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
+            //self.bind(document, "mousemove", self.ontouchmove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            if (self.opt.cursordragontouch) {
+              self.bind(self.cursor, "mousedown", self.onmousedown);
+              self.bind(self.cursor, "mouseup", self.onmouseup);
+              //self.bind(self.cursor, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
+            } else {
+              self.bind(self.rail, "mousedown", function(e){e.preventDefault();});  // prevent text selection             
+							self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();});
+            }
+
+          }
+            
+
+          if (self.opt.enablemousewheel) {
+            if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel);
+            self.mousewheel(self.rail, self.onmousewheel);
+            if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
+          }
+
+          if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
+            if (!self.win.attr("tabindex")) self.win.attr({
+              "tabindex": tabindexcounter++
+            });
+
+            self.jqbind(self.win, "focus", function(e) {
+              domfocus = (self.getTarget(e)).id || true;
+              self.hasfocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "blur", function(e) {
+              domfocus = false;
+              self.hasfocus = false;
+            });
+
+            self.jqbind(self.win, "mouseenter", function(e) {
+              mousefocus = (self.getTarget(e)).id || true;
+              self.hasmousefocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "mouseleave", function() {
+              mousefocus = false;
+              self.hasmousefocus = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+          }
+
+        } // !ie9mobile
+
+        //Thanks to http://www.quirksmode.org !!
+        self.onkeypress = function(e) {
+          if (self.railslocked && self.page.maxh == 0) return true;
+
+          e = (e) ? e : window.e;
+          var tg = self.getTarget(e);
+          if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
+            var tp = tg.getAttribute('type') || tg.type || false;
+            if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
+          }
+
+          if ($(tg).attr('contenteditable')) return true;
+
+          if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
+            var key = e.keyCode;
+
+            if (self.railslocked && key != 27) return self.cancelEvent(e);
+
+            var ctrl = e.ctrlKey || false;
+            var shift = e.shiftKey || false;
+
+            var ret = false;
+            switch (key) {
+              case 38:
+              case 63233: //safari
+                self.doScrollBy(24 * 3);
+                ret = true;
+                break;
+              case 40:
+              case 63235: //safari
+                self.doScrollBy(-24 * 3);
+                ret = true;
+                break;
+              case 37:
+              case 63232: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
+                  ret = true;
+                }
+                break;
+              case 39:
+              case 63234: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
+                  ret = true;
+                }
+                break;
+              case 33:
+              case 63276: // safari
+                self.doScrollBy(self.view.h);
+                ret = true;
+                break;
+              case 34:
+              case 63277: // safari
+                self.doScrollBy(-self.view.h);
+                ret = true;
+                break;
+              case 36:
+              case 63273: // safari                
+                (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
+                ret = true;
+                break;
+              case 35:
+              case 63275: // safari
+                (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
+                ret = true;
+                break;
+              case 32:
+                if (self.opt.spacebarenabled) {
+                  (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
+                  ret = true;
+                }
+                break;
+              case 27: // ESC
+                if (self.zoomactive) {
+                  self.doZoom();
+                  ret = true;
+                }
+                break;
+            }
+            if (ret) return self.cancelEvent(e);
+          }
+        };
+
+        if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
+
+        self.bind(document, "keydown", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (ctrl) self.wheelprevented = true;
+        });
+        self.bind(document, "keyup", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (!ctrl) self.wheelprevented = false;
+        });
+        self.bind(window,"blur",function(e){
+          self.wheelprevented = false;
+        });        
+
+        self.bind(window, 'resize', self.lazyResize);
+        self.bind(window, 'orientationchange', self.lazyResize);
+
+        self.bind(window, "load", self.lazyResize);
+
+        if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
+          var tmp = self.win.attr("style");
+          var ww = parseFloat(self.win.css("width")) + 1;
+          self.win.css('width', ww);
+          self.synched("chromefix", function() {
+            self.win.attr("style", tmp);
+          });
+        }
+
+
+        // Trying a cross-browser implementation - good luck!
+
+        self.onAttributeChange = function(e) {
+          self.lazyResize(self.isieold ? 250 : 30);
+        };
+
+        if (self.opt.enableobserver) {
+
+          if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
+            self.observerbody = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(function(mut){
+                if (mut.type=="attributes") {
+                  return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+                }
+              });
+              // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
+              if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
+            });
+            self.observerbody.observe(document.body, {
+              childList: true,
+              subtree: true,
+              characterData: false,
+              attributes: true,
+              attributeFilter: ['class']
+            });
+          }
+          
+          if (!self.ispage && !self.haswrapper) {
+            // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+            if (ClsMutationObserver !== false) {
+              self.observer = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(self.onAttributeChange);
+              });
+              self.observer.observe(self.win[0], {
+                childList: true,
+                characterData: false,
+                attributes: true,
+                subtree: false
+              });
+              self.observerremover = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(function(mo) {
+                  if (mo.removedNodes.length > 0) {
+                    for (var dd in mo.removedNodes) {
+                      if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+                    }
+                  }
+                });
+              });
+              self.observerremover.observe(self.win[0].parentNode, {
+                childList: true,
+                characterData: false,
+                attributes: false,
+                subtree: false
+              });
+            } else {
+              self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+              if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+              self.bind(self.win, "DOMNodeRemoved", function(e) {
+                if (e.target == self.win[0]) self.remove();
+              });
+            }
+          }
+
+        }
+
+        //
+
+        if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
+				if (self.istextarea) {
+					self.bind(self.win, "keydown", self.lazyResize);
+					self.bind(self.win, "mouseup", self.lazyResize);
+				}
+
+        //        self.checkrtlmode = true;
+        self.lazyResize(30);
+
+      }
+      
+      if (this.doc[0].nodeName == 'IFRAME') {
+        var oniframeload = function() {
+          self.iframexd = false;
+          var doc;
+          try {
+            doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
+            var a = doc.domain;
+          } catch (e) {
+            self.iframexd = true;
+            doc = false;
+          }
+          
+          if (self.iframexd) {
+            if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
+            return true; //cross-domain - I can't manage this        
+          }
+
+          self.forcescreen = true;
+
+          if (self.isiframe) {
+            self.iframe = {
+              "doc": $(doc),
+              "html": self.doc.contents().find('html')[0],
+              "body": self.doc.contents().find('body')[0]
+            };
+            self.getContentSize = function() {
+              return {
+                w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
+                h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
+              };
+            };
+            self.docscroll = $(self.iframe.body); //$(this.contentWindow);
+          }
+
+          if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
+            self.win.scrollTop(0); // reset position
+            self.doc.height(""); //reset height to fix browser bug
+            var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
+            self.doc.height(hh);
+          }
+          self.lazyResize(30);
+
+          if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden);
+          self.css($(self.iframe.body), _scrollyhidden);
+
+          if (cap.isios && self.haswrapper) {
+            self.css($(doc.body), {
+              '-webkit-transform': 'translate3d(0,0,0)'
+            }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
+          }
+
+          if ('contentWindow' in this) {
+            self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
+          } else {
+            self.bind(doc, "scroll", self.onscroll);
+          }
+
+          if (self.opt.enablemousewheel) {
+            self.mousewheel(doc, self.onmousewheel);
+          }
+
+          if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
+
+          if (cap.cantouch) {
+            self.bind(doc, "touchstart", self.ontouchstart);
+            self.bind(doc, "touchmove", self.ontouchmove);          
+          } 
+          else if (self.opt.emulatetouch) {
+            self.bind(doc, "mousedown", self.ontouchstart);
+            self.bind(doc, "mousemove", function(e) {
+              return self.ontouchmove(e, true);
+            });
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
+              'cursor': cap.cursorgrabvalue
+            });
+          }
+
+          self.bind(doc, "mouseup", self.ontouchend);
+
+          if (self.zoom) {
+            if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
+            if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
+          }
+        };
+
+        if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
+          setTimeout(function() {
+            oniframeload.call(self.doc[0], false);
+          }, 500);
+        }
+        self.bind(this.doc, "load", oniframeload);
+
+      }
+
+    };
+
+    this.showCursor = function(py, px) {
+      if (self.cursortimeout) {
+        clearTimeout(self.cursortimeout);
+        self.cursortimeout = 0;
+      }
+      if (!self.rail) return;
+      if (self.autohidedom) {
+        self.autohidedom.stop().css({
+          opacity: self.opt.cursoropacitymax
+        });
+        self.cursoractive = true;
+      }
+
+      if (!self.rail.drag || self.rail.drag.pt != 1) {
+        if (py !== undefined && py !== false) {
+          self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
+        }
+        if (px !== undefined) {
+          self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
+        }
+      }
+
+      self.cursor.css({
+        height: self.cursorheight,
+        top: self.scroll.y
+      });
+      if (self.cursorh) {        
+        var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
+        (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx + self.rail.width
+        }): self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx
+        });
+        self.cursoractive = true;
+      }
+
+      if (self.zoom) self.zoom.stop().css({
+        opacity: self.opt.cursoropacitymax
+      });
+    };
+
+    this.hideCursor = function(tm) {
+      if (self.cursortimeout) return;
+      if (!self.rail) return;
+      if (!self.autohidedom) return;
+      if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
+      self.cursortimeout = setTimeout(function() {
+        if (!self.rail.active || !self.showonmouseevent) {
+          self.autohidedom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          if (self.zoom) self.zoom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          self.cursoractive = false;
+        }
+        self.cursortimeout = 0;
+      }, tm || self.opt.hidecursordelay);
+    };
+
+    this.noticeCursor = function(tm, py, px) {
+      self.showCursor(py, px);
+      if (!self.rail.active) self.hideCursor(tm);
+    };
+
+    this.getContentSize =
+      (self.ispage) ?
+      function() {
+        return {
+          w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+          h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+        };
+      } : (self.haswrapper) ?
+      function() {
+        return {
+          w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
+          h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
+        };
+      } : function() {
+        return {
+          w: self.docscroll[0].scrollWidth,
+          h: self.docscroll[0].scrollHeight
+        };
+      };
+
+    this.onResize = function(e, page) {
+    
+      if (!self || !self.win) return false;
+
+      if (!self.haswrapper && !self.ispage) {
+        if (self.win.css('display') == 'none') {
+          if (self.visibility) self.hideRail().hideRailHr();
+          return false;
+        } else {
+          if (!self.hidden && !self.visibility) self.showRail().showRailHr();
+        }
+      }
+
+      var premaxh = self.page.maxh;
+      var premaxw = self.page.maxw;
+
+      var preview = {
+        h: self.view.h,
+        w: self.view.w
+      };
+
+      self.view = {
+        w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
+        h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
+      };
+
+      self.page = (page) ? page : self.getContentSize();
+
+      self.page.maxh = Math.max(0, self.page.h - self.view.h);
+      self.page.maxw = Math.max(0, self.page.w - self.view.w);
+      
+      if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
+        // test position        
+        if (!self.ispage) {
+          var pos = self.win.offset();
+          if (self.lastposition) {
+            var lst = self.lastposition;
+            if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do            
+          }
+          self.lastposition = pos;
+        } else {
+          return self; //nothing to do
+        }
+      }
+
+      if (self.page.maxh == 0) {
+        self.hideRail();
+        self.scrollvaluemax = 0;
+        self.scroll.y = 0;
+        self.scrollratio.y = 0;
+        self.cursorheight = 0;
+        self.setScrollTop(0);
+        if (self.rail) self.rail.scrollable = false;
+      } else {
+        self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+        self.rail.scrollable = true;
+      }
+
+      if (self.page.maxw == 0) {
+        self.hideRailHr();
+        self.scrollvaluemaxw = 0;
+        self.scroll.x = 0;
+        self.scrollratio.x = 0;
+        self.cursorwidth = 0;
+        self.setScrollLeft(0);
+        if (self.railh) {
+          self.railh.scrollable = false;
+        }
+      } else {
+          self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+          if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
+      }
+
+      self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
+      if (self.railslocked) {
+        if (!self.ispage) self.updateScrollBar(self.view);
+        return false;
+      }
+
+      if (!self.hidden && !self.visibility) {
+        self.showRail().showRailHr();
+      }
+      else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();
+
+      if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
+
+      self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
+      self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
+
+      self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
+      self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
+
+      self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+
+      if (self.railh) {
+        self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
+        self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+      }
+
+      /*
+      if (self.checkrtlmode&&self.railh) {
+        self.checkrtlmode = false;
+        if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
+      }
+*/
+
+      if (!self.ispage) self.updateScrollBar(self.view);
+
+      self.scrollratio = {
+        x: (self.page.maxw / self.scrollvaluemaxw),
+        y: (self.page.maxh / self.scrollvaluemax)
+      };
+
+      var sy = self.getScrollTop();
+      if (sy > self.page.maxh) {
+        self.doScrollTop(self.page.maxh);
+      } else {
+        self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+        self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+        if (self.cursoractive) self.noticeCursor();
+      }
+
+      if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
+
+      return self;
+    };
+
+    this.resize = self.onResize;
+
+		this.hlazyresize = 0;
+		
+    this.lazyResize = function(tm) { // event debounce
+/*		
+      tm = (isNaN(tm)) ? 30 : tm;
+      self.debounced('resize', self.resize, tm);
+*/
+
+//			if (!self.haswrapper&&self.opt.autohidemode!==false) self.hide();	
+			if (!self.haswrapper) self.hide();	
+			if (self.hlazyresize) clearTimeout(self.hlazyresize);
+			self.hlazyresize = setTimeout(function(){
+				if (self) { self.resize(); self.show(); }  // this form mandatory for uglify
+			},240);
+			
+      return self;
+    };
+
+    // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
+    function _modernWheelEvent(dom, name, fn, bubble) {
+      self._bind(dom, name, function(e) {
+        var e = (e) ? e : window.event;
+        var event = {
+          original: e,
+          target: e.target || e.srcElement,
+          type: "wheel",
+          deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
+          deltaX: 0,
+          deltaZ: 0,
+          preventDefault: function() {
+            e.preventDefault ? e.preventDefault() : e.returnValue = false;
+            return false;
+          },
+          stopImmediatePropagation: function() {
+            (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
+          }
+        };
+
+        if (name == "mousewheel") {
+          e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
+					e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
+					!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
+        } else {
+          event.deltaY = e.detail;
+        }
+
+        return fn.call(dom, event);
+      }, bubble);
+    }
+
+
+
+    this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
+      self.events.push({
+        e: dom,
+        n: name,
+        f: fn,
+        q: true
+      });
+      $(dom).bind(name, fn);
+    };
+    
+    this.mousewheel = function(dom, fn, bubble) { // bind mousewheel
+      var el = ("jquery" in dom) ? dom[0] : dom;
+      if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel"
+        self._bind(el, "wheel", fn, bubble || false);
+      } else {
+        var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox          
+        _modernWheelEvent(el, wname, fn, bubble || false);
+        if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
+      }
+    };
+    
+    if (cap.haseventlistener) {  // W3C standard event model
+    
+      this.bind = function(dom, name, fn, bubble, active) {  // W3C
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, fn, bubble || false, active || false);
+      };
+
+      // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
+      var passiveSupported = false;
+      try{var options=Object.defineProperty({},"passive",{get:function(){passiveSupported=!0}});window.addEventListener("test",null,options)}catch(err){}
+      this._bind = function(el, name, fn, bubble, active) { // primitive bind
+      
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+
+        (passiveSupported&&active) ? el.addEventListener(name, fn, {passive:false,capture:bubble}) : el.addEventListener(name, fn, bubble || false);
+      };    
+      this.cancelEvent = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        if (e.cancelable) e.preventDefault();
+        e.stopPropagation();
+        if (e.preventManipulation) e.preventManipulation(); //IE10
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        e.stopPropagation();
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind
+        el.removeEventListener(name, fn, bub);
+      };
+    } else {  // old IE model
+
+      this.bind = function(dom, name, fn, bubble) {  // legacy IE
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, function(e) {
+          e = e || window.event || false;
+          if (e && e.srcElement) {
+            e.target = e.srcElement;
+          }
+          if (!("pageY" in e)) {
+            e.pageX = e.clientX + document.documentElement.scrollLeft;
+            e.pageY = e.clientY + document.documentElement.scrollTop;
+          }
+          return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
+        });
+      };
+    
+      this._bind = function(el, name, fn, bubble) { // primitive bind
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+        if (el.attachEvent) {
+          el.attachEvent("on" + name, fn);
+        } else {
+          el["on" + name] = fn;
+        }
+      };    
+      // Thanks to http://www.switchonthecode.com !!
+      this.cancelEvent = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        e.cancel = true;
+        e.returnValue = false;
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
+        if (el.detachEvent) {
+          el.detachEvent('on' + name, fn);
+        } else {
+          el['on' + name] = false;
+        }
+      };
+    }
+    
+    this.unbindAll = function() {
+      for (var a = 0; a < self.events.length; a++) {
+        var r = self.events[a];
+        (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
+      }
+    };
+
+    this.showRail = function() {
+      if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.visibility = true;
+        self.rail.visibility = true;
+        self.rail.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.showRailHr = function() {
+      if (!self.railh) return self;
+      if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.railh.visibility = true;
+        self.railh.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.hideRail = function() {
+      self.visibility = false;
+      self.rail.visibility = false;
+      self.rail.css('display', 'none');
+      return self;
+    };
+
+    this.hideRailHr = function() {
+      if (!self.railh) return self;
+      self.railh.visibility = false;
+      self.railh.css('display', 'none');
+      return self;
+    };
+
+    this.show = function() {
+      self.hidden = false;
+      self.railslocked = false;
+      return self.showRail().showRailHr();
+    };
+
+    this.hide = function() {
+      self.hidden = true;
+      self.railslocked = true;
+      return self.hideRail().hideRailHr();
+    };
+
+    this.toggle = function() {
+      return (self.hidden) ? self.show() : self.hide();
+    };
+
+    this.remove = function() {
+      self.stop();
+      if (self.cursortimeout) clearTimeout(self.cursortimeout);
+//      if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
+			for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
+      self.doZoomOut();
+      self.unbindAll();
+
+      if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+
+      if (self.observer !== false) self.observer.disconnect();
+      if (self.observerremover !== false) self.observerremover.disconnect();
+      if (self.observerbody !== false) self.observerbody.disconnect();
+
+      self.events = null;
+
+      if (self.cursor) {
+        self.cursor.remove();
+      }
+      if (self.cursorh) {
+        self.cursorh.remove();
+      }
+      if (self.rail) {
+        self.rail.remove();
+      }
+      if (self.railh) {
+        self.railh.remove();
+      }
+      if (self.zoom) {
+        self.zoom.remove();
+      }
+      for (var a = 0; a < self.saved.css.length; a++) {
+        var d = self.saved.css[a];
+        d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
+      }
+      self.saved = false;
+      self.me.data('__nicescroll', ''); //erase all traces
+
+      // memory leak fixed by GianlucaGuarini - thanks a lot!
+      // remove the current nicescroll from the $.nicescroll array & normalize array
+      var lst = $.nicescroll;
+      lst.each(function(i) {
+        if (!this) return;
+        if (this.id === self.id) {
+          delete lst[i];
+          for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
+          lst.length--;
+          if (lst.length) delete lst[lst.length];
+        }
+      });
+
+      for (var i in self) {
+        self[i] = null;
+        delete self[i];
+      }
+
+      self = null;
+
+    };
+
+    this.scrollstart = function(fn) {
+      this.onscrollstart = fn;
+      return self;
+    };
+    this.scrollend = function(fn) {
+      this.onscrollend = fn;
+      return self;
+    };
+    this.scrollcancel = function(fn) {
+      this.onscrollcancel = fn;
+      return self;
+    };
+
+    this.zoomin = function(fn) {
+      this.onzoomin = fn;
+      return self;
+    };
+    this.zoomout = function(fn) {
+      this.onzoomout = fn;
+      return self;
+    };
+
+    this.isScrollable = function(e) {
+      var dom = (e.target) ? e.target : e;
+      if (dom.nodeName == 'OPTION') return true;
+      while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false;
+    };
+
+    this.getViewport = function(me) {
+      var dom = (me && me.parentNode) ? me.parentNode : false;
+      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        if (/fixed|absolute/.test(dd.css("position"))) return dd;
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
+        if (dd.getNiceScroll().length > 0) return dd;
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false; //(dom) ? $(dom) : false;
+    };
+
+    this.triggerScrollEnd = function() {
+      if (!self.onscrollend) return;
+
+      var px = self.getScrollLeft();
+      var py = self.getScrollTop();
+
+      var info = {
+        type: "scrollend",
+        current: {
+          x: px,
+          y: py
+        },
+        end: {
+          x: px,
+          y: py
+        }
+      };
+      self.onscrollend.call(self, info);
+    };
+
+    function execScrollWheel(e, hr, chkscroll) {
+      var px, py;
+      
+      if (e.deltaMode == 0) { // PIXEL
+        px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
+        py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
+      } else if (e.deltaMode == 1) { // LINE
+        px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
+        py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
+      }
+
+      if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support 
+        px = py;
+        py = 0;
+      
+        if (chkscroll) {
+          var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
+          if (hrend) {  // preserve vertical scrolling
+            py = px;
+            px = 0;            
+          }
+        }
+        
+      }
+
+      // invert horizontal direction for rtl mode
+      if (self.isrtlmode) px = -px;
+
+      if (px) {
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltax += px;
+        self.debounced("mousewheelx", function() {
+          var dt = self.lastdeltax;
+          self.lastdeltax = 0;
+          if (!self.rail.drag) {
+            self.doScrollLeftBy(dt);
+          }
+        }, 15);
+      }
+      if (py) {
+        if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
+          if (py < 0) {
+            if (self.getScrollTop() >= self.page.maxh) return true;
+          } else {
+            if (self.getScrollTop() <= 0) return true;
+          }
+        }
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltay += py;
+//        self.debounced("mousewheely", function() {
+	      self.synched("mousewheely", function() {
+          var dt = self.lastdeltay;
+          self.lastdeltay = 0;
+          if (!self.rail.drag) {
+            self.doScrollBy(dt);
+          }
+        }, 15);
+      }
+
+      e.stopImmediatePropagation();
+      return e.preventDefault();
+    }
+
+    this.onmousewheel = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked) {
+        self.debounced("checkunlock", self.resize, 250);
+        return true;
+      }
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
+
+      if (self.opt.oneaxismousemode && e.deltaX == 0) {
+        if (!self.rail.scrollable) {
+          if (self.railh && self.railh.scrollable) {
+            return self.onmousewheelhr(e);
+          } else {
+            return true;
+          }
+        }
+      }
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      var ret = execScrollWheel(e, false, chk);
+      if (ret) self.checkarea = 0;
+      return ret;
+    };
+
+    this.onmousewheelhr = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked || !self.railh.scrollable) return true;
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      if (self.railslocked) return self.cancelEvent(e);
+
+      return execScrollWheel(e, true, chk);
+    };
+
+    this.stop = function() {
+      self.cancelScroll();
+      if (self.scrollmon) self.scrollmon.stop();
+      self.cursorfreezed = false;
+      self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+      self.noticeCursor();
+      return self;
+    };
+
+    this.getTransitionSpeed = function(dif) {
+      var sp = Math.round(self.opt.scrollspeed * 10);
+      var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
+      return (ex > 20) ? ex : 0;
+    };
+
+    if (!self.opt.smoothscroll) {
+      this.doScrollLeft = function(x, spd) { //direct
+        var y = self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollTop = function(y, spd) { //direct
+        var x = self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollPos = function(x, y, spd) { //direct
+        var nx = (x > self.page.maxw) ? self.page.maxw : x;
+        if (nx < 0) nx = 0;
+        var ny = (y > self.page.maxh) ? self.page.maxh : y;
+        if (ny < 0) ny = 0;
+        self.synched('scroll', function() {
+          self.setScrollTop(ny);
+          self.setScrollLeft(nx);
+        });
+      };
+      this.cancelScroll = function() {}; // direct
+    } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
+      this.prepareTransition = function(dif, istime) {
+        var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
+        var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
+        if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
+          self.lasttransitionstyle = trans;
+          self.doc.css(cap.transitionstyle, trans);
+        }
+        return ex;
+      };
+
+      this.doScrollLeft = function(x, spd) { //trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //trans
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection      
+
+        if (self.opt.bouncescroll == false) {
+          if (y < 0) y = 0;
+          else if (y > self.page.maxh) y = self.page.maxh;
+          if (x < 0) x = 0;
+          else if (x > self.page.maxw) x = self.page.maxw;
+        }
+
+        if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        self.newscrollspeed = spd || false;
+
+        if (self.timer) return false;
+
+        self.timer = setTimeout(function() {
+
+          var top = self.getScrollTop();
+          var lft = self.getScrollLeft();
+
+          var dst = {};
+          dst.x = x - lft;
+          dst.y = y - top;
+          dst.px = lft;
+          dst.py = top;
+
+          var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
+          var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
+          if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
+
+          self.prepareTransition(ms, true);
+
+          if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+
+          if (ms > 0) {
+
+            if (!self.scrollrunning && self.onscrollstart) {
+              var info = {
+                "type": "scrollstart",
+                "current": {
+                  "x": lft,
+                  "y": top
+                },
+                "request": {
+                  "x": x,
+                  "y": y
+                },
+                "end": {
+                  "x": self.newscrollx,
+                  "y": self.newscrolly
+                },
+                "speed": ms
+              };
+              self.onscrollstart.call(self, info);
+            }
+
+            if (cap.transitionend) {
+              if (!self.scrollendtrapped) {
+                self.scrollendtrapped = true;
+                self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
+              }
+            } else {
+              if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
+              self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
+            }
+
+            var py = top;
+            var px = lft;
+            self.timerscroll = {
+              bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
+              bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
+            };
+            if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
+              self.showCursor(self.getScrollTop(), self.getScrollLeft());
+            }, 60);
+
+          }
+
+          self.synched("doScroll-set", function() {
+            self.timer = 0;
+            if (self.scrollendtrapped) self.scrollrunning = true;
+            self.setScrollTop(self.newscrolly);
+            self.setScrollLeft(self.newscrollx);
+            if (!self.scrollendtrapped) self.onScrollTransitionEnd();
+          });
+
+
+        }, 50);
+
+      };
+
+      this.cancelScroll = function() {
+        if (!self.scrollendtrapped) return true;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.scrollrunning = false;
+        if (!cap.transitionend) clearTimeout(cap.transitionend);
+        self.scrollendtrapped = false;
+        self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.prepareTransition(0);
+        self.setScrollTop(py); // fire event onscroll
+        if (self.railh) self.setScrollLeft(px);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+
+        self.cursorfreezed = false;
+
+        self.showCursor(py, px);
+        return self;
+      };
+      this.onScrollTransitionEnd = function() {
+        if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.scrollendtrapped = false;
+        self.prepareTransition(0);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.setScrollTop(py); // fire event onscroll        
+        if (self.railh) self.setScrollLeft(px); // fire event onscroll left
+
+        self.noticeCursor(false, py, px);
+
+        self.cursorfreezed = false;
+
+        if (py < 0) py = 0;
+        else if (py > self.page.maxh) py = self.page.maxh;
+        if (px < 0) px = 0;
+        else if (px > self.page.maxw) px = self.page.maxw;
+        if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
+
+        if (self.onscrollend && self.scrollrunning) {
+          self.triggerScrollEnd();
+        }
+        self.scrollrunning = false;
+
+      };
+
+    } else {
+
+      this.doScrollLeft = function(x, spd) { //no-trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //no-trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //no-trans
+        var y = (y === undefined || y === false) ? self.getScrollTop(true) : y;
+
+        if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
+
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        if (!self.bouncescroll || !self.rail.visibility) {
+          if (self.newscrolly < 0) {
+            self.newscrolly = 0;
+          } else if (self.newscrolly > self.page.maxh) {
+            self.newscrolly = self.page.maxh;
+          }
+        }
+        if (!self.bouncescroll || !self.railh.visibility) {
+          if (self.newscrollx < 0) {
+            self.newscrollx = 0;
+          } else if (self.newscrollx > self.page.maxw) {
+            self.newscrollx = self.page.maxw;
+          }
+        }
+
+        self.dst = {};
+        self.dst.x = x - px;
+        self.dst.y = y - py;
+        self.dst.px = px;
+        self.dst.py = py;
+
+        var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
+
+        self.dst.ax = self.dst.x / dst;
+        self.dst.ay = self.dst.y / dst;
+
+        var pa = 0;
+        var pe = dst;
+
+        if (self.dst.x == 0) {
+          pa = py;
+          pe = y;
+          self.dst.ay = 1;
+          self.dst.py = 0;
+        } else if (self.dst.y == 0) {
+          pa = px;
+          pe = x;
+          self.dst.ax = 1;
+          self.dst.px = 0;
+        }
+
+        var ms = self.getTransitionSpeed(dst);
+        if (spd && spd <= 1) ms *= spd;
+        if (ms > 0) {
+          self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
+        } else {
+          self.bzscroll = false;
+        }
+
+        if (self.timer) return;
+
+        if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
+
+        var sync = 1;
+
+        function scrolling() {
+          if (self.cancelAnimationFrame) return true;
+
+          self.scrollrunning = true;
+
+          sync = 1 - sync;
+          if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
+
+          var done = 0;
+          var sx, sy;
+
+          var sc = sy = self.getScrollTop();
+          if (self.dst.ay) {
+            sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
+            var dr = sc - sy;
+            if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
+            self.setScrollTop(sc);
+            if (sc == self.newscrolly) done = 1;
+          } else {
+            done = 1;
+          }
+
+          var scx = sx = self.getScrollLeft();
+          if (self.dst.ax) {
+            scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
+            var dr = scx - sx;
+            if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
+            self.setScrollLeft(scx);
+            if (scx == self.newscrollx) done += 1;
+          } else {
+            done += 1;
+          }
+
+          if (done == 2) {
+            self.timer = 0;
+            self.cursorfreezed = false;
+            self.bzscroll = false;
+            self.scrollrunning = false;
+            if (sc < 0) sc = 0;
+            else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh);
+            if (scx < 0) scx = 0;
+            else if (scx > self.page.maxw) scx = self.page.maxw;
+            if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
+            else {
+              if (self.onscrollend) {
+                self.triggerScrollEnd();
+              }
+            }
+          } else {
+            self.timer = setAnimationFrame(scrolling) || 1;
+          }
+        }
+        self.cancelAnimationFrame = false;
+        self.timer = 1;
+
+        if (self.onscrollstart && !self.scrollrunning) {
+          var info = {
+            "type": "scrollstart",
+            "current": {
+              "x": px,
+              "y": py
+            },
+            "request": {
+              "x": x,
+              "y": y
+            },
+            "end": {
+              "x": self.newscrollx,
+              "y": self.newscrolly
+            },
+            "speed": ms
+          };
+          self.onscrollstart.call(self, info);
+        }
+
+        scrolling();
+
+        if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
+
+        self.noticeCursor();
+      };
+
+      this.cancelScroll = function() {
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+        self.bzscroll = false;
+        self.scrollrunning = false;
+        return self;
+      };
+
+    }
+
+    this.doScrollBy = function(stp, relative) {
+      var ny = 0;
+
+      if (relative) {
+        ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
+      } else {
+        var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
+        ny = sy - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.h / 2);
+        if (ny < -haf) ny = -haf;
+        else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
+      }
+      self.cursorfreezed = false;
+
+      var py = self.getScrollTop(true);
+      if (ny < 0 && py <= 0) return self.noticeCursor();
+      else if (ny > self.page.maxh && py >= self.page.maxh) {
+        self.checkContentSize();
+        return self.noticeCursor();
+      }
+
+      self.doScrollTop(ny);
+    };
+
+    this.doScrollLeftBy = function(stp, relative) {
+      var nx = 0;
+      if (relative) {
+        nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x);
+      } else {
+        var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
+        nx = sx - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.w / 2);
+        if (nx < -haf) nx = -haf;
+        else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
+      }
+      self.cursorfreezed = false;
+
+      var px = self.getScrollLeft(true);
+      if (nx < 0 && px <= 0) return self.noticeCursor();
+      else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
+
+      self.doScrollLeft(nx);
+    };
+
+    this.doScrollTo = function(pos, relative) {
+      var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
+      if (ny < 0) ny = 0;
+      else if (ny > self.page.maxh) ny = self.page.maxh;
+      self.cursorfreezed = false;
+      self.doScrollTop(pos);
+    };
+
+    this.checkContentSize = function() {
+      var pg = self.getContentSize();
+      if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
+    };
+
+    self.onscroll = function(e) {
+      if (self.rail.drag) return;
+      if (!self.cursorfreezed) {
+        self.synched('scroll', function() {
+          self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+          if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+          self.noticeCursor();
+        });
+      }
+      self.triggerScrollEnd();
+    };
+    self.bind(self.docscroll, "scroll", self.onscroll);
+
+    this.doZoomIn = function(e) {
+      if (self.zoomactive) return;
+      self.zoomactive = true;
+
+      self.zoomrestore = {
+        style: {}
+      };
+      var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
+      var win = self.win[0].style;
+      for (var a in lst) {
+        var pp = lst[a];
+        self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
+      }
+
+      self.zoomrestore.style.width = self.win.css('width');
+      self.zoomrestore.style.height = self.win.css('height');
+
+      self.zoomrestore.padding = {
+        w: self.win.outerWidth() - self.win.width(),
+        h: self.win.outerHeight() - self.win.height()
+      };
+
+      if (cap.isios4) {
+        self.zoomrestore.scrollTop = $(window).scrollTop();
+        $(window).scrollTop(0);
+      }
+
+      self.win.css({
+        position: (cap.isios4) ? "absolute" : "fixed",
+        top: 0,
+        left: 0,
+        zIndex: globalmaxzindex + 100,
+        margin: 0
+      });
+      var bkg = self.win.css("backgroundColor");
+      if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
+      self.rail.css({
+        zIndex: globalmaxzindex + 101
+      });
+      self.zoom.css({
+        zIndex: globalmaxzindex + 102
+      });
+      self.zoom.css('backgroundPosition', '0px -18px');
+      self.resizeZoom();
+
+      if (self.onzoomin) self.onzoomin.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoomOut = function(e) {
+      if (!self.zoomactive) return;
+      self.zoomactive = false;
+
+      self.win.css("margin", "");
+      self.win.css(self.zoomrestore.style);
+
+      if (cap.isios4) {
+        $(window).scrollTop(self.zoomrestore.scrollTop);
+      }
+
+      self.rail.css({
+        "z-index": self.zindex
+      });
+      self.zoom.css({
+        "z-index": self.zindex
+      });
+      self.zoomrestore = false;
+      self.zoom.css('backgroundPosition', '0px 0px');
+      self.onResize();
+
+      if (self.onzoomout) self.onzoomout.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoom = function(e) {
+      return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
+    };
+
+    this.resizeZoom = function() {
+      if (!self.zoomactive) return;
+
+      var py = self.getScrollTop(); //preserve scrolling position
+      self.win.css({
+        width: $(window).width() - self.zoomrestore.padding.w + "px",
+        height: $(window).height() - self.zoomrestore.padding.h + "px"
+      });
+      self.onResize();
+
+      self.setScrollTop(Math.min(self.page.maxh, py));
+    };
+
+    this.init();
+
+    $.nicescroll.push(this);
+
+  };
+
+  // Inspired by the work of Kin Blas
+  // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js  
+
+
+  var ScrollMomentumClass2D = function(nc) {
+    var self = this;
+    this.nc = nc;
+
+    this.lastx = 0;
+    this.lasty = 0;
+    this.speedx = 0;
+    this.speedy = 0;
+    this.lasttime = 0;
+    this.steptime = 0;
+    this.snapx = false;
+    this.snapy = false;
+    this.demulx = 0;
+    this.demuly = 0;
+
+    this.lastscrollx = -1;
+    this.lastscrolly = -1;
+
+    this.chkx = 0;
+    this.chky = 0;
+
+    this.timer = 0;
+
+    this.time = function() {
+      return +new Date(); //beautifull hack
+    };
+
+    this.reset = function(px, py) {
+      self.stop();
+      var now = self.time();
+      self.steptime = 0;
+      self.lasttime = now;
+      self.speedx = 0;
+      self.speedy = 0;
+      self.lastx = px;
+      self.lasty = py;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.update = function(px, py) {
+      var now = self.time();
+      self.steptime = now - self.lasttime;
+      self.lasttime = now;
+      var dy = py - self.lasty;
+      var dx = px - self.lastx;
+      var sy = self.nc.getScrollTop();
+      var sx = self.nc.getScrollLeft();
+      var newy = sy + dy;
+      var newx = sx + dx;
+      self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
+      self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
+      self.speedx = dx;
+      self.speedy = dy;
+      self.lastx = px;
+      self.lasty = py;
+    };
+
+    this.stop = function() {
+      self.nc.unsynched("domomentum2d");
+      if (self.timer) clearTimeout(self.timer);
+      self.timer = 0;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.doSnapy = function(nx, ny) {
+      var snap = false;
+
+      if (ny < 0) {
+        ny = 0;
+        snap = true;
+      } else if (ny > self.nc.page.maxh) {
+        ny = self.nc.page.maxh;
+        snap = true;
+      }
+
+      if (nx < 0) {
+        nx = 0;
+        snap = true;
+      } else if (nx > self.nc.page.maxw) {
+        nx = self.nc.page.maxw;
+        snap = true;
+      }
+
+      (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
+    };
+
+    this.doMomentum = function(gp) {
+      var t = self.time();
+      var l = (gp) ? t + gp : self.lasttime;
+
+      var sl = self.nc.getScrollLeft();
+      var st = self.nc.getScrollTop();
+
+      var pageh = self.nc.page.maxh;
+      var pagew = self.nc.page.maxw;
+
+      self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
+      self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
+
+      var chk = l && (t - l) <= 60;
+
+      if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
+
+      var sy = (self.speedy && chk) ? self.speedy : false;
+      var sx = (self.speedx && chk) ? self.speedx : false;
+
+      if (sy || sx) {
+        var tm = Math.max(16, self.steptime); //timeout granularity
+
+        if (tm > 50) { // do smooth
+          var xm = tm / 50;
+          self.speedx *= xm;
+          self.speedy *= xm;
+          tm = 50;
+        }
+
+        self.demulxy = 0;
+
+        self.lastscrollx = self.nc.getScrollLeft();
+        self.chkx = self.lastscrollx;
+        self.lastscrolly = self.nc.getScrollTop();
+        self.chky = self.lastscrolly;
+
+        var nx = self.lastscrollx;
+        var ny = self.lastscrolly;
+
+        var onscroll = function() {
+          var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
+
+          if (self.speedx) {
+            nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
+            self.lastscrollx = nx;
+            if ((nx < 0) || (nx > pagew)) df = 0.10;
+          }
+
+          if (self.speedy) {
+            ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
+            self.lastscrolly = ny;
+            if ((ny < 0) || (ny > pageh)) df = 0.10;
+          }
+
+          self.demulxy = Math.min(1, self.demulxy + df);
+
+          self.nc.synched("domomentum2d", function() {
+
+            if (self.speedx) {
+              var scx = self.nc.getScrollLeft();
+//              if (scx != self.chkx) self.stop();
+              self.chkx = nx;
+              self.nc.setScrollLeft(nx);
+            }
+
+            if (self.speedy) {
+              var scy = self.nc.getScrollTop();
+//              if (scy != self.chky) self.stop();
+              self.chky = ny;
+              self.nc.setScrollTop(ny);
+            }
+
+            if (!self.timer) {
+              self.nc.hideCursor();
+              self.doSnapy(nx, ny);
+            }
+
+          });
+
+          if (self.demulxy < 1) {
+            self.timer = setTimeout(onscroll, tm);
+          } else {
+            self.stop();
+            self.nc.hideCursor();
+            self.doSnapy(nx, ny);
+          }
+        };
+
+        onscroll();
+
+      } else {
+        self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
+      }
+
+    };
+
+  };
+
+
+  // override jQuery scrollTop
+
+  var _scrollTop = jQuery.fn.scrollTop; // preserve original function
+
+  jQuery.cssHooks.pageYOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
+      return this;
+    }
+  };
+
+  /*  
+  $.fx.step["scrollTop"] = function(fx){    
+    $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
+  };
+*/
+
+  jQuery.fn.scrollTop = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
+      });
+    }
+  };
+
+  // override jQuery scrollLeft
+
+  var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
+
+  $.cssHooks.pageXOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
+      return this;
+    }
+  };
+
+  /*  
+  $.fx.step["scrollLeft"] = function(fx){
+    $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
+  };  
+*/
+
+  jQuery.fn.scrollLeft = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
+      });
+    }
+  };
+
+  var NiceScrollArray = function(doms) {
+    var self = this;
+    this.length = 0;
+    this.name = "nicescrollarray";
+
+    this.each = function(fn) {
+      $.each(self, fn);
+      return self;
+    };
+
+    this.push = function(nice) {
+      self[self.length] = nice;
+      self.length++;
+    };
+
+    this.eq = function(idx) {
+      return self[idx];
+    };
+
+    if (doms) {
+      for (var a = 0; a < doms.length; a++) {
+        var nice = $.data(doms[a], '__nicescroll') || false;
+        if (nice) {
+          this[this.length] = nice;
+          this.length++;
+        }
+      }
+    }
+
+    return this;
+  };
+
+  function mplex(el, lst, fn) {
+    for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
+  }
+  mplex(
+    NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
+    function(e, n) {
+      e[n] = function() {
+        var args = arguments;
+        return this.each(function() {
+          this[n].apply(this, args);
+        });
+      };
+    }
+  );
+
+  jQuery.fn.getNiceScroll = function(index) {
+    if (index === undefined) {
+      return new NiceScrollArray(this);
+    } else {
+      return this[index] && $.data(this[index], '__nicescroll') || false;
+    }
+  };
+
+  jQuery.expr[':'].nicescroll = function(a) {
+    return $.data(a, '__nicescroll') !== undefined;
+  };
+
+  $.fn.niceScroll = function(wrapper, opt) {
+    if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
+      opt = wrapper;
+      wrapper = false;
+    }
+    opt = $.extend({},opt); // cloning
+    var ret = new NiceScrollArray();
+    if (opt === undefined) opt = {};
+
+    if (wrapper || false) {
+      opt.doc = $(wrapper);
+      opt.win = $(this);
+    }
+    var docundef = !("doc" in opt);
+    if (!docundef && !("win" in opt)) opt.win = $(this);
+
+    this.each(function() {
+      var nice = $(this).data('__nicescroll') || false;
+      if (!nice) {
+        opt.doc = (docundef) ? $(this) : opt.doc;
+        nice = new NiceScrollClass(opt, $(this));
+        $(this).data('__nicescroll', nice);
+      }
+      ret.push(nice);
+    });
+    return (ret.length == 1) ? ret[0] : ret;
+  };
+
+  window.NiceScroll = {
+    getjQuery: function() {
+      return jQuery;
+    }
+  };
+
+  if (!$.nicescroll) {
+    $.nicescroll = new NiceScrollArray();
+    $.nicescroll.options = _globaloptions;
+  }
+
+}));
+

Failā izmaiņas netiks attēlotas, jo tās ir par lielu
+ 1 - 120
dist/jquery.nicescroll.min.js


BIN
dist/zoomico.png


+ 198 - 149
jquery.nicescroll.js

@@ -1,6 +1,6 @@
 /* jquery.nicescroll
--- version 3.6.8
--- copyright 2016-02-29 InuYaksa*2016
+-- version 3.7.0 [maintenance edition]
+-- copyright 2017-05-21 InuYaksa*2017
 -- licensed under the MIT
 --
 -- http://nicescroll.areaaperta.com/
@@ -38,20 +38,23 @@
     return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
   }
 
-  var vendors = ['webkit','ms','moz','o'];
-
-  var setAnimationFrame = window.requestAnimationFrame || false;
-  var clearAnimationFrame = window.cancelAnimationFrame || false;
-
-  if (!setAnimationFrame) {  // legacy detection
-    for (var vx in vendors) {
-      var v = vendors[vx];
-      setAnimationFrame = window[v + 'RequestAnimationFrame'];
-      if (setAnimationFrame) {
-        clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
-        break;
-      }
-    }
+  // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/  
+  var setAnimationFrame = (function(){ return window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || false; })();
+  var clearAnimationFrame = (function(){ return window.cancelAnimationFrame || window.webkitCancelAnimationFrame || window.mozCancelAnimationFrame || false; })();  
+  if (!setAnimationFrame) {
+    setAnimationFrame = function(callback, element) {
+      var currTime = new Date().getTime();
+      var timeToCall = Math.max(0, 16 - (currTime - lastTime));
+      var id = window.setTimeout(function() { callback(currTime + timeToCall); },
+        timeToCall);
+      lastTime = currTime + timeToCall;
+      return id;
+    };
+    clearAnimationFrame = function(id) {
+      window.clearTimeout(id);
+    };
+  } else {
+    if (!window.cancelAnimationFrame) clearAnimationFrame = function(id) {};
   }
 
   var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
@@ -66,7 +69,8 @@
     cursorborderradius: "5px",
     scrollspeed: 60,
     mousescrollstep: 8 * 3,
-    touchbehavior: false,
+    touchbehavior: false,   // deprecated
+    emulatetouch: false,    // replacing touchbehavior
     hwacceleration: true,
     usetransition: true,
     boxzoom: false,
@@ -112,7 +116,8 @@
     oneaxismousemode: "auto",
     scriptpath: getScriptPath(),
     preventmultitouchscrolling: true,
-    disablemutationobserver:false
+    disablemutationobserver:false,
+    enableobserver:true
   };
 
   var browserdetected = false;
@@ -135,24 +140,23 @@
 
     d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
     d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
-    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
-    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
-    d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9);
-    d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
+    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode === 7));
+    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode === 8);
+    d.isie9 = d.isie && ("performance" in window) && (document.documentMode === 9);
+    d.isie10 = d.isie && ("performance" in window) && (document.documentMode === 10);
     d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
-    d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./));  // IE Edge 12
-    d.isieedge = ("msOverflowStyle" in _el);  // IE Edge
-    d.ismodernie = d.isie11 || d.isieedge;
-    
+
+    d.ismsedge = ("msCredentials" in window);  // MS Edge 14+
+
     d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
     if (d.isie9mobile) d.isie9 = false;
     d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
 
     d.ismozilla = ("MozAppearance" in _style);
 
-    d.iswebkit = ("WebkitAppearance" in _style);
+    d.iswebkit = !d.ismsedge&&("WebkitAppearance" in _style);
 
-    d.ischrome = ("chrome" in window);
+    d.ischrome = !d.ismsedge&&("chrome" in window);
     d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
     d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
     d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
@@ -167,6 +171,7 @@
     d.isios4 = ((d.isios) && !("seal" in Object));
     d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
     d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
+    d.isios10 = (d.isios&&window.Proxy);  //iOS 10+
 
     d.isandroid = (/android/i.test(_agent));
 
@@ -179,39 +184,50 @@
     d.hastransition = false;
     d.transitionend = false;
 
-    var a;
-    var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
-    for (a = 0; a < check.length; a++) {
-      if (_style[check[a]] !== undefined) {
-        d.trstyle = check[a];
-        break;
+    d.trstyle = "transform";
+    d.hastransform = ("transform" in _style)||(function(){
+      var a;
+      var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
+      for (a = 0; a < check.length; a++) {
+        if (_style[check[a]] !== undefined) {
+          d.trstyle = check[a];
+          break;
+        }
       }
-    }
-    d.hastransform = (!!d.trstyle);
+      d.hastransform = (!!d.trstyle);
+    })(); 
+
     if (d.hastransform) {
       _style[d.trstyle] = "translate3d(1px,2px,3px)";
       d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
     }
 
-    d.transitionstyle = false;
+    d.transitionstyle = "transition";
     d.prefixstyle = '';
-    d.transitionend = false;
-    check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
-    var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
-    var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
-    for (a = 0; a < check.length; a++) {
-      if (check[a] in _style) {
-        d.transitionstyle = check[a];
-        d.prefixstyle = prefix[a];
-        d.transitionend = evs[a];
-        break;
+    d.transitionend = "transitionend";
+
+    d.hastransition = ("transition" in _style)||(function(){
+
+      d.transitionend = false;
+      var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+      var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+      var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+      for (var a = 0; a < check.length; a++) {
+        if (check[a] in _style) {
+          d.transitionstyle = check[a];
+          d.prefixstyle = prefix[a];
+          d.transitionend = evs[a];
+          break;
+        }
+      }    
+      if (d.ischrome26) {  // always use prefix
+        d.prefixstyle = prefix[1];
       }
-    }
-    if (d.ischrome26) {  // always use prefix
-      d.prefixstyle = prefix[1];
-    }
+      d.hastransition = (d.transitionstyle);
+
+    })();
+
 
-    d.hastransition = (d.transitionstyle);
 
     function detectCursorGrab() {
       var lst = ['grab','-webkit-grab', '-moz-grab'];
@@ -221,7 +237,7 @@
         _style.cursor = p;
         if (_style.cursor == p) return p;
       }
-      return 'url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor!
+      return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thank to https://cdnjs.com/ for the openhand cursor!
     }
     d.cursorgrabvalue = detectCursorGrab();
 
@@ -240,7 +256,7 @@
 
     var self = this;
 
-    this.version = '3.6.8';
+    this.version = '3.7.0';
     this.name = 'nicescroll';
 
     this.me = me;
@@ -795,9 +811,9 @@
 
     };
 
-    self.hasanimationframe = (setAnimationFrame);
-    self.hascancelanimationframe = (clearAnimationFrame);
-
+    self.hasanimationframe = ("requestAnimationFrame" in window);
+    self.hascancelanimationframe = ("cancelAnimationFrame" in window);
+/*
     if (!self.hasanimationframe) {
       setAnimationFrame = function(fn) {
         return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
@@ -806,6 +822,7 @@
     } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
       self.cancelAnimationFrame = true;
     };
+*/    
 
     this.init = function() {
     
@@ -813,14 +830,12 @@
       
       if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
       if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
-
-      var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action';
-      if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
-        _touchaction: 'none'
-      });
+      if (cap.isandroid && !("hidden" in document)) return true; // Android 3- SORRY, DO NOT WORK!
 
       var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
       
+      self.opt.emulatetouch = self.opt.emulatetouch||self.opt.touchbehavior;  // mantain compatibility with "touchbehavior"      
+
       self.zindex = "auto";
       if (!self.ispage && self.opt.zindex == "auto") {
         self.zindex = getZIndex() || "auto";
@@ -1194,11 +1209,12 @@
 
         } else {
 
-          if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
+          if (cap.cantouch || self.istouchcapable || self.opt.emulatetouch || cap.hasmstouch) {
 
             self.scrollmom = new ScrollMomentumClass2D(self);
 
             self.ontouchstart = function(e) {
+
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
               
               self.hasmoving = false;
@@ -1247,7 +1263,8 @@
                   st: self.getScrollTop(),
                   sl: self.getScrollLeft(),
                   pt: 2,
-                  dl: false
+                  dl: false,
+                  tg: tg
                 };
 
                 if (self.ispage || !self.opt.directionlockdeadzone) {
@@ -1273,7 +1290,7 @@
                   if (!self.rail.drag.ck) self.rail.drag.dl = "f";
                 }
 
-                if (self.opt.touchbehavior && self.isiframe && cap.isie) {
+                if (self.opt.emulatetouch && self.isiframe && cap.isie) {
                   var wp = self.win.position();
                   self.rail.drag.x += wp.left;
                   self.rail.drag.y += wp.top;
@@ -1285,10 +1302,10 @@
                 
                 if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
                 
-                  var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
+                  var ip = (tg) ? /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName) : false;
                   if (!ip) {
                     if (!self.ispage && cap.hasmousecapture) tg.setCapture();
-                    if (self.opt.touchbehavior) {
+                    if (self.opt.emulatetouch) {
                       if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
                         tg._onclick = tg.onclick;
                         tg.onclick = function(e) {
@@ -1314,18 +1331,27 @@
             };
 
             self.ontouchend = function(e) {              
+
               if (!self.rail.drag) return true;              
               if (self.rail.drag.pt == 2) {
-                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-								
-                self.scrollmom.doMomentum();
+                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;                
+
+                if (!self.hasmoving) {
+                  var tg = self.rail.drag.tg;
+                  setTimeout(function(){
+                    tg&&$(tg).trigger("click");
+                  },20);
+                }
                 self.rail.drag = false;
-                if (self.hasmoving) {
+
+                if (self.hasmoving) {                  
+                  self.scrollmom.doMomentum();
                   self.lastmouseup = true;
                   self.hideCursor();
                   if (cap.hasmousecapture) document.releaseCapture();
                   if (!cap.cantouch) return self.cancelEvent(e);
                 }
+
               }
               else if (self.rail.drag.pt == 1) {
                 return self.onmouseup(e);
@@ -1333,27 +1359,22 @@
 
             };
 
-            var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
+            var moveneedoffset = (self.opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
 
             self.ontouchmove = function(e, byiframe) {
 
               if (!self.rail.drag) return false;
-            
+
               if (e.targetTouches && self.opt.preventmultitouchscrolling) {
                 if (e.targetTouches.length > 1) return false; // multitouch
               }
             
               if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-          
-              if (self.rail.drag.pt == 2) {
-                if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements
-
-                self.hasmoving = true;
+              
+              cap.isandroid && self.cancelEvent(e);
 
-                if (self.preventclick && !self.preventclick.click) {
-                  self.preventclick.click = self.preventclick.tg.onclick || false;
-                  self.preventclick.tg.onclick = self.onpreventclick;
-                }
+              if (self.rail.drag.pt == 2) {
+                //if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements  <--- not works on modern devices
 
                 var ev = $.extend({
                   "original": e
@@ -1374,6 +1395,15 @@
                   e.clientY = le.screenY;
                 }
 
+                if (self.rail.drag.y===e.clientY&&self.rail.drag.x===e.clientX) return false;  // prevent first useless move event 
+
+                self.hasmoving = true;
+
+                if (self.preventclick && !self.preventclick.click) {
+                  self.preventclick.click = self.preventclick.tg.onclick || false;
+                  self.preventclick.tg.onclick = self.onpreventclick;
+                }
+
                 var ofy,ofx;
                 ofx = ofy = 0;
 
@@ -1565,7 +1595,7 @@
               sx: self.scroll.x,
               sy: self.scroll.y,
               pt: 1,
-              hr: (!!hronly)
+              hr: hronly||false
             };
             var tg = self.getTarget(e);
             if (!self.ispage && cap.hasmousecapture) tg.setCapture();
@@ -1594,9 +1624,9 @@
 
           self.onmousemove = function(e) {
             if (self.rail.drag) {
-              if (self.rail.drag.pt != 1) return;
+              if (self.rail.drag.pt !== 1) return;
 
-              if (cap.ischrome && e.which == 0) return self.onmouseup(e);
+              if (cap.ischrome && e.which === 0) return self.onmouseup(e);
 
               self.cursorfreezed = true;
               self.hasmoving = true;
@@ -1634,7 +1664,7 @@
             }
           };
 
-          if (cap.cantouch || self.opt.touchbehavior) {
+          if (cap.cantouch || self.opt.emulatetouch) {
 
             self.onpreventclick = function(e) {
               if (self.preventclick) {
@@ -1644,7 +1674,7 @@
               }
             };
 
-            self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
+            //self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging  <-- REENABLE!!
 
             self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
               if (self.lastmouseup) {
@@ -1723,11 +1753,10 @@
                 checkSelectionScroll(e);
               }, 250);
             };
-
-
           }
 
           if (cap.hasw3ctouch) { //IE11+
+            self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
             self.css(self.rail, {
               'touch-action': 'none'
             });
@@ -1738,6 +1767,7 @@
             self.bind(document, "pointerup", self.ontouchend);
             self.bind(document, "pointermove", self.ontouchmove);
           } else if (cap.hasmstouch) { //IE10
+            self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
             self.css(self.rail, {
               '-ms-touch-action': 'none'
             });
@@ -1753,15 +1783,20 @@
             self.bind(self.cursor, "contextmenu", function(e) {
               e.preventDefault();
             });
-          } else if (this.istouchcapable) { //desktop with screen touch enabled
-            self.bind(self.win, "touchstart", self.ontouchstart);
-            self.bind(document, "touchend", self.ontouchend);
-            self.bind(document, "touchcancel", self.ontouchend);
-            self.bind(document, "touchmove", self.ontouchmove);
+          } else if (cap.cantouch) { // smartphones/touch devices
+            self.bind(self.win, "touchstart", self.ontouchstart,false,true);
+            self.bind(document, "touchend", self.ontouchend,false,true);
+            self.bind(document, "touchcancel", self.ontouchend,false,true);
+            self.bind(document, "touchmove", self.ontouchmove,false,true);
           }
 
+          if (self.opt.emulatetouch) {
+            self.bind(self.win, "mousedown", self.ontouchstart,false,true);
+            self.bind(document, "mouseup", self.ontouchend,false,true);
+            self.bind(document, "mousemove", self.ontouchmove,false,true);
+          }
           
-          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
+          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.emulatetouch)) {
 
             self.rail.css({
               cursor: "default"
@@ -1836,7 +1871,7 @@
             self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
           }
 
-          if (!cap.cantouch && !self.opt.touchbehavior) {
+          if (!cap.cantouch && !self.opt.emulatetouch) {
 
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
             self.bind(document, "mousemove", self.onmousemove);
@@ -1874,7 +1909,7 @@
           } else {
 
             self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
-            self.bind(document, "mousemove", self.ontouchmove);
+            //self.bind(document, "mousemove", self.ontouchmove);
             if (self.onclick) self.bind(document, "click", self.onclick);
 
             if (self.opt.cursordragontouch) {
@@ -2049,59 +2084,63 @@
           self.lazyResize(self.isieold ? 250 : 30);
         };
 
-        if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
-          self.observerbody = new ClsMutationObserver(function(mutations) {
-            mutations.forEach(function(mut){
-              if (mut.type=="attributes") {
-                return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
-              }
-            });
-            // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
-            if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
-          });
-          self.observerbody.observe(document.body, {
-            childList: true,
-            subtree: true,
-            characterData: false,
-            attributes: true,
-            attributeFilter: ['class']
-          });
-        }
-        
-        if (!self.ispage && !self.haswrapper) {
-          // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
-          if (ClsMutationObserver !== false) {
-            self.observer = new ClsMutationObserver(function(mutations) {
-              mutations.forEach(self.onAttributeChange);
+        if (self.opt.enableobserver) {
+
+          if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
+            self.observerbody = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(function(mut){
+                if (mut.type=="attributes") {
+                  return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+                }
+              });
+              // if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
+              if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
             });
-            self.observer.observe(self.win[0], {
+            self.observerbody.observe(document.body, {
               childList: true,
+              subtree: true,
               characterData: false,
               attributes: true,
-              subtree: false
+              attributeFilter: ['class']
             });
-            self.observerremover = new ClsMutationObserver(function(mutations) {
-              mutations.forEach(function(mo) {
-                if (mo.removedNodes.length > 0) {
-                  for (var dd in mo.removedNodes) {
-                    if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+          }
+          
+          if (!self.ispage && !self.haswrapper) {
+            // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+            if (ClsMutationObserver !== false) {
+              self.observer = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(self.onAttributeChange);
+              });
+              self.observer.observe(self.win[0], {
+                childList: true,
+                characterData: false,
+                attributes: true,
+                subtree: false
+              });
+              self.observerremover = new ClsMutationObserver(function(mutations) {
+                mutations.forEach(function(mo) {
+                  if (mo.removedNodes.length > 0) {
+                    for (var dd in mo.removedNodes) {
+                      if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+                    }
                   }
-                }
+                });
               });
-            });
-            self.observerremover.observe(self.win[0].parentNode, {
-              childList: true,
-              characterData: false,
-              attributes: false,
-              subtree: false
-            });
-          } else {
-            self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
-            if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
-            self.bind(self.win, "DOMNodeRemoved", function(e) {
-              if (e.target == self.win[0]) self.remove();
-            });
+              self.observerremover.observe(self.win[0].parentNode, {
+                childList: true,
+                characterData: false,
+                attributes: false,
+                subtree: false
+              });
+            } else {
+              self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+              if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+              self.bind(self.win, "DOMNodeRemoved", function(e) {
+                if (e.target == self.win[0]) self.remove();
+              });
+            }
           }
+
         }
 
         //
@@ -2180,7 +2219,11 @@
 
           if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
 
-          if (cap.cantouch || self.opt.touchbehavior) {
+          if (cap.cantouch) {
+            self.bind(doc, "touchstart", self.ontouchstart);
+            self.bind(doc, "touchmove", self.ontouchmove);          
+          } 
+          else if (self.opt.emulatetouch) {
             self.bind(doc, "mousedown", self.ontouchstart);
             self.bind(doc, "mousemove", function(e) {
               return self.ontouchmove(e, true);
@@ -2437,7 +2480,7 @@
 			if (!self.haswrapper) self.hide();	
 			if (self.hlazyresize) clearTimeout(self.hlazyresize);
 			self.hlazyresize = setTimeout(function(){
-				self && self.show().resize();
+				if (self) { self.resize(); self.show(); }  // this form mandatory for uglify
 			},240);
 			
       return self;
@@ -2500,12 +2543,16 @@
     
     if (cap.haseventlistener) {  // W3C standard event model
     
-      this.bind = function(dom, name, fn, bubble) {  // W3C
+      this.bind = function(dom, name, fn, bubble, active) {  // W3C
         var el = ("jquery" in dom) ? dom[0] : dom;
-        self._bind(el, name, fn, bubble || false);
+        self._bind(el, name, fn, bubble || false, active || false);
       };
-    
-      this._bind = function(el, name, fn, bubble) { // primitive bind
+
+      // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
+      var passiveSupported = false;
+      try{var options=Object.defineProperty({},"passive",{get:function(){passiveSupported=!0}});window.addEventListener("test",null,options)}catch(err){}
+      this._bind = function(el, name, fn, bubble, active) { // primitive bind
+      
         self.events.push({
           e: el,
           n: name,
@@ -2513,7 +2560,8 @@
           b: bubble,
           q: false
         });
-        el.addEventListener(name, fn, bubble || false);
+
+        (passiveSupported&&active) ? el.addEventListener(name, fn, {passive:false,capture:bubble}) : el.addEventListener(name, fn, bubble || false);
       };    
       this.cancelEvent = function(e) {
         if (!e) return false;
@@ -3266,6 +3314,7 @@
 
     this.doScrollBy = function(stp, relative) {
       var ny = 0;
+
       if (relative) {
         ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
       } else {

Failā izmaiņas netiks attēlotas, jo tās ir par lielu
+ 0 - 0
jquery.nicescroll.min.js


+ 26 - 16
package.json

@@ -1,6 +1,6 @@
 {
   "name": "nicescroll",
-  "version": "3.6.8",
+  "version": "3.7.0",
   "bugs": "http://github.com/inuyaksa/jquery.nicescroll/issues",
   "repository": {
     "type": "git",
@@ -12,15 +12,15 @@
     "url": "https://github.com/inuyaksa"
   },
   "licenses": "MIT",
-	"autoupdate": {
+  "autoupdate": {
     "source": "git",
     "target": "git://github.com/inuyaksa/jquery.nicescroll.git",
     "basePath": "dist",
     "files": [
       "**/*"
     ]
-  },	
-  "description": "Nicescroll is a jquery plugin, for nice customizabled scrollbars with a very similar ios/mobile style. It supports DIVs, IFrames and document page (body) scrollbars. Compatible with Firefox 4+, Chrome 5+, Safari 4+ (win/mac), Opera 10+, IE 6+ (all A-grade browsers). Compatible with iOS devices as iPad, Android, Blackberry, Windows Phone, and many many mobile and touch devices.",
+  },
+  "description": "Nicescroll is a jquery plugin, for nice customizabled scrollbars with a very similar ios/mobile style. It supports DIVs, IFrames and document page (body) scrollbars. Compatible with modern browsers Chrome/Firefox/Edge/Safari/Opera for smartphone ios/android and desktop pc/mac: iphone/ipad/ipod, android, surface, pc (chrome/firefox) mac (safari/chrome). Compatibile with older browers too, such as IE11/10/9, some limitations could exists.",
   "keywords": [
     "nicescroll",
     "jquery",
@@ -36,7 +36,12 @@
     "desktop",
     "scrollbar",
     "touch",
-    "android"
+    "android",
+    "chrome",
+    "firefox",
+    "safari",
+    "surface",
+    "edge"
   ],
   "homepage": "https://github.com/inuyaksa/jquery.nicescroll",
   "contributors": [
@@ -56,21 +61,26 @@
     "TNKSoftware"
   ],
   "files": [
-    "jquery.nicescroll.js",
-    "jquery.nicescroll.min.js",
-    "zoomico.png"
+    "dist/jquery.nicescroll.js",
+    "dist/jquery.nicescroll.min.js",
+    "dist/zoomico.png"
   ],
   "main": "jquery.nicescroll.js",
   "dependencies": {
     "jquery": ">=1.8.3"
   },
-  "devDependencies": {},
+  "devDependencies": {
+    "grunt-contrib-copy": "^1.0.0",
+    "grunt-contrib-jshint": "^1.1.0"
+  },
   "npmName": "nicescroll",
-  "npmFileMap": [{
-    "basePath": "/dist/",
-    "files": [
-      "*.js",
-      "zoomico.png"
-    ]
-  }]
+  "npmFileMap": [
+    {
+      "basePath": "/dist/",
+      "files": [
+        "*.js",
+        "zoomico.png"
+      ]
+    }
+  ]
 }

BIN
zoomico.png


Daži faili netika attēloti, jo izmaiņu fails ir pārāk liels