jquery.nicescroll/jquery.nicescroll.js

/* jquery.nicescroll
-- version 3.7.6
-- copyright 2017-07-19 InuYaksa*2017
-- licensed under the MIT
--
-- https://nicescroll.areaaperta.com/
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/

/* jshint expr: true */

(function (factory) {
  if (typeof define === 'function' && define.amd) {
    // AMD. Register as anonymous module.
    define(['jquery'], factory);
  } else if (typeof exports === 'object') {
    // Node/CommonJS.
    module.exports = factory(require('jquery'));
  } else {
    // Browser globals.
    factory(jQuery);
  }
}(function (jQuery) {

  "use strict";

  // globals
  var domfocus = false,
    mousefocus = false,
    tabindexcounter = 0,
    ascrailcounter = 2000,
    globalmaxzindex = 0;

  var $ = jQuery,       // sandbox
    _doc = document,
    _win = window,
    $window = $(_win);

  var delegatevents = [];

  // http://stackoverflow.com/questions/2161159/get-script-path
  function getScriptPath() {
    var scripts = _doc.currentScript || (function () { var s = _doc.getElementsByTagName('script'); return (s.length) ? s[s.length - 1] : false; })();
    var path = scripts ? scripts.src.split('?')[0] : '';
    return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
  }

  // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/  
  var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false;
  var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false;

  if (!setAnimationFrame) {
    var anilasttime = 0;
    setAnimationFrame = function (callback, element) {
      var currTime = new Date().getTime();
      var timeToCall = Math.max(0, 16 - (currTime - anilasttime));
      var id = _win.setTimeout(function () { callback(currTime + timeToCall); },
        timeToCall);
      anilasttime = currTime + timeToCall;
      return id;
    };
    clearAnimationFrame = function (id) {
      _win.clearTimeout(id);
    };
  } else {
    if (!_win.cancelAnimationFrame) clearAnimationFrame = function (id) { };
  }

  var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false;

  var now = Date.now || function () { return new Date().getTime(); };

  var _globaloptions = {
    zindex: "auto",
    cursoropacitymin: 0,
    cursoropacitymax: 1,
    cursorcolor: "#424242",
    cursorwidth: "6px",
    cursorborder: "1px solid #fff",
    cursorborderradius: "5px",
    scrollspeed: 40,
    mousescrollstep: 9 * 3,
    touchbehavior: false,   // deprecated
    emulatetouch: false,    // replacing touchbehavior
    hwacceleration: true,
    usetransition: true,
    boxzoom: false,
    dblclickzoom: true,
    gesturezoom: true,
    grabcursorenabled: true,
    autohidemode: true,
    background: "",
    iframeautoresize: true,
    cursorminheight: 32,
    preservenativescrolling: true,
    railoffset: false,
    railhoffset: false,
    bouncescroll: true,
    spacebarenabled: true,
    railpadding: {
      top: 0,
      right: 0,
      left: 0,
      bottom: 0
    },
    disableoutline: true,
    horizrailenabled: true,
    railalign: "right",
    railvalign: "bottom",
    enabletranslate3d: true,
    enablemousewheel: true,
    enablekeyboard: true,
    smoothscroll: true,
    sensitiverail: true,
    enablemouselockapi: true,
    //      cursormaxheight:false,
    cursorfixedheight: false,
    directionlockdeadzone: 6,
    hidecursordelay: 400,
    nativeparentscrolling: true,
    enablescrollonselection: true,
    overflowx: true,
    overflowy: true,
    cursordragspeed: 0.3,
    rtlmode: "auto",
    cursordragontouch: false,
    oneaxismousemode: "auto",
    scriptpath: getScriptPath(),
    preventmultitouchscrolling: true,
    disablemutationobserver: false,
    enableobserver: true,
    scrollbarid: false
  };

  var browserdetected = false;

  var getBrowserDetection = function () {

    if (browserdetected) return browserdetected;

    var _el = _doc.createElement('DIV'),
      _style = _el.style,
      _agent = navigator.userAgent,
      _platform = navigator.platform,
      d = {};

    d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc;

    d.isopera = ("opera" in _win); // 12-
    d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
    d.isoperamini = (Object.prototype.toString.call(_win.operamini) === "[object OperaMini]");

    d.isie = (("all" in _doc) && ("attachEvent" in _el) && !d.isopera); //IE10-
    d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
    d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || (_doc.documentMode === 7));
    d.isie8 = d.isie && ("documentMode" in _doc) && (_doc.documentMode === 8);
    d.isie9 = d.isie && ("performance" in _win) && (_doc.documentMode === 9);
    d.isie10 = d.isie && ("performance" in _win) && (_doc.documentMode === 10);
    d.isie11 = ("msRequestFullscreen" in _el) && (_doc.documentMode >= 11); // IE11+

    d.ismsedge = ("msCredentials" in _win);  // MS Edge 14+

    d.ismozilla = ("MozAppearance" in _style);

    d.iswebkit = !d.ismsedge && ("WebkitAppearance" in _style);

    d.ischrome = d.iswebkit && ("chrome" in _win);
    d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
    d.ischrome22 = (!d.ischrome38) && (d.ischrome && d.haspointerlock);
    d.ischrome26 = (!d.ischrome38) && (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)

    d.cantouch = ("ontouchstart" in _doc.documentElement) || ("ontouchstart" in _win); // with detection for Chrome Touch Emulation    
    d.hasw3ctouch = (_win.PointerEvent || false) && ((navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
    d.hasmstouch = (!d.hasw3ctouch) && (_win.MSPointerEvent || false); // IE10 pointer events

    d.ismac = /^mac$/i.test(_platform);

    d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform);
    d.isios4 = d.isios && !("seal" in Object);
    d.isios7 = d.isios && ("webkitHidden" in _doc);  //iOS 7+
    d.isios8 = d.isios && ("hidden" in _doc);  //iOS 8+
    d.isios10 = d.isios && _win.Proxy;  //iOS 10+

    d.isandroid = (/android/i.test(_agent));

    d.haseventlistener = ("addEventListener" in _el);

    d.trstyle = false;
    d.hastransform = false;
    d.hastranslate3d = false;
    d.transitionstyle = false;
    d.hastransition = false;
    d.transitionend = false;

    d.trstyle = "transform";
    d.hastransform = ("transform" in _style) || (function () {
      var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
      for (var a = 0, c = check.length; a < c; a++) {
        if (_style[check[a]] !== undefined) {
          d.trstyle = check[a];
          break;
        }
      }
      d.hastransform = (!!d.trstyle);
    })();

    if (d.hastransform) {
      _style[d.trstyle] = "translate3d(1px,2px,3px)";
      d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
    }

    d.transitionstyle = "transition";
    d.prefixstyle = '';
    d.transitionend = "transitionend";

    d.hastransition = ("transition" in _style) || (function () {

      d.transitionend = false;
      var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
      var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
      var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
      for (var a = 0, c = check.length; a < c; a++) {
        if (check[a] in _style) {
          d.transitionstyle = check[a];
          d.prefixstyle = prefix[a];
          d.transitionend = evs[a];
          break;
        }
      }
      if (d.ischrome26) d.prefixstyle = prefix[1];  // always use prefix

      d.hastransition = (d.transitionstyle);

    })();

    function detectCursorGrab() {
      var lst = ['grab', '-webkit-grab', '-moz-grab'];
      if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
      for (var a = 0, l = lst.length; a < l; a++) {
        var p = lst[a];
        _style.cursor = p;
        if (_style.cursor == p) return p;
      }
      return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thanks to https://cdnjs.com/ for the openhand cursor!
    }
    d.cursorgrabvalue = detectCursorGrab();

    d.hasmousecapture = ("setCapture" in _el);

    d.hasMutationObserver = (ClsMutationObserver !== false);

    _el = null; //memory released

    browserdetected = d;

    return d;
  };

  var NiceScrollClass = function (myopt, me) {

    var self = this;

    this.version = '3.7.6';
    this.name = 'nicescroll';

    this.me = me;

    var $body = $("body");

    var opt = this.opt = {
      doc: $body,
      win: false
    };

    $.extend(opt, _globaloptions);  // clone opts

    // Options for internal use
    opt.snapbackspeed = 80;

    if (myopt || false) {
      for (var a in opt) {
        if (myopt[a] !== undefined) opt[a] = myopt[a];
      }
    }

    if (opt.disablemutationobserver) ClsMutationObserver = false;

    this.doc = opt.doc;
    this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
    this.ispage = /^BODY|HTML/.test((opt.win) ? opt.win[0].nodeName : this.doc[0].nodeName);
    this.haswrapper = (opt.win !== false);
    this.win = opt.win || (this.ispage ? $window : this.doc);
    this.docscroll = (this.ispage && !this.haswrapper) ? $window : this.win;
    this.body = $body;
    this.viewport = false;

    this.isfixed = false;

    this.iframe = false;
    this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));

    this.istextarea = (this.win[0].nodeName == 'TEXTAREA');

    this.forcescreen = false; //force to use screen position on events

    this.canshowonmouseevent = (opt.autohidemode != "scroll");

    // Events jump table    
    this.onmousedown = false;
    this.onmouseup = false;
    this.onmousemove = false;
    this.onmousewheel = false;
    this.onkeypress = false;
    this.ongesturezoom = false;
    this.onclick = false;

    // Nicescroll custom events
    this.onscrollstart = false;
    this.onscrollend = false;
    this.onscrollcancel = false;

    this.onzoomin = false;
    this.onzoomout = false;

    // Let's start!  
    this.view = false;
    this.page = false;

    this.scroll = {
      x: 0,
      y: 0
    };
    this.scrollratio = {
      x: 0,
      y: 0
    };
    this.cursorheight = 20;
    this.scrollvaluemax = 0;

    // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
    // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
    if (opt.rtlmode == "auto") {
      var target = this.win[0] == _win ? this.body : this.win;
      var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");

      if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") {
        this.isrtlmode = (target.css("direction") == "rtl");
        this.isvertical = false;
      } else {
        this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
        this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
      }
    } else {
      this.isrtlmode = (opt.rtlmode === true);
      this.isvertical = false;
    }
    //    this.checkrtlmode = false;

    this.scrollrunning = false;

    this.scrollmom = false;

    this.observer = false;  // observer div changes
    this.observerremover = false;  // observer on parent for remove detection
    this.observerbody = false;  // observer on body for position change

    if (opt.scrollbarid !== false) {
      this.id = opt.scrollbarid;
    } else {
      do {
        this.id = "ascrail" + (ascrailcounter++);
      } while (_doc.getElementById(this.id));
    }

    this.rail = false;
    this.cursor = false;
    this.cursorfreezed = false;
    this.selectiondrag = false;

    this.zoom = false;
    this.zoomactive = false;

    this.hasfocus = false;
    this.hasmousefocus = false;

    //this.visibility = true;
    this.railslocked = false;  // locked by resize
    this.locked = false;  // prevent lost of locked status sets by user
    this.hidden = false; // rails always hidden
    this.cursoractive = true; // user can interact with cursors

    this.wheelprevented = false; //prevent mousewheel event

    this.overflowx = opt.overflowx;
    this.overflowy = opt.overflowy;

    this.nativescrollingarea = false;
    this.checkarea = 0;

    this.events = []; // event list for unbind

    this.saved = {};  // style saved

    this.delaylist = {};
    this.synclist = {};

    this.lastdeltax = 0;
    this.lastdeltay = 0;

    this.detected = getBrowserDetection();

    var cap = $.extend({}, this.detected);

    this.canhwscroll = (cap.hastransform && opt.hwacceleration);
    this.ishwscroll = (this.canhwscroll && self.haswrapper);

    if (!this.isrtlmode) {
      this.hasreversehr = false;
    } else if (this.isvertical) { // RTL mode with reverse horizontal axis
      this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
    } else {
      this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
    }

    this.istouchcapable = false; // desktop devices with touch screen support

    //## Check WebKit-based desktop with touch support
    //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)

    if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) {  // desktop device with multiple input
      this.istouchcapable = true;
    } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
      this.istouchcapable = true;
    }

    //## disable MouseLock API on user request
    if (!opt.enablemouselockapi) {
      cap.hasmousecapture = false;
      cap.haspointerlock = false;
    }

    this.debounced = function (name, fn, tm) {
      if (!self) return;
      var dd = self.delaylist[name] || false;
      if (!dd) {
        self.delaylist[name] = {
          h: setAnimationFrame(function () {
            self.delaylist[name].fn.call(self);
            self.delaylist[name] = false;
          }, tm)
        };
        fn.call(self);
      }
      self.delaylist[name].fn = fn;
    };


    this.synched = function (name, fn) {
      if (self.synclist[name]) self.synclist[name] = fn;
      else {
        self.synclist[name] = fn;
        setAnimationFrame(function () {
          if (!self) return;
          self.synclist[name] && self.synclist[name].call(self);
          self.synclist[name] = null;
        });
      }
    };

    this.unsynched = function (name) {
      if (self.synclist[name]) self.synclist[name] = false;
    };

    this.css = function (el, pars) { // save & set
      for (var n in pars) {
        self.saved.css.push([el, n, el.css(n)]);
        el.css(n, pars[n]);
      }
    };

    this.scrollTop = function (val) {
      return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
    };

    this.scrollLeft = function (val) {
      return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
    };

    // derived by by Dan Pupius www.pupius.net
    var BezierClass = function (st, ed, spd, p1, p2, p3, p4) {

      this.st = st;
      this.ed = ed;
      this.spd = spd;

      this.p1 = p1 || 0;
      this.p2 = p2 || 1;
      this.p3 = p3 || 0;
      this.p4 = p4 || 1;

      this.ts = now();
      this.df = ed - st;
    };
    BezierClass.prototype = {
      B2: function (t) {
        return 3 * (1 - t) * (1 - t) * t;
      },
      B3: function (t) {
        return 3 * (1 - t) * t * t;
      },
      B4: function (t) {
        return t * t * t;
      },
      getPos: function () {
        return (now() - this.ts) / this.spd;
      },
      getNow: function () {
        var pc = (now() - this.ts) / this.spd;
        var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
        return (pc >= 1) ? this.ed : this.st + (this.df * bz) | 0;
      },
      update: function (ed, spd) {
        this.st = this.getNow();
        this.ed = ed;
        this.spd = spd;
        this.ts = now();
        this.df = this.ed - this.st;
        return this;
      }
    };

    //derived from http://stackoverflow.com/questions/11236090/
    function getMatrixValues() {
      var tr = self.doc.css(cap.trstyle);
      if (tr && (tr.substr(0, 6) == "matrix")) {
        return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
      }
      return false;
    }

    if (this.ishwscroll) {    // hw accelerated scroll

      this.doc.translate = {
        x: 0,
        y: 0,
        tx: "0px",
        ty: "0px"
      };

      //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
      if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/      

      this.getScrollTop = function (last) {
        if (!last) {
          var mtx = getMatrixValues();
          if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
          if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
        }
        return self.doc.translate.y;
      };

      this.getScrollLeft = function (last) {
        if (!last) {
          var mtx = getMatrixValues();
          if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
          if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
        }
        return self.doc.translate.x;
      };

      this.notifyScrollEvent = function (el) {
        var e = _doc.createEvent("UIEvents");
        e.initUIEvent("scroll", false, false, _win, 1);
        e.niceevent = true;
        el.dispatchEvent(e);
      };

      var cxscrollleft = (this.isrtlmode) ? 1 : -1;

      if (cap.hastranslate3d && opt.enabletranslate3d) {
        this.setScrollTop = function (val, silent) {
          self.doc.translate.y = val;
          self.doc.translate.ty = (val * -1) + "px";
          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
        this.setScrollLeft = function (val, silent) {
          self.doc.translate.x = val;
          self.doc.translate.tx = (val * cxscrollleft) + "px";
          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
      } else {
        this.setScrollTop = function (val, silent) {
          self.doc.translate.y = val;
          self.doc.translate.ty = (val * -1) + "px";
          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
        this.setScrollLeft = function (val, silent) {
          self.doc.translate.x = val;
          self.doc.translate.tx = (val * cxscrollleft) + "px";
          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
      }
    } else {    // native scroll

      this.getScrollTop = function () {
        return self.docscroll.scrollTop();
      };
      this.setScrollTop = function (val) {
        self.docscroll.scrollTop(val);
      };

      this.getScrollLeft = function () {
        var val;
        if (!self.hasreversehr) {
          val = self.docscroll.scrollLeft();
        } else if (self.detected.ismozilla) {
          val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
        } else {
          val = self.page.maxw - self.docscroll.scrollLeft();
        }
        return val;
      };
      this.setScrollLeft = function (val) {
        return setTimeout(function () {
          if (!self) return;
          if (self.hasreversehr) {
            if (self.detected.ismozilla) {
              val = -(self.page.maxw - val);
            } else {
              val = self.page.maxw - val;
            }
          }
          return self.docscroll.scrollLeft(val);
        }, 1);
      };
    }

    this.getTarget = function (e) {
      if (!e) return false;
      if (e.target) return e.target;
      if (e.srcElement) return e.srcElement;
      return false;
    };

    this.hasParent = function (e, id) {
      if (!e) return false;
      var el = e.target || e.srcElement || e || false;
      while (el && el.id != id) {
        el = el.parentNode || false;
      }
      return (el !== false);
    };

    function getZIndex() {
      var dom = self.win;
      if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
      while (dom.length > 0) {
        if (dom[0].nodeType == 9) return false;
        var zi = dom.css('zIndex');
        if (!isNaN(zi) && zi !== 0) return parseInt(zi);
        dom = dom.parent();
      }
      return false;
    }

    //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
    var _convertBorderWidth = {
      "thin": 1,
      "medium": 3,
      "thick": 5
    };

    function getWidthToPixel(dom, prop, chkheight) {
      var wd = dom.css(prop);
      var px = parseFloat(wd);
      if (isNaN(px)) {
        px = _convertBorderWidth[wd] || 0;
        var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
        if (self.isie8 && px) px += 1;
        return (brd) ? px : 0;
      }
      return px;
    }

    this.getDocumentScrollOffset = function () {
      return {
        top: _win.pageYOffset || _doc.documentElement.scrollTop,
        left: _win.pageXOffset || _doc.documentElement.scrollLeft
      };
    };

    this.getOffset = function () {
      if (self.isfixed) {
        var ofs = self.win.offset();  // fix Chrome auto issue (when right/bottom props only)
        var scrl = self.getDocumentScrollOffset();
        ofs.top -= scrl.top;
        ofs.left -= scrl.left;
        return ofs;
      }
      var ww = self.win.offset();
      if (!self.viewport) return ww;
      var vp = self.viewport.offset();
      return {
        top: ww.top - vp.top,
        left: ww.left - vp.left
      };
    };

    this.updateScrollBar = function (len) {
      var pos, off;
      if (self.ishwscroll) {
        self.rail.css({
          height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom)
        });
        if (self.railh) self.railh.css({
          width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right)
        });
      } else {
        var wpos = self.getOffset();
        pos = {
          top: wpos.top,
          left: wpos.left - (opt.railpadding.left + opt.railpadding.right)
        };
        pos.top += getWidthToPixel(self.win, 'border-top-width', true);
        pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');

        off = opt.railoffset;
        if (off) {
          if (off.top) pos.top += off.top;
          if (off.left) pos.left += off.left;
        }

        if (!self.railslocked) self.rail.css({
          top: pos.top,
          left: pos.left,
          height: ((len) ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom)
        });

        if (self.zoom) {
          self.zoom.css({
            top: pos.top + 1,
            left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
          });
        }

        if (self.railh && !self.railslocked) {
          pos = {
            top: wpos.top,
            left: wpos.left
          };
          off = opt.railhoffset;
          if (off) {
            if (off.top) pos.top += off.top;
            if (off.left) pos.left += off.left;
          }
          var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
          var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
          self.railh.css({
            top: y - (opt.railpadding.top + opt.railpadding.bottom),
            left: x,
            width: self.railh.width
          });
        }

      }
    };

    this.doRailClick = function (e, dbl, hr) {
      var fn, pg, cur, pos;

      if (self.railslocked) return;

      self.cancelEvent(e);

      if (!("pageY" in e)) {
        e.pageX = e.clientX + _doc.documentElement.scrollLeft;
        e.pageY = e.clientY + _doc.documentElement.scrollTop;
      }

      if (dbl) {
        fn = (hr) ? self.doScrollLeft : self.doScrollTop;
        cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
        self.unsynched("relativexy");
        fn(cur|0);
      } else {
        fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
        cur = (hr) ? self.scroll.x : self.scroll.y;
        pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
        pg = (hr) ? self.view.w : self.view.h;
        fn((cur >= pos) ? pg : -pg);
      }

    };

    self.newscrolly = self.newscrollx = 0;

    self.hasanimationframe = ("requestAnimationFrame" in _win);
    self.hascancelanimationframe = ("cancelAnimationFrame" in _win);

    self.hasborderbox = false;

    this.init = function () {

      self.saved.css = [];

      if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
      if (cap.isandroid && !("hidden" in _doc)) return true; // Android 3- SORRY, DO NOT WORK!

      opt.emulatetouch = opt.emulatetouch || opt.touchbehavior;  // mantain compatibility with "touchbehavior"      

      self.hasborderbox = _win.getComputedStyle && (_win.getComputedStyle(_doc.body)['box-sizing'] === "border-box");

      var _scrollyhidden = { 'overflow-y': 'hidden' };
      if (cap.isie11 || cap.isie10) _scrollyhidden['-ms-overflow-style'] = 'none';  // IE 10 & 11 is always a world apart!

      if (self.ishwscroll) {
        this.doc.css(cap.transitionstyle, cap.prefixstyle + 'transform 0ms ease-out');
        if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
      }

      self.zindex = "auto";
      if (!self.ispage && opt.zindex == "auto") {
        self.zindex = getZIndex() || "auto";
      } else {
        self.zindex = opt.zindex;
      }

      if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
        globalmaxzindex = self.zindex;
      }

      if (self.isie && self.zindex === 0 && opt.zindex == "auto") { // fix IE auto == 0
        self.zindex = "auto";
      }

      if (!self.ispage || !cap.isieold) {

        var cont = self.docscroll;
        if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;

        self.css(cont, _scrollyhidden);

        if (self.ispage && (cap.isie11 || cap.isie)) { // IE 7-11
          self.css($("html"), _scrollyhidden);
        }

        if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, {
          "-webkit-overflow-scrolling": "touch"
        }); //force hw acceleration

        var cursor = $(_doc.createElement('div'));
        cursor.css({
          position: "relative",
          top: 0,
          "float": "right",
          width: opt.cursorwidth,
          height: 0,
          'background-color': opt.cursorcolor,
          border: opt.cursorborder,
          'background-clip': 'padding-box',
          '-webkit-border-radius': opt.cursorborderradius,
          '-moz-border-radius': opt.cursorborderradius,
          'border-radius': opt.cursorborderradius
        });

        cursor.addClass('nicescroll-cursors');

        self.cursor = cursor;

        var rail = $(_doc.createElement('div'));
        rail.attr('id', self.id);
        rail.addClass('nicescroll-rails nicescroll-rails-vr');

        var v, a, kp = ["left", "right", "top", "bottom"];  //**
        for (var n in kp) {
          a = kp[n];
          v = opt.railpadding[a] || 0;
          v && rail.css("padding-" + a, v + "px");
        }

        rail.append(cursor);

        rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth());
        rail.css({
          width: rail.width + "px",
          zIndex: self.zindex,
          background: opt.background,
          cursor: "default"
        });

        rail.visibility = true;
        rail.scrollable = true;

        rail.align = (opt.railalign == "left") ? 0 : 1;

        self.rail = rail;

        self.rail.drag = false;

        var zoom = false;
        if (opt.boxzoom && !self.ispage && !cap.isieold) {
          zoom = _doc.createElement('div');

          self.bind(zoom, "click", self.doZoom);
          self.bind(zoom, "mouseenter", function () {
            self.zoom.css('opacity', opt.cursoropacitymax);
          });
          self.bind(zoom, "mouseleave", function () {
            self.zoom.css('opacity', opt.cursoropacitymin);
          });

          self.zoom = $(zoom);
          self.zoom.css({
            cursor: "pointer",
            zIndex: self.zindex,
            backgroundImage: 'url(' + opt.scriptpath + 'zoomico.png)',
            height: 18,
            width: 18,
            backgroundPosition: '0 0'
          });
          if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
          if (cap.cantouch && opt.gesturezoom) {
            self.ongesturezoom = function (e) {
              if (e.scale > 1.5) self.doZoomIn(e);
              if (e.scale < 0.8) self.doZoomOut(e);
              return self.cancelEvent(e);
            };
            self.bind(self.win, "gestureend", self.ongesturezoom);
          }
        }

        // init HORIZ

        self.railh = false;
        var railh;

        if (opt.horizrailenabled) {

          self.css(cont, {
            overflowX: 'hidden'
          });

          cursor = $(_doc.createElement('div'));
          cursor.css({
            position: "absolute",
            top: 0,
            height: opt.cursorwidth,
            width: 0,
            backgroundColor: opt.cursorcolor,
            border: opt.cursorborder,
            backgroundClip: 'padding-box',
            '-webkit-border-radius': opt.cursorborderradius,
            '-moz-border-radius': opt.cursorborderradius,
            'border-radius': opt.cursorborderradius
          });

          if (cap.isieold) cursor.css('overflow', 'hidden');  //IE6 horiz scrollbar issue

          cursor.addClass('nicescroll-cursors');

          self.cursorh = cursor;

          railh = $(_doc.createElement('div'));
          railh.attr('id', self.id + '-hr');
          railh.addClass('nicescroll-rails nicescroll-rails-hr');
          railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight());
          railh.css({
            height: railh.height + "px",
            'zIndex': self.zindex,
            "background": opt.background
          });

          railh.append(cursor);

          railh.visibility = true;
          railh.scrollable = true;

          railh.align = (opt.railvalign == "top") ? 0 : 1;

          self.railh = railh;

          self.railh.drag = false;

        }

        if (self.ispage) {

          rail.css({
            position: "fixed",
            top: 0,
            height: "100%"
          });

          rail.css((rail.align) ? { right: 0 } : { left: 0 });

          self.body.append(rail);
          if (self.railh) {
            railh.css({
              position: "fixed",
              left: 0,
              width: "100%"
            });

            railh.css((railh.align) ? { bottom: 0 } : { top: 0 });

            self.body.append(railh);
          }
        } else {
          if (self.ishwscroll) {
            if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' });
            var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
            $(bd).scrollTop(0).scrollLeft(0);  // fix rail position if content already scrolled
            if (self.zoom) {
              self.zoom.css({
                position: "absolute",
                top: 1,
                right: 0,
                "margin-right": rail.width + 4
              });
              bd.append(self.zoom);
            }
            rail.css({
              position: "absolute",
              top: 0
            });
            rail.css((rail.align) ? { right: 0 } : { left: 0 });
            bd.append(rail);
            if (railh) {
              railh.css({
                position: "absolute",
                left: 0,
                bottom: 0
              });
              railh.css((railh.align) ? { bottom: 0 } : { top: 0 });
              bd.append(railh);
            }
          } else {
            self.isfixed = (self.win.css("position") == "fixed");
            var rlpos = (self.isfixed) ? "fixed" : "absolute";

            if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
            if (self.viewport) {
              self.body = self.viewport;
              if (!(/fixed|absolute/.test(self.viewport.css("position")))) self.css(self.viewport, {
                "position": "relative"
              });
            }

            rail.css({
              position: rlpos
            });
            if (self.zoom) self.zoom.css({
              position: rlpos
            });
            self.updateScrollBar();
            self.body.append(rail);
            if (self.zoom) self.body.append(self.zoom);
            if (self.railh) {
              railh.css({
                position: rlpos
              });
              self.body.append(railh);
            }
          }

          if (cap.isios) self.css(self.win, {
            '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
            '-webkit-touch-callout': 'none'
          }); // prevent grey layer on click

          if (opt.disableoutline) {
            if (cap.isie) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
            if (cap.iswebkit) self.win.css('outline', 'none');  // Webkit outline
          }

        }

        if (opt.autohidemode === false) {
          self.autohidedom = false;
          self.rail.css({
            opacity: opt.cursoropacitymax
          });
          if (self.railh) self.railh.css({
            opacity: opt.cursoropacitymax
          });
        } else if ((opt.autohidemode === true) || (opt.autohidemode === "leave")) {
          self.autohidedom = $().add(self.rail);
          if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
          if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
        } else if (opt.autohidemode == "scroll") {
          self.autohidedom = $().add(self.rail);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
        } else if (opt.autohidemode == "cursor") {
          self.autohidedom = $().add(self.cursor);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
        } else if (opt.autohidemode == "hidden") {
          self.autohidedom = false;
          self.hide();
          self.railslocked = false;
        }

        if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) {

          self.scrollmom = new ScrollMomentumClass2D(self);

          var delayedclick = null;

          self.ontouchstart = function (e) {

            if (self.locked) return false;

            //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
            if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;  // need test on surface!!

            self.hasmoving = false;

            if (self.scrollmom.timer) {
              self.triggerScrollEnd();
              self.scrollmom.stop();
            }

            if (!self.railslocked) {
              var tg = self.getTarget(e);

              if (tg) {
                var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
                if (skp) return self.stopPropagation(e);
              }

              var ismouse = (e.type === "mousedown");

              if (!("clientX" in e) && ("changedTouches" in e)) {
                e.clientX = e.changedTouches[0].clientX;
                e.clientY = e.changedTouches[0].clientY;
              }

              if (self.forcescreen) {
                var le = e;
                e = {
                  "original": (e.original) ? e.original : e
                };
                e.clientX = le.screenX;
                e.clientY = le.screenY;
              }

              self.rail.drag = {
                x: e.clientX,
                y: e.clientY,
                sx: self.scroll.x,
                sy: self.scroll.y,
                st: self.getScrollTop(),
                sl: self.getScrollLeft(),
                pt: 2,
                dl: false,
                tg: tg
              };

              if (self.ispage || !opt.directionlockdeadzone) {

                self.rail.drag.dl = "f";

              } else {

                var view = {
                  w: $window.width(),
                  h: $window.height()
                };

                var page = self.getContentSize();

                var maxh = page.h - view.h;
                var maxw = page.w - view.w;

                if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
                else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
                else self.rail.drag.ck = false;

              }

              if (opt.emulatetouch && self.isiframe && cap.isie) {
                var wp = self.win.position();
                self.rail.drag.x += wp.left;
                self.rail.drag.y += wp.top;
              }

              self.hasmoving = false;
              self.lastmouseup = false;
              self.scrollmom.reset(e.clientX, e.clientY);

              if (tg&&ismouse) {

                var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName);
                if (!ip) {
                  if (cap.hasmousecapture) tg.setCapture();
                  if (opt.emulatetouch) {
                    if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
                      tg._onclick = tg.onclick;
                      tg.onclick = function (e) {
                        if (self.hasmoving) return false;
                        tg._onclick.call(this, e);
                      };
                    }
                    return self.cancelEvent(e);
                  }
                  return self.stopPropagation(e);
                }

                if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
                  self.preventclick = {
                    "tg": tg,
                    "click": false
                  };
                }

              }
            }

          };

          self.ontouchend = function (e) {

            if (!self.rail.drag) return true;

            if (self.rail.drag.pt == 2) {
              //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
              if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;

              self.rail.drag = false;

              var ismouse = (e.type === "mouseup");

              if (self.hasmoving) {
                self.scrollmom.doMomentum();
                self.lastmouseup = true;
                self.hideCursor();
                if (cap.hasmousecapture) _doc.releaseCapture();
                if (ismouse) return self.cancelEvent(e);
              }

            }
            else if (self.rail.drag.pt == 1) {
              return self.onmouseup(e);
            }

          };

          var moveneedoffset = (opt.emulatetouch && self.isiframe && !cap.hasmousecapture);

          var locktollerance = opt.directionlockdeadzone * 0.3 | 0;

          self.ontouchmove = function (e, byiframe) {

            if (!self.rail.drag) return true;

            if (e.targetTouches && opt.preventmultitouchscrolling) {
              if (e.targetTouches.length > 1) return true; // multitouch
            }

            //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
            if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true;

            if (self.rail.drag.pt == 2) {

              if (("changedTouches" in e)) {
                e.clientX = e.changedTouches[0].clientX;
                e.clientY = e.changedTouches[0].clientY;
              }

              var ofy, ofx;
              ofx = ofy = 0;

              if (moveneedoffset && !byiframe) {
                var wp = self.win.position();
                ofx = -wp.left;
                ofy = -wp.top;
              }

              var fy = e.clientY + ofy;
              var my = (fy - self.rail.drag.y);
              var fx = e.clientX + ofx;
              var mx = (fx - self.rail.drag.x);

              var ny = self.rail.drag.st - my;

              if (self.ishwscroll && opt.bouncescroll) {
                if (ny < 0) {
                  ny = Math.round(ny / 2);
                } else if (ny > self.page.maxh) {
                  ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
                }
              } else {
                if (ny < 0) {
                  ny = 0;
                  fy = 0;
                }
                else if (ny > self.page.maxh) {
                  ny = self.page.maxh;
                  fy = 0;
                }
                if (fy === 0 && !self.hasmoving) {
                  if (!self.ispage) self.rail.drag = false;
                  return true;
                }
              }

              var nx = self.getScrollLeft();

              if (self.railh && self.railh.scrollable) {
                nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;

                if (self.ishwscroll && opt.bouncescroll) {
                  if (nx < 0) {
                    nx = Math.round(nx / 2);
                  } else if (nx > self.page.maxw) {
                    nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
                  }
                } else {
                  if (nx < 0) {
                    nx = 0;
                    fx = 0;
                  }
                  if (nx > self.page.maxw) {
                    nx = self.page.maxw;
                    fx = 0;
                  }
                }

              }


              if (!self.hasmoving) {

                if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e);  // prevent first useless move event 

                var ay = Math.abs(my);
                var ax = Math.abs(mx);
                var dz = opt.directionlockdeadzone;

                if (!self.rail.drag.ck) {
                  if (ay > dz && ax > dz) self.rail.drag.dl = "f";
                  else if (ay > dz) self.rail.drag.dl = (ax > locktollerance) ? "f" : "v";
                  else if (ax > dz) self.rail.drag.dl = (ay > locktollerance) ? "f" : "h";
                }
                else if (self.rail.drag.ck == "v") {
                  if (ax > dz && ay <= locktollerance) {
                    self.rail.drag = false;
                  }
                  else if (ay > dz) self.rail.drag.dl = "v";

                }
                else if (self.rail.drag.ck == "h") {

                  if (ay > dz && ax <= locktollerance) {
                    self.rail.drag = false;
                  }
                  else if (ax > dz) self.rail.drag.dl = "h";

                }

                if (!self.rail.drag.dl) return self.cancelEvent(e);

                self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
                self.hasmoving = true;
              }

              if (self.preventclick && !self.preventclick.click) {
                self.preventclick.click = self.preventclick.tg.onclick || false;
                self.preventclick.tg.onclick = self.onpreventclick;
              }

              if (self.rail.drag.dl) {
                if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
                else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
              }

              self.synched("touchmove", function () {
                if (self.rail.drag && (self.rail.drag.pt == 2)) {
                  if (self.prepareTransition) self.resetTransition();
                  if (self.rail.scrollable) self.setScrollTop(ny);
                  self.scrollmom.update(fx, fy);
                  if (self.railh && self.railh.scrollable) {
                    self.setScrollLeft(nx);
                    self.showCursor(ny, nx);
                  } else {
                    self.showCursor(ny);
                  }
                  if (cap.isie10) _doc.selection.clear();
                }
              });

              return self.cancelEvent(e);

            }
            else if (self.rail.drag.pt == 1) { // drag on cursor
              return self.onmousemove(e);
            }

          };

          self.ontouchstartCursor = function (e, hronly) {
            if (self.rail.drag && self.rail.drag.pt != 3) return;
            if (self.locked) return self.cancelEvent(e);
            self.cancelScroll();
            self.rail.drag = {
              x: e.touches[0].clientX,
              y: e.touches[0].clientY,
              sx: self.scroll.x,
              sy: self.scroll.y,
              pt: 3,
              hr: (!!hronly)
            };
            var tg = self.getTarget(e);
            if (!self.ispage && cap.hasmousecapture) tg.setCapture();
            if (self.isiframe && !cap.hasmousecapture) {
              self.saved.csspointerevents = self.doc.css("pointer-events");
              self.css(self.doc, { "pointer-events": "none" });
            }
            return self.cancelEvent(e);
          };

          self.ontouchendCursor = function (e) {
            if (self.rail.drag) {
              if (cap.hasmousecapture) _doc.releaseCapture();
              if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
              if (self.rail.drag.pt != 3) return;
              self.rail.drag = false;
              return self.cancelEvent(e);
            }
          };

          self.ontouchmoveCursor = function (e) {
            if (self.rail.drag) {
              if (self.rail.drag.pt != 3) return;

              self.cursorfreezed = true;

              if (self.rail.drag.hr) {
                self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
                if (self.scroll.x < 0) self.scroll.x = 0;
                var mw = self.scrollvaluemaxw;
                if (self.scroll.x > mw) self.scroll.x = mw;
              } else {
                self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
                if (self.scroll.y < 0) self.scroll.y = 0;
                var my = self.scrollvaluemax;
                if (self.scroll.y > my) self.scroll.y = my;
              }

              self.synched('touchmove', function () {
                if (self.rail.drag && (self.rail.drag.pt == 3)) {
                  self.showCursor();
                  if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed);
                  else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed);
                }
              });

              return self.cancelEvent(e);
            }

          };

        }

        self.onmousedown = function (e, hronly) {
          if (self.rail.drag && self.rail.drag.pt != 1) return;
          if (self.railslocked) return self.cancelEvent(e);
          self.cancelScroll();
          self.rail.drag = {
            x: e.clientX,
            y: e.clientY,
            sx: self.scroll.x,
            sy: self.scroll.y,
            pt: 1,
            hr: hronly || false
          };
          var tg = self.getTarget(e);

          if (cap.hasmousecapture) tg.setCapture();
          if (self.isiframe && !cap.hasmousecapture) {
            self.saved.csspointerevents = self.doc.css("pointer-events");
            self.css(self.doc, {
              "pointer-events": "none"
            });
          }
          self.hasmoving = false;
          return self.cancelEvent(e);
        };

        self.onmouseup = function (e) {
          if (self.rail.drag) {
            if (self.rail.drag.pt != 1) return true;

            if (cap.hasmousecapture) _doc.releaseCapture();
            if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
            self.rail.drag = false;
            self.cursorfreezed = false;
            if (self.hasmoving) self.triggerScrollEnd();
            return self.cancelEvent(e);
          }
        };

        self.onmousemove = function (e) {
          if (self.rail.drag) {
            if (self.rail.drag.pt !== 1) return;

            if (cap.ischrome && e.which === 0) return self.onmouseup(e);

            self.cursorfreezed = true;

            if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);

            self.hasmoving = true;

            if (self.rail.drag.hr) {
              self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
              if (self.scroll.x < 0) self.scroll.x = 0;
              var mw = self.scrollvaluemaxw;
              if (self.scroll.x > mw) self.scroll.x = mw;
            } else {
              self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
              if (self.scroll.y < 0) self.scroll.y = 0;
              var my = self.scrollvaluemax;
              if (self.scroll.y > my) self.scroll.y = my;
            }

            self.synched('mousemove', function () {

              if (self.cursorfreezed) {
                self.showCursor();

                if (self.rail.drag.hr) {
                  self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x));
                } else {
                  self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y));
                }

              }
            });

            return self.cancelEvent(e);
          }
          else {
            self.checkarea = 0;
          }
        };

        if (cap.cantouch || opt.emulatetouch) {

          self.onpreventclick = function (e) {
            if (self.preventclick) {
              self.preventclick.tg.onclick = self.preventclick.click;
              self.preventclick = false;
              return self.cancelEvent(e);
            }
          };

          self.onclick = (cap.isios) ? false : function (e) {  // it needs to check IE11 ???
            if (self.lastmouseup) {
              self.lastmouseup = false;
              return self.cancelEvent(e);
            } else {
              return true;
            }
          };

          if (opt.grabcursorenabled && cap.cursorgrabvalue) {
            self.css((self.ispage) ? self.doc : self.win, {
              'cursor': cap.cursorgrabvalue
            });
            self.css(self.rail, {
              'cursor': cap.cursorgrabvalue
            });
          }

        } else {

          var checkSelectionScroll = function (e) {
            if (!self.selectiondrag) return;

            if (e) {
              var ww = self.win.outerHeight();
              var df = (e.pageY - self.selectiondrag.top);
              if (df > 0 && df < ww) df = 0;
              if (df >= ww) df -= ww;
              self.selectiondrag.df = df;
            }
            if (self.selectiondrag.df === 0) return;

            var rt = -(self.selectiondrag.df*2/6)|0;
            self.doScrollBy(rt);

            self.debounced("doselectionscroll", function () {
              checkSelectionScroll();
            }, 50);
          };

          if ("getSelection" in _doc) { // A grade - Major browsers
            self.hasTextSelected = function () {
              return (_doc.getSelection().rangeCount > 0);
            };
          } else if ("selection" in _doc) { //IE9-
            self.hasTextSelected = function () {
              return (_doc.selection.type != "None");
            };
          } else {
            self.hasTextSelected = function () { // no support
              return false;
            };
          }

          self.onselectionstart = function (e) {
            //  More testing - severe chrome issues           
            /* 
                          if (!self.haswrapper&&(e.which&&e.which==2)) {  // fool browser to manage middle button scrolling
                            self.win.css({'overflow':'auto'});
                            setTimeout(function(){
                              self.win.css({'overflow':'hidden'});
                            },10);                
                            return true;
                          }            
            */
            if (self.ispage) return;
            self.selectiondrag = self.win.offset();
          };

          self.onselectionend = function (e) {
            self.selectiondrag = false;
          };
          self.onselectiondrag = function (e) {
            if (!self.selectiondrag) return;
            if (self.hasTextSelected()) self.debounced("selectionscroll", function () {
              checkSelectionScroll(e);
            }, 250);
          };
        }

        if (cap.hasw3ctouch) { //IE11+
          self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
          self.css(self.rail, {
            'touch-action': 'none'
          });
          self.css(self.cursor, {
            'touch-action': 'none'
          });
          self.bind(self.win, "pointerdown", self.ontouchstart);
          self.bind(_doc, "pointerup", self.ontouchend);
          self.delegate(_doc, "pointermove", self.ontouchmove);
        } else if (cap.hasmstouch) { //IE10
          self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
          self.css(self.rail, {
            '-ms-touch-action': 'none'
          });
          self.css(self.cursor, {
            '-ms-touch-action': 'none'
          });
          self.bind(self.win, "MSPointerDown", self.ontouchstart);
          self.bind(_doc, "MSPointerUp", self.ontouchend);
          self.delegate(_doc, "MSPointerMove", self.ontouchmove);
          self.bind(self.cursor, "MSGestureHold", function (e) {
            e.preventDefault();
          });
          self.bind(self.cursor, "contextmenu", function (e) {
            e.preventDefault();
          });
        } else if (cap.cantouch) { // smartphones/touch devices
          self.bind(self.win, "touchstart", self.ontouchstart, false, true);
          self.bind(_doc, "touchend", self.ontouchend, false, true);
          self.bind(_doc, "touchcancel", self.ontouchend, false, true);
          self.delegate(_doc, "touchmove", self.ontouchmove, false, true);
        }

        if (opt.emulatetouch) {
          self.bind(self.win, "mousedown", self.ontouchstart, false, true);
          self.bind(_doc, "mouseup", self.ontouchend, false, true);
          self.bind(_doc, "mousemove", self.ontouchmove, false, true);
        }

        if (opt.cursordragontouch || (!cap.cantouch && !opt.emulatetouch)) {

          self.rail.css({
            cursor: "default"
          });
          self.railh && self.railh.css({
            cursor: "default"
          });

          self.jqbind(self.rail, "mouseenter", function () {
            if (!self.ispage && !self.win.is(":visible")) return false;
            if (self.canshowonmouseevent) self.showCursor();
            self.rail.active = true;
          });
          self.jqbind(self.rail, "mouseleave", function () {
            self.rail.active = false;
            if (!self.rail.drag) self.hideCursor();
          });

          if (opt.sensitiverail) {
            self.bind(self.rail, "click", function (e) {
              self.doRailClick(e, false, false);
            });
            self.bind(self.rail, "dblclick", function (e) {
              self.doRailClick(e, true, false);
            });
            self.bind(self.cursor, "click", function (e) {
              self.cancelEvent(e);
            });
            self.bind(self.cursor, "dblclick", function (e) {
              self.cancelEvent(e);
            });
          }

          if (self.railh) {
            self.jqbind(self.railh, "mouseenter", function () {
              if (!self.ispage && !self.win.is(":visible")) return false;
              if (self.canshowonmouseevent) self.showCursor();
              self.rail.active = true;
            });
            self.jqbind(self.railh, "mouseleave", function () {
              self.rail.active = false;
              if (!self.rail.drag) self.hideCursor();
            });

            if (opt.sensitiverail) {
              self.bind(self.railh, "click", function (e) {
                self.doRailClick(e, false, true);
              });
              self.bind(self.railh, "dblclick", function (e) {
                self.doRailClick(e, true, true);
              });
              self.bind(self.cursorh, "click", function (e) {
                self.cancelEvent(e);
              });
              self.bind(self.cursorh, "dblclick", function (e) {
                self.cancelEvent(e);
              });
            }

          }

        }

        if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
          self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
          self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
          self.bind(self.cursor, "touchend", self.ontouchendCursor);
          self.cursorh && self.bind(self.cursorh, "touchstart", function (e) {
            self.ontouchstartCursor(e, true);
          });
          self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
          self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
        }

//        if (!cap.cantouch && !opt.emulatetouch) {
        if (!opt.emulatetouch && !cap.isandroid && !cap.isios) {

          self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.onmouseup);
          self.bind(_doc, "mousemove", self.onmousemove);
          if (self.onclick) self.bind(_doc, "click", self.onclick);

          self.bind(self.cursor, "mousedown", self.onmousedown);
          self.bind(self.cursor, "mouseup", self.onmouseup);

          if (self.railh) {
            self.bind(self.cursorh, "mousedown", function (e) {
              self.onmousedown(e, true);
            });
            self.bind(self.cursorh, "mouseup", self.onmouseup);
          }

          if (!self.ispage && opt.enablescrollonselection) {
            self.bind(self.win[0], "mousedown", self.onselectionstart);
            self.bind(_doc, "mouseup", self.onselectionend);
            self.bind(self.cursor, "mouseup", self.onselectionend);
            if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
            self.bind(_doc, "mousemove", self.onselectiondrag);
          }

          if (self.zoom) {
            self.jqbind(self.zoom, "mouseenter", function () {
              if (self.canshowonmouseevent) self.showCursor();
              self.rail.active = true;
            });
            self.jqbind(self.zoom, "mouseleave", function () {
              self.rail.active = false;
              if (!self.rail.drag) self.hideCursor();
            });
          }

        } else {

          self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.ontouchend);
          if (self.onclick) self.bind(_doc, "click", self.onclick);

          if (opt.cursordragontouch) {
            self.bind(self.cursor, "mousedown", self.onmousedown);
            self.bind(self.cursor, "mouseup", self.onmouseup);
            self.cursorh && self.bind(self.cursorh, "mousedown", function (e) {
              self.onmousedown(e, true);
            });
            self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
          } else {
            self.bind(self.rail, "mousedown", function (e) { e.preventDefault(); });  // prevent text selection             
            self.railh && self.bind(self.railh, "mousedown", function (e) { e.preventDefault(); });
          }

        }


        if (opt.enablemousewheel) {
          if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? _doc : self.win, self.onmousewheel);
          self.mousewheel(self.rail, self.onmousewheel);
          if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
        }

        if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
          if (!self.win.attr("tabindex")) self.win.attr({
            "tabindex": ++tabindexcounter
          });

          self.bind(self.win, "focus", function (e) {  // better using native events
            domfocus = (self.getTarget(e)).id || self.getTarget(e) || false;
            self.hasfocus = true;
            if (self.canshowonmouseevent) self.noticeCursor();
          });
          self.bind(self.win, "blur", function (e) {  // *
            domfocus = false;
            self.hasfocus = false;
          });

          self.bind(self.win, "mouseenter", function (e) {   // *
            mousefocus = (self.getTarget(e)).id || self.getTarget(e) || false;
            self.hasmousefocus = true;
            if (self.canshowonmouseevent) self.noticeCursor();
          });
          self.bind(self.win, "mouseleave", function (e) {   // *       
            mousefocus = false;
            self.hasmousefocus = false;
            if (!self.rail.drag) self.hideCursor();
          });

        }


        //Thanks to http://www.quirksmode.org !!
        self.onkeypress = function (e) {
          if (self.railslocked && self.page.maxh === 0) return true;

          e = e || _win.event;
          var tg = self.getTarget(e);
          if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
            var tp = tg.getAttribute('type') || tg.type || false;
            if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
          }

          if ($(tg).attr('contenteditable')) return true;

          if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
            var key = e.keyCode;

            if (self.railslocked && key != 27) return self.cancelEvent(e);

            var ctrl = e.ctrlKey || false;
            var shift = e.shiftKey || false;

            var ret = false;
            switch (key) {
              case 38:
              case 63233: //safari
                self.doScrollBy(24 * 3);
                ret = true;
                break;
              case 40:
              case 63235: //safari
                self.doScrollBy(-24 * 3);
                ret = true;
                break;
              case 37:
              case 63232: //safari
                if (self.railh) {
                  (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3);
                  ret = true;
                }
                break;
              case 39:
              case 63234: //safari
                if (self.railh) {
                  (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3);
                  ret = true;
                }
                break;
              case 33:
              case 63276: // safari
                self.doScrollBy(self.view.h);
                ret = true;
                break;
              case 34:
              case 63277: // safari
                self.doScrollBy(-self.view.h);
                ret = true;
                break;
              case 36:
              case 63273: // safari                
                (self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0);
                ret = true;
                break;
              case 35:
              case 63275: // safari
                (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh);
                ret = true;
                break;
              case 32:
                if (opt.spacebarenabled) {
                  (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
                  ret = true;
                }
                break;
              case 27: // ESC
                if (self.zoomactive) {
                  self.doZoom();
                  ret = true;
                }
                break;
            }
            if (ret) return self.cancelEvent(e);
          }
        };

        if (opt.enablekeyboard) self.bind(_doc, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);

        self.bind(_doc, "keydown", function (e) {
          var ctrl = e.ctrlKey || false;
          if (ctrl) self.wheelprevented = true;
        });
        self.bind(_doc, "keyup", function (e) {
          var ctrl = e.ctrlKey || false;
          if (!ctrl) self.wheelprevented = false;
        });
        self.bind(_win, "blur", function (e) {
          self.wheelprevented = false;
        });

        self.bind(_win, 'resize', self.onscreenresize);
        self.bind(_win, 'orientationchange', self.onscreenresize);

        self.bind(_win, "load", self.lazyResize);

        if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
          var tmp = self.win.attr("style");
          var ww = parseFloat(self.win.css("width")) + 1;
          self.win.css('width', ww);
          self.synched("chromefix", function () {
            self.win.attr("style", tmp);
          });
        }


        // Trying a cross-browser implementation - good luck!

        self.onAttributeChange = function (e) {
          self.lazyResize(self.isieold ? 250 : 30);
        };

        if (opt.enableobserver) {

          if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
            self.observerbody = new ClsMutationObserver(function (mutations) {
              mutations.forEach(function (mut) {
                if (mut.type == "attributes") {
                  return ($body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0], self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
                }
              });
              if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30);
            });
            self.observerbody.observe(_doc.body, {
              childList: true,
              subtree: true,
              characterData: false,
              attributes: true,
              attributeFilter: ['class']
            });
          }

          if (!self.ispage && !self.haswrapper) {

            var _dom = self.win[0];

            // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
            if (ClsMutationObserver !== false) {
              self.observer = new ClsMutationObserver(function (mutations) {
                mutations.forEach(self.onAttributeChange);
              });
              self.observer.observe(_dom, {
                childList: true,
                characterData: false,
                attributes: true,
                subtree: false
              });
              self.observerremover = new ClsMutationObserver(function (mutations) {
                mutations.forEach(function (mo) {
                  if (mo.removedNodes.length > 0) {
                    for (var dd in mo.removedNodes) {
                      if (!!self && (mo.removedNodes[dd] === _dom)) return self.remove();
                    }
                  }
                });
              });
              self.observerremover.observe(_dom.parentNode, {
                childList: true,
                characterData: false,
                attributes: false,
                subtree: false
              });
            } else {
              self.bind(_dom, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
              if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
              self.bind(_dom, "DOMNodeRemoved", function (e) {
                if (e.target === _dom) self.remove();
              });
            }
          }

        }

        //

        if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom);
        if (self.istextarea) {
          self.bind(self.win, "keydown", self.lazyResize);
          self.bind(self.win, "mouseup", self.lazyResize);
        }

        self.lazyResize(30);

      }

      if (this.doc[0].nodeName == 'IFRAME') {
        var oniframeload = function () {
          self.iframexd = false;
          var doc;
          try {
            doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow._doc;
            var a = doc.domain;
          } catch (e) {
            self.iframexd = true;
            doc = false;
          }

          if (self.iframexd) {
            if ("console" in _win) console.log('NiceScroll error: policy restriced iframe');
            return true; //cross-domain - I can't manage this        
          }

          self.forcescreen = true;

          if (self.isiframe) {
            self.iframe = {
              "doc": $(doc),
              "html": self.doc.contents().find('html')[0],
              "body": self.doc.contents().find('body')[0]
            };
            self.getContentSize = function () {
              return {
                w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
                h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
              };
            };
            self.docscroll = $(self.iframe.body);
          }

          if (!cap.isios && opt.iframeautoresize && !self.isiframe) {
            self.win.scrollTop(0); // reset position
            self.doc.height(""); //reset height to fix browser bug
            var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
            self.doc.height(hh);
          }
          self.lazyResize(30);

          self.css($(self.iframe.body), _scrollyhidden);

          if (cap.isios && self.haswrapper) {
            self.css($(doc.body), {
              '-webkit-transform': 'translate3d(0,0,0)'
            }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
          }

          if ('contentWindow' in this) {
            self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
          } else {
            self.bind(doc, "scroll", self.onscroll);
          }

          if (opt.enablemousewheel) {
            self.mousewheel(doc, self.onmousewheel);
          }

          if (opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);

          if (cap.cantouch) {
            self.bind(doc, "touchstart", self.ontouchstart);
            self.bind(doc, "touchmove", self.ontouchmove);
          }
          else if (opt.emulatetouch) {
            self.bind(doc, "mousedown", self.ontouchstart);
            self.bind(doc, "mousemove", function (e) {
              return self.ontouchmove(e, true);
            });
            if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
              'cursor': cap.cursorgrabvalue
            });
          }

          self.bind(doc, "mouseup", self.ontouchend);

          if (self.zoom) {
            if (opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
            if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
          }
        };

        if (this.doc[0].readyState && this.doc[0].readyState === "complete") {
          setTimeout(function () {
            oniframeload.call(self.doc[0], false);
          }, 500);
        }
        self.bind(this.doc, "load", oniframeload);

      }

    };

    this.showCursor = function (py, px) {
      if (self.cursortimeout) {
        clearTimeout(self.cursortimeout);
        self.cursortimeout = 0;
      }
      if (!self.rail) return;
      if (self.autohidedom) {
        self.autohidedom.stop().css({
          opacity: opt.cursoropacitymax
        });
        self.cursoractive = true;
      }

      if (!self.rail.drag || self.rail.drag.pt != 1) {
        if (py !== undefined && py !== false) {
          self.scroll.y = (py / self.scrollratio.y) | 0;
        }
        if (px !== undefined) {
          self.scroll.x = (px / self.scrollratio.x) | 0;
        }
      }

      self.cursor.css({
        height: self.cursorheight,
        top: self.scroll.y
      });
      if (self.cursorh) {
        var lx = (self.hasreversehr) ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x;
        self.cursorh.css({
          width: self.cursorwidth,
          left: (!self.rail.align && self.rail.visibility) ? lx + self.rail.width : lx
        });
        self.cursoractive = true;
      }

      if (self.zoom) self.zoom.stop().css({
        opacity: opt.cursoropacitymax
      });
    };

    this.hideCursor = function (tm) {
      if (self.cursortimeout) return;
      if (!self.rail) return;
      if (!self.autohidedom) return;

      if (self.hasmousefocus && opt.autohidemode === "leave") return;
      self.cursortimeout = setTimeout(function () {
        if (!self.rail.active || !self.showonmouseevent) {
          self.autohidedom.stop().animate({
            opacity: opt.cursoropacitymin
          });
          if (self.zoom) self.zoom.stop().animate({
            opacity: opt.cursoropacitymin
          });
          self.cursoractive = false;
        }
        self.cursortimeout = 0;
      }, tm || opt.hidecursordelay);
    };

    this.noticeCursor = function (tm, py, px) {
      self.showCursor(py, px);
      if (!self.rail.active) self.hideCursor(tm);
    };

    this.getContentSize =
      (self.ispage) ?
        function () {
          return {
            w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth),
            h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight)
          };
        } : (self.haswrapper) ?
          function () {
            return {
              w: self.doc[0].offsetWidth,
              h: self.doc[0].offsetHeight
            };
          } : function () {
            return {
              w: self.docscroll[0].scrollWidth,
              h: self.docscroll[0].scrollHeight
            };
          };

    this.onResize = function (e, page) {

      if (!self || !self.win) return false;

      var premaxh = self.page.maxh,
          premaxw = self.page.maxw,
          previewh = self.view.h,
          previeww = self.view.w;

      self.view = {
        w: (self.ispage) ? self.win.width() : self.win[0].clientWidth,
        h: (self.ispage) ? self.win.height() : self.win[0].clientHeight
      };

      self.page = (page) ? page : self.getContentSize();

      self.page.maxh = Math.max(0, self.page.h - self.view.h);
      self.page.maxw = Math.max(0, self.page.w - self.view.w);

      if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == previeww) && (self.view.h == previewh)) {
        // test position        
        if (!self.ispage) {
          var pos = self.win.offset();
          if (self.lastposition) {
            var lst = self.lastposition;
            if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do            
          }
          self.lastposition = pos;
        } else {
          return self; //nothing to do
        }
      }

      if (self.page.maxh === 0) {
        self.hideRail();
        self.scrollvaluemax = 0;
        self.scroll.y = 0;
        self.scrollratio.y = 0;
        self.cursorheight = 0;
        self.setScrollTop(0);
        if (self.rail) self.rail.scrollable = false;
      } else {
        self.page.maxh -= (opt.railpadding.top + opt.railpadding.bottom);
        self.rail.scrollable = true;
      }

      if (self.page.maxw === 0) {
        self.hideRailHr();
        self.scrollvaluemaxw = 0;
        self.scroll.x = 0;
        self.scrollratio.x = 0;
        self.cursorwidth = 0;
        self.setScrollLeft(0);
        if (self.railh) {
          self.railh.scrollable = false;
        }
      } else {
        self.page.maxw -= (opt.railpadding.left + opt.railpadding.right);
        if (self.railh) self.railh.scrollable = (opt.horizrailenabled);
      }

      self.railslocked = (self.locked) || ((self.page.maxh === 0) && (self.page.maxw === 0));
      if (self.railslocked) {
        if (!self.ispage) self.updateScrollBar(self.view);
        return false;
      }

      if (!self.hidden) {
        if (!self.rail.visibility) self.showRail();
        if (self.railh && !self.railh.visibility) self.showRailHr();
      }

      if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;

      self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
      self.cursorheight = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight);

      self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
      self.cursorwidth = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth);

      self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom);
      if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight;

      if (self.railh) {
        self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
        self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right);
      }

      if (!self.ispage) self.updateScrollBar(self.view);

      self.scrollratio = {
        x: (self.page.maxw / self.scrollvaluemaxw),
        y: (self.page.maxh / self.scrollvaluemax)
      };

      var sy = self.getScrollTop();
      if (sy > self.page.maxh) {
        self.doScrollTop(self.page.maxh);
      } else {
        self.scroll.y = (self.getScrollTop() / self.scrollratio.y) | 0;
        self.scroll.x = (self.getScrollLeft() / self.scrollratio.x) | 0;
        if (self.cursoractive) self.noticeCursor();
      }

      if (self.scroll.y && (self.getScrollTop() === 0)) self.doScrollTo((self.scroll.y * self.scrollratio.y)|0);

      return self;
    };

    this.resize = self.onResize;

    var hlazyresize = 0;

    this.onscreenresize = function(e) {
      clearTimeout(hlazyresize);

      var hiderails = (!self.ispage && !self.haswrapper);
      if (hiderails) self.hideRails();

      hlazyresize = setTimeout(function () {
        if (self) {
          if (hiderails) self.showRails();
          self.resize();
        }
        hlazyresize=0;
      }, 120);
    };

    this.lazyResize = function (tm) { // event debounce

      clearTimeout(hlazyresize);

      tm = isNaN(tm) ? 240 : tm;

      hlazyresize = setTimeout(function () {
        self && self.resize();
        hlazyresize=0;
      }, tm);

      return self;

    };

    // derived by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
    function _modernWheelEvent(dom, name, fn, bubble) {
      self._bind(dom, name, function (e) {
        e = e || _win.event;
        var event = {
          original: e,
          target: e.target || e.srcElement,
          type: "wheel",
          deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
          deltaX: 0,
          deltaZ: 0,
          preventDefault: function () {
            e.preventDefault ? e.preventDefault() : e.returnValue = false;
            return false;
          },
          stopImmediatePropagation: function () {
            (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;
          }
        };

        if (name == "mousewheel") {
          e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
          e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
          !event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
        } else {
          event.deltaY = e.detail;
        }

        return fn.call(dom, event);
      }, bubble);
    }



    this.jqbind = function (dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
      self.events.push({
        e: dom,
        n: name,
        f: fn,
        q: true
      });
      $(dom).on(name, fn);
    };

    this.mousewheel = function (dom, fn, bubble) { // bind mousewheel
      var el = ("jquery" in dom) ? dom[0] : dom;
      if ("onwheel" in _doc.createElement("div")) { // Modern browsers support "wheel"
        self._bind(el, "wheel", fn, bubble || false);
      } else {
        var wname = (_doc.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox          
        _modernWheelEvent(el, wname, fn, bubble || false);
        if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
      }
    };

    var passiveSupported = false;

    if (cap.haseventlistener) {  // W3C standard event model

      // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
      try { var options = Object.defineProperty({}, "passive", { get: function () { passiveSupported = !0; } }); _win.addEventListener("test", null, options); } catch (err) { }

      this.stopPropagation = function (e) {
        if (!e) return false;
        e = (e.original) ? e.original : e;
        e.stopPropagation();
        return false;
      };

      this.cancelEvent = function(e) {
        if (e.cancelable) e.preventDefault();
        e.stopImmediatePropagation();
        if (e.preventManipulation) e.preventManipulation();  // IE10+
        return false;
      };      

    } else {

      // inspired from https://gist.github.com/jonathantneal/2415137      

      Event.prototype.preventDefault = function () {
        this.returnValue = false;
      };

      Event.prototype.stopPropagation = function () {
        this.cancelBubble = true;
      };

      _win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function (type, listener, useCapture) {
        this.attachEvent("on" + type, listener);
      };
      _win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function (type, listener, useCapture) {
        this.detachEvent("on" + type, listener);
      };

      // Thanks to http://www.switchonthecode.com !!
      this.cancelEvent = function (e) {
        e = e || _win.event;
        if (e) {          
          e.cancelBubble = true;
          e.cancel = true;
          e.returnValue = false;
        }  
        return false;
      };

      this.stopPropagation = function (e) {
        e = e || _win.event;
        if (e) e.cancelBubble = true;
        return false;
      };

    }

    this.delegate = function (dom, name, fn, bubble, active) {

      var de = delegatevents[name] || false;

      if (!de) {

        de = {
          a: [],
          l: [],
          f: function (e) {
            var lst = de.l, l = lst.length - 1;
            var r = false;
            for (var a = l; a >= 0; a--) {
              r = lst[a].call(e.target, e);
              if (r === false) return false;
            }
            return r;
          }
        };

        self.bind(dom, name, de.f, bubble, active);

        delegatevents[name] = de;

      }

      if (self.ispage) {
        de.a = [self.id].concat(de.a);
        de.l = [fn].concat(de.l);
      } else {
        de.a.push(self.id);
        de.l.push(fn);        
      }

    };

    this.undelegate = function (dom, name, fn, bubble, active) {
      var de = delegatevents[name]||false;
      if (de&&de.l) {  // quick fix #683
        for (var a=0,l=de.l.length;a<l;a++) {
          if (de.a[a] === self.id) {
            de.a.splice(a);
            de.l.splice(a);
            if (de.a.length===0) {
              self._unbind(dom,name,de.l.f);
              delegatevents[name] = null;
            }
          }
        }
      }
    };

    this.bind = function (dom, name, fn, bubble, active) {
      var el = ("jquery" in dom) ? dom[0] : dom;
      self._bind(el, name, fn, bubble || false, active || false);
    };

    this._bind = function (el, name, fn, bubble, active) { // primitive bind

      self.events.push({
        e: el,
        n: name,
        f: fn,
        b: bubble,
        q: false
      });

      (passiveSupported && active) ? el.addEventListener(name, fn, { passive: false, capture: bubble }) : el.addEventListener(name, fn, bubble || false);
    };

    this._unbind = function (el, name, fn, bub) { // primitive unbind
      if (delegatevents[name]) self.undelegate(el, name, fn, bub);
      else el.removeEventListener(name, fn, bub);
    };

    this.unbindAll = function () {
      for (var a = 0; a < self.events.length; a++) {
        var r = self.events[a];
        (r.q) ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b);
      }
    };

    this.showRails = function () {
      return self.showRail().showRailHr();
    };

    this.showRail = function () {
      if ((self.page.maxh !== 0) && (self.ispage || self.win.css('display') != 'none')) {
        //self.visibility = true;
        self.rail.visibility = true;
        self.rail.css('display', 'block');
      }
      return self;
    };

    this.showRailHr = function () {
      if (self.railh) {
        if ((self.page.maxw !== 0) && (self.ispage || self.win.css('display') != 'none')) {
          self.railh.visibility = true;
          self.railh.css('display', 'block');
        }
      }
      return self;
    };

    this.hideRails = function () {
      return self.hideRail().hideRailHr();
    };

    this.hideRail = function () {
      //self.visibility = false;
      self.rail.visibility = false;
      self.rail.css('display', 'none');
      return self;
    };

    this.hideRailHr = function () {
      if (self.railh) {
        self.railh.visibility = false;
        self.railh.css('display', 'none');
      }
      return self;
    };

    this.show = function () {
      self.hidden = false;
      self.railslocked = false;
      return self.showRails();
    };

    this.hide = function () {
      self.hidden = true;
      self.railslocked = true;
      return self.hideRails();
    };

    this.toggle = function () {
      return (self.hidden) ? self.show() : self.hide();
    };

    this.remove = function () {
      self.stop();
      if (self.cursortimeout) clearTimeout(self.cursortimeout);
      for (var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
      self.doZoomOut();
      self.unbindAll();

      if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug

      if (self.observer !== false) self.observer.disconnect();
      if (self.observerremover !== false) self.observerremover.disconnect();
      if (self.observerbody !== false) self.observerbody.disconnect();

      self.events = null;

      if (self.cursor) {
        self.cursor.remove();
      }
      if (self.cursorh) {
        self.cursorh.remove();
      }
      if (self.rail) {
        self.rail.remove();
      }
      if (self.railh) {
        self.railh.remove();
      }
      if (self.zoom) {
        self.zoom.remove();
      }
      for (var a = 0; a < self.saved.css.length; a++) {
        var d = self.saved.css[a];
        d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
      }
      self.saved = false;
      self.me.data('__nicescroll', ''); //erase all traces

      // memory leak fixed by GianlucaGuarini - thanks a lot!
      // remove the current nicescroll from the $.nicescroll array & normalize array
      var lst = $.nicescroll;
      lst.each(function (i) {
        if (!this) return;
        if (this.id === self.id) {
          delete lst[i];
          for (var b = ++i; b < lst.length; b++ , i++) lst[i] = lst[b];
          lst.length--;
          if (lst.length) delete lst[lst.length];
        }
      });

      for (var i in self) {
        self[i] = null;
        delete self[i];
      }

      self = null;

    };

    this.scrollstart = function (fn) {
      this.onscrollstart = fn;
      return self;
    };
    this.scrollend = function (fn) {
      this.onscrollend = fn;
      return self;
    };
    this.scrollcancel = function (fn) {
      this.onscrollcancel = fn;
      return self;
    };

    this.zoomin = function (fn) {
      this.onzoomin = fn;
      return self;
    };
    this.zoomout = function (fn) {
      this.onzoomout = fn;
      return self;
    };

    this.isScrollable = function (e) {
      var dom = (e.target) ? e.target : e;
      if (dom.nodeName == 'OPTION') return true;
      while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) {
        var dd = $(dom);
        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
        if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
        dom = (dom.parentNode) ? dom.parentNode : false;
      }
      return false;
    };

    this.getViewport = function (me) {
      var dom = (me && me.parentNode) ? me.parentNode : false;
      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
        var dd = $(dom);
        if (/fixed|absolute/.test(dd.css("position"))) return dd;
        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
        if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
        if (dd.getNiceScroll().length > 0) return dd;
        dom = (dom.parentNode) ? dom.parentNode : false;
      }
      return false;
    };

    this.triggerScrollStart = function (cx, cy, rx, ry, ms) {

      if (self.onscrollstart) {
        var info = {
          type: "scrollstart",
          current: {
            x: cx,
            y: cy
          },
          request: {
            x: rx,
            y: ry
          },
          end: {
            x: self.newscrollx,
            y: self.newscrolly
          },
          speed: ms
        };
        self.onscrollstart.call(self, info);
      }

    };

    this.triggerScrollEnd = function () {
      if (self.onscrollend) {

        var px = self.getScrollLeft();
        var py = self.getScrollTop();

        var info = {
          type: "scrollend",
          current: {
            x: px,
            y: py
          },
          end: {
            x: px,
            y: py
          }
        };

        self.onscrollend.call(self, info);

      }

    };

    var scrolldiry = 0, scrolldirx = 0, scrolltmr = 0, scrollspd = 1;

    function doScrollRelative(px, py, chkscroll, iswheel) {

      if (!self.scrollrunning) {
        self.newscrolly = self.getScrollTop();
        self.newscrollx = self.getScrollLeft();
        scrolltmr = now();
      }

      var gap = (now() - scrolltmr);
      scrolltmr = now();

      if (gap > 350) {
        scrollspd = 1;
      } else {
        scrollspd += (2 - scrollspd) / 10;
      }

      px = px * scrollspd | 0;
      py = py * scrollspd | 0;

      if (px) {

        if (iswheel) { // mouse-only
          if (px < 0) {  // fix apple magic mouse swipe back/forward
            if (self.getScrollLeft() >= self.page.maxw) return true;
          } else {
            if (self.getScrollLeft() <= 0) return true;
          }
        }

        var dx = px > 0 ? 1 : -1;

        if (scrolldirx !== dx) {
          if (self.scrollmom) self.scrollmom.stop();
          self.newscrollx = self.getScrollLeft();
          scrolldirx = dx;
        }

        self.lastdeltax -= px;

      }

      if (py) {

        var chk = (function () {
          var top = self.getScrollTop();
          if (py < 0) {
            if (top >= self.page.maxh) return true;
          } else {
            if (top <= 0) return true;
          }
        })();

        if (chk) {
          if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true;
          var ny = self.view.h >> 1;
          if (self.newscrolly < -ny) { self.newscrolly = -ny; py = -1; }
          else if (self.newscrolly > self.page.maxh + ny) { self.newscrolly = self.page.maxh + ny; py = 1; }
          else py = 0;
        }

        var dy = py > 0 ? 1 : -1;

        if (scrolldiry !== dy) {
          if (self.scrollmom) self.scrollmom.stop();
          self.newscrolly = self.getScrollTop();
          scrolldiry = dy;
        }

        self.lastdeltay -= py;

      }

      if (py || px) {
        self.synched("relativexy", function () {

          var dty = self.lastdeltay + self.newscrolly;
          self.lastdeltay = 0;

          var dtx = self.lastdeltax + self.newscrollx;
          self.lastdeltax = 0;

          if (!self.rail.drag) self.doScrollPos(dtx, dty);

        });
      }

    }

    var hasparentscrollingphase = false;

    function execScrollWheel(e, hr, chkscroll) {
      var px, py;

      if (!chkscroll && hasparentscrollingphase) return true;

      if (e.deltaMode === 0) { // PIXEL
        px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0;
        py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0;
      } else if (e.deltaMode === 1) { // LINE
        px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0;
        py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0;
      }

      if (hr && opt.oneaxismousemode && (px === 0) && py) { // classic vertical-only mousewheel + browser with x/y support 
        px = py;
        py = 0;

        if (chkscroll) {
          var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
          if (hrend) {  // preserve vertical scrolling
            py = px;
            px = 0;
          }
        }

      }

      // invert horizontal direction for rtl mode
      if (self.isrtlmode) px = -px;

      var chk = doScrollRelative(px, py, chkscroll, true);

      if (chk) {
        if (chkscroll) hasparentscrollingphase = true;
      } else {
        hasparentscrollingphase = false;
        e.stopImmediatePropagation();
        return e.preventDefault();
      }

    }

    this.onmousewheel = function (e) {
      if (self.wheelprevented||self.locked) return false;
      if (self.railslocked) {
        self.debounced("checkunlock", self.resize, 250);
        return false;
      }
      if (self.rail.drag) return self.cancelEvent(e);

      if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)

      if (opt.oneaxismousemode && e.deltaX === 0) {
        if (!self.rail.scrollable) {
          if (self.railh && self.railh.scrollable) {
            return self.onmousewheelhr(e);
          } else {
            return true;
          }
        }
      }

      var nw = now();
      var chk = false;
      if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
        self.nativescrollingarea = self.isScrollable(e);
        chk = true;
      }
      self.checkarea = nw;
      if (self.nativescrollingarea) return true; // this isn't my business
      var ret = execScrollWheel(e, false, chk);
      if (ret) self.checkarea = 0;
      return ret;
    };

    this.onmousewheelhr = function (e) {
      if (self.wheelprevented) return;
      if (self.railslocked || !self.railh.scrollable) return true;
      if (self.rail.drag) return self.cancelEvent(e);

      var nw = now();
      var chk = false;
      if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
        self.nativescrollingarea = self.isScrollable(e);
        chk = true;
      }
      self.checkarea = nw;
      if (self.nativescrollingarea) return true; // this is not my business
      if (self.railslocked) return self.cancelEvent(e);

      return execScrollWheel(e, true, chk);
    };

    this.stop = function () {
      self.cancelScroll();
      if (self.scrollmon) self.scrollmon.stop();
      self.cursorfreezed = false;
      self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
      self.noticeCursor();
      return self;
    };

    this.getTransitionSpeed = function (dif) {

      return 80 + (dif / 72) * opt.scrollspeed |0;

    };

    if (!opt.smoothscroll) {
      this.doScrollLeft = function (x, spd) { //direct
        var y = self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };
      this.doScrollTop = function (y, spd) { //direct
        var x = self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };
      this.doScrollPos = function (x, y, spd) { //direct
        var nx = (x > self.page.maxw) ? self.page.maxw : x;
        if (nx < 0) nx = 0;
        var ny = (y > self.page.maxh) ? self.page.maxh : y;
        if (ny < 0) ny = 0;
        self.synched('scroll', function () {
          self.setScrollTop(ny);
          self.setScrollLeft(nx);
        });
      };
      this.cancelScroll = function () { }; // direct

    } else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) {

      var lasttransitionstyle = '';

      this.resetTransition = function () {
        lasttransitionstyle = '';
        self.doc.css(cap.prefixstyle + 'transition-duration', '0ms');
      };

      this.prepareTransition = function (dif, istime) {
        var ex = (istime) ? dif : self.getTransitionSpeed(dif);
        var trans = ex + 'ms';
        if (lasttransitionstyle !== trans) {
          lasttransitionstyle = trans;
          self.doc.css(cap.prefixstyle + 'transition-duration', trans);
        }
        return ex;
      };

      this.doScrollLeft = function (x, spd) { //trans
        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollTop = function (y, spd) { //trans
        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };

      this.cursorupdate = {
        running: false,
        start: function () {
          var m = this;

          if (m.running) return;
          m.running = true;

          var loop = function () {
            if (m.running) setAnimationFrame(loop);
            self.showCursor(self.getScrollTop(), self.getScrollLeft());
            self.notifyScrollEvent(self.win[0]);
          };

          setAnimationFrame(loop);
        },
        stop: function () {
          this.running = false;
        }
      };

      this.doScrollPos = function (x, y, spd) { //trans

        var py = self.getScrollTop();
        var px = self.getScrollLeft();

        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection      

        if (!opt.bouncescroll) {
          if (y < 0) y = 0;
          else if (y > self.page.maxh) y = self.page.maxh;
          if (x < 0) x = 0;
          else if (x > self.page.maxw) x = self.page.maxw;
        } else {
          if (y < 0) y = y / 2 | 0;
          else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0;
          if (x < 0) x = x / 2 | 0;
          else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0;
        }

        if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;

        self.newscrolly = y;
        self.newscrollx = x;

        var top = self.getScrollTop();
        var lft = self.getScrollLeft();

        var dst = {};
        dst.x = x - lft;
        dst.y = y - top;

        var dd = Math.sqrt((dst.x * dst.x) + (dst.y * dst.y)) | 0;

        var ms = self.prepareTransition(dd);

        if (!self.scrollrunning) {
          self.scrollrunning = true;
          self.triggerScrollStart(lft, top, x, y, ms);
          self.cursorupdate.start();
        }

        self.scrollendtrapped = true;

        if (!cap.transitionend) {
          if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
          self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
        }

        self.setScrollTop(self.newscrolly);
        self.setScrollLeft(self.newscrollx);

      };

      this.cancelScroll = function () {
        if (!self.scrollendtrapped) return true;
        var py = self.getScrollTop();
        var px = self.getScrollLeft();
        self.scrollrunning = false;
        if (!cap.transitionend) clearTimeout(cap.transitionend);
        self.scrollendtrapped = false;
        self.resetTransition();
        self.setScrollTop(py); // fire event onscroll
        if (self.railh) self.setScrollLeft(px);
        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
        self.timerscroll = false;

        self.cursorfreezed = false;

        self.cursorupdate.stop();
        self.showCursor(py, px);
        return self;
      };

      this.onScrollTransitionEnd = function () {

        if (!self.scrollendtrapped) return;

        var py = self.getScrollTop();
        var px = self.getScrollLeft();

        if (py < 0) py = 0;
        else if (py > self.page.maxh) py = self.page.maxh;
        if (px < 0) px = 0;
        else if (px > self.page.maxw) px = self.page.maxw;
        if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, opt.snapbackspeed);

        if (self.scrollrunning) self.triggerScrollEnd();
        self.scrollrunning = false;

        self.scrollendtrapped = false;
        self.resetTransition();
        self.timerscroll = false;
        self.setScrollTop(py); // fire event onscroll        
        if (self.railh) self.setScrollLeft(px); // fire event onscroll left

        self.cursorupdate.stop();
        self.noticeCursor(false, py, px);

        self.cursorfreezed = false;

      };

    } else {

      this.doScrollLeft = function (x, spd) { //no-trans
        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollTop = function (y, spd) { //no-trans
        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollPos = function (x, y, spd) { //no-trans

        var py = self.getScrollTop();
        var px = self.getScrollLeft();

        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection

        var clipped = false;

        if (!self.bouncescroll || !self.rail.visibility) {
          if (y < 0) {
            y = 0;
            clipped = true;
          } else if (y > self.page.maxh) {
            y = self.page.maxh;
            clipped = true;
          }
        }
        if (!self.bouncescroll || !self.railh.visibility) {
          if (x < 0) {
            x = 0;
            clipped = true;
          } else if (x > self.page.maxw) {
            x = self.page.maxw;
            clipped = true;
          }
        }

        if (self.scrollrunning && (self.newscrolly === y) && (self.newscrollx === x)) return true;

        self.newscrolly = y;
        self.newscrollx = x;

        self.dst = {};
        self.dst.x = x - px;
        self.dst.y = y - py;
        self.dst.px = px;
        self.dst.py = py;

        var dd = Math.sqrt((self.dst.x * self.dst.x) + (self.dst.y * self.dst.y)) | 0;
        var ms = self.getTransitionSpeed(dd);

        self.bzscroll = {};

        var p3 = (clipped) ? 1 : 0.58;
        self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1);
        self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1);

        var loopid = now();

        var loop = function () {

          if (!self.scrollrunning) return;
          var x = self.bzscroll.y.getPos();

          self.setScrollLeft(self.bzscroll.x.getNow());
          self.setScrollTop(self.bzscroll.y.getNow());

          if (x <= 1) {
            self.timer = setAnimationFrame(loop);
          } else {
            self.scrollrunning = false;
            self.timer = 0;
            self.triggerScrollEnd();
          }

        };

        if (!self.scrollrunning) {
          self.triggerScrollStart(px, py, x, y, ms);
          self.scrollrunning = true;
          self.timer = setAnimationFrame(loop);
        }

      };

      this.cancelScroll = function () {
        if (self.timer) clearAnimationFrame(self.timer);
        self.timer = 0;
        self.bzscroll = false;
        self.scrollrunning = false;
        return self;
      };

    }

    this.doScrollBy = function (stp, relative) {
      doScrollRelative(0, stp);
    };

    this.doScrollLeftBy = function (stp, relative) {
      doScrollRelative(stp, 0);
    };

    this.doScrollTo = function (pos, relative) {
      var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
      if (ny < 0) ny = 0;
      else if (ny > self.page.maxh) ny = self.page.maxh;
      self.cursorfreezed = false;
      self.doScrollTop(pos);
    };

    this.checkContentSize = function () {
      var pg = self.getContentSize();
      if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
    };

    self.onscroll = function (e) {
      if (self.rail.drag) return;
      if (!self.cursorfreezed) {
        self.synched('scroll', function () {
          self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y);
          if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x);
          self.noticeCursor();
        });
      }
    };
    self.bind(self.docscroll, "scroll", self.onscroll);

    this.doZoomIn = function (e) {
      if (self.zoomactive) return;
      self.zoomactive = true;

      self.zoomrestore = {
        style: {}
      };
      var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
      var win = self.win[0].style;
      for (var a in lst) {
        var pp = lst[a];
        self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
      }

      self.zoomrestore.style.width = self.win.css('width');
      self.zoomrestore.style.height = self.win.css('height');

      self.zoomrestore.padding = {
        w: self.win.outerWidth() - self.win.width(),
        h: self.win.outerHeight() - self.win.height()
      };

      if (cap.isios4) {
        self.zoomrestore.scrollTop = $window.scrollTop();
        $window.scrollTop(0);
      }

      self.win.css({
        position: (cap.isios4) ? "absolute" : "fixed",
        top: 0,
        left: 0,
        zIndex: globalmaxzindex + 100,
        margin: 0
      });
      var bkg = self.win.css("backgroundColor");
      if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
      self.rail.css({
        zIndex: globalmaxzindex + 101
      });
      self.zoom.css({
        zIndex: globalmaxzindex + 102
      });
      self.zoom.css('backgroundPosition', '0 -18px');
      self.resizeZoom();

      if (self.onzoomin) self.onzoomin.call(self);

      return self.cancelEvent(e);
    };

    this.doZoomOut = function (e) {
      if (!self.zoomactive) return;
      self.zoomactive = false;

      self.win.css("margin", "");
      self.win.css(self.zoomrestore.style);

      if (cap.isios4) {
        $window.scrollTop(self.zoomrestore.scrollTop);
      }

      self.rail.css({
        "z-index": self.zindex
      });
      self.zoom.css({
        "z-index": self.zindex
      });
      self.zoomrestore = false;
      self.zoom.css('backgroundPosition', '0 0');
      self.onResize();

      if (self.onzoomout) self.onzoomout.call(self);

      return self.cancelEvent(e);
    };

    this.doZoom = function (e) {
      return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
    };

    this.resizeZoom = function () {
      if (!self.zoomactive) return;

      var py = self.getScrollTop(); //preserve scrolling position
      self.win.css({
        width: $window.width() - self.zoomrestore.padding.w + "px",
        height: $window.height() - self.zoomrestore.padding.h + "px"
      });
      self.onResize();

      self.setScrollTop(Math.min(self.page.maxh, py));
    };

    this.init();

    $.nicescroll.push(this);

  };

  // Inspired by the work of Kin Blas
  // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js  
  var ScrollMomentumClass2D = function (nc) {
    var self = this;
    this.nc = nc;

    this.lastx = 0;
    this.lasty = 0;
    this.speedx = 0;
    this.speedy = 0;
    this.lasttime = 0;
    this.steptime = 0;
    this.snapx = false;
    this.snapy = false;
    this.demulx = 0;
    this.demuly = 0;

    this.lastscrollx = -1;
    this.lastscrolly = -1;

    this.chkx = 0;
    this.chky = 0;

    this.timer = 0;

    this.reset = function (px, py) {
      self.stop();
      self.steptime = 0;
      self.lasttime = now();
      self.speedx = 0;
      self.speedy = 0;
      self.lastx = px;
      self.lasty = py;
      self.lastscrollx = -1;
      self.lastscrolly = -1;
    };

    this.update = function (px, py) {
      var tm = now();
      self.steptime = tm - self.lasttime;
      self.lasttime = tm;
      var dy = py - self.lasty;
      var dx = px - self.lastx;
      var sy = self.nc.getScrollTop();
      var sx = self.nc.getScrollLeft();
      var newy = sy + dy;
      var newx = sx + dx;
      self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
      self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
      self.speedx = dx;
      self.speedy = dy;
      self.lastx = px;
      self.lasty = py;
    };

    this.stop = function () {
      self.nc.unsynched("domomentum2d");
      if (self.timer) clearTimeout(self.timer);
      self.timer = 0;
      self.lastscrollx = -1;
      self.lastscrolly = -1;
    };

    this.doSnapy = function (nx, ny) {
      var snap = false;

      if (ny < 0) {
        ny = 0;
        snap = true;
      } else if (ny > self.nc.page.maxh) {
        ny = self.nc.page.maxh;
        snap = true;
      }

      if (nx < 0) {
        nx = 0;
        snap = true;
      } else if (nx > self.nc.page.maxw) {
        nx = self.nc.page.maxw;
        snap = true;
      }

      (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd();
    };

    this.doMomentum = function (gp) {
      var t = now();
      var l = (gp) ? t + gp : self.lasttime;

      var sl = self.nc.getScrollLeft();
      var st = self.nc.getScrollTop();

      var pageh = self.nc.page.maxh;
      var pagew = self.nc.page.maxw;

      self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
      self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;

      var chk = l && (t - l) <= 60;

      if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;

      var sy = (self.speedy && chk) ? self.speedy : false;
      var sx = (self.speedx && chk) ? self.speedx : false;

      if (sy || sx) {
        var tm = Math.max(16, self.steptime); //timeout granularity

        if (tm > 50) { // do smooth
          var xm = tm / 50;
          self.speedx *= xm;
          self.speedy *= xm;
          tm = 50;
        }

        self.demulxy = 0;

        self.lastscrollx = self.nc.getScrollLeft();
        self.chkx = self.lastscrollx;
        self.lastscrolly = self.nc.getScrollTop();
        self.chky = self.lastscrolly;

        var nx = self.lastscrollx;
        var ny = self.lastscrolly;

        var onscroll = function () {
          var df = ((now() - t) > 600) ? 0.04 : 0.02;

          if (self.speedx) {
            nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
            self.lastscrollx = nx;
            if ((nx < 0) || (nx > pagew)) df = 0.10;
          }

          if (self.speedy) {
            ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
            self.lastscrolly = ny;
            if ((ny < 0) || (ny > pageh)) df = 0.10;
          }

          self.demulxy = Math.min(1, self.demulxy + df);

          self.nc.synched("domomentum2d", function () {

            if (self.speedx) {
              var scx = self.nc.getScrollLeft();
              //              if (scx != self.chkx) self.stop();
              self.chkx = nx;
              self.nc.setScrollLeft(nx);
            }

            if (self.speedy) {
              var scy = self.nc.getScrollTop();
              //              if (scy != self.chky) self.stop();
              self.chky = ny;
              self.nc.setScrollTop(ny);
            }

            if (!self.timer) {
              self.nc.hideCursor();
              self.doSnapy(nx, ny);
            }

          });

          if (self.demulxy < 1) {
            self.timer = setTimeout(onscroll, tm);
          } else {
            self.stop();
            self.nc.hideCursor();
            self.doSnapy(nx, ny);
          }
        };

        onscroll();

      } else {
        self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
      }

    };

  };


  // override jQuery scrollTop
  var _scrollTop = jQuery.fn.scrollTop; // preserve original function

  jQuery.cssHooks.pageYOffset = {
    get: function (elem, computed, extra) {
      var nice = $.data(elem, '__nicescroll') || false;
      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
    },
    set: function (elem, value) {
      var nice = $.data(elem, '__nicescroll') || false;
      (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value);
      return this;
    }
  };

  jQuery.fn.scrollTop = function (value) {
    if (value === undefined) {
      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
    } else {
      return this.each(function () {
        var nice = $.data(this, '__nicescroll') || false;
        (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value);
      });
    }
  };

  // override jQuery scrollLeft
  var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function

  $.cssHooks.pageXOffset = {
    get: function (elem, computed, extra) {
      var nice = $.data(elem, '__nicescroll') || false;
      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
    },
    set: function (elem, value) {
      var nice = $.data(elem, '__nicescroll') || false;
      (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value);
      return this;
    }
  };

  jQuery.fn.scrollLeft = function (value) {
    if (value === undefined) {
      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
    } else {
      return this.each(function () {
        var nice = $.data(this, '__nicescroll') || false;
        (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value);
      });
    }
  };

  var NiceScrollArray = function (doms) {
    var self = this;
    this.length = 0;
    this.name = "nicescrollarray";

    this.each = function (fn) {
      $.each(self, fn);
      return self;
    };

    this.push = function (nice) {
      self[self.length] = nice;
      self.length++;
    };

    this.eq = function (idx) {
      return self[idx];
    };

    if (doms) {
      for (var a = 0; a < doms.length; a++) {
        var nice = $.data(doms[a], '__nicescroll') || false;
        if (nice) {
          this[this.length] = nice;
          this.length++;
        }
      }
    }

    return this;
  };

  function mplex(el, lst, fn) {
    for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]);
  }
  mplex(
    NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
    function (e, n) {
      e[n] = function () {
        var args = arguments;
        return this.each(function () {
          this[n].apply(this, args);
        });
      };
    }
  );

  jQuery.fn.getNiceScroll = function (index) {
    if (index === undefined) {
      return new NiceScrollArray(this);
    } else {
      return this[index] && $.data(this[index], '__nicescroll') || false;
    }
  };

  var pseudos = jQuery.expr.pseudos || jQuery.expr[':'];  // jQuery 3 migration
  pseudos.nicescroll = function (a) {
    return $.data(a, '__nicescroll') !== undefined;
  };

  $.fn.niceScroll = function (wrapper, _opt) {
    if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
      _opt = wrapper;
      wrapper = false;
    }

    var ret = new NiceScrollArray();

    this.each(function () {
      var $this = $(this);

      var opt = $.extend({}, _opt); // cloning

      if (wrapper || false) {
        var wrp = $(wrapper);
        opt.doc = (wrp.length > 1) ? $(wrapper, $this) : wrp;
        opt.win = $this;
      }
      var docundef = !("doc" in opt);
      if (!docundef && !("win" in opt)) opt.win = $this;

      var nice = $this.data('__nicescroll') || false;
      if (!nice) {
        opt.doc = opt.doc || $this;
        nice = new NiceScrollClass(opt, $this);
        $this.data('__nicescroll', nice);
      }
      ret.push(nice);
    });

    return (ret.length === 1) ? ret[0] : ret;
  };

  _win.NiceScroll = {
    getjQuery: function () {
      return jQuery;
    }
  };

  if (!$.nicescroll) {
    $.nicescroll = new NiceScrollArray();
    $.nicescroll.options = _globaloptions;
  }

}));